ĐỀ CƯƠNG ÔN THI ĐẠI HỌC MÔN HOÁ

0
1311
ĐỀ CƯƠNG ÔN THI ĐẠI HỌC MÔN HOÁ
QUẢNG CÁO
Vài Phút Quảng Cáo Sản Phẩm


ĐỀ CƯƠNG ÔN THI ĐẠI HỌC MÔN HOÁ

Mọi ý kiến đóng góp xin gửi vào hòm thư: [email protected]

Tổng hợp các đề cương đại học hiện có của Đại Học Hàng HảiĐề Cương VIMARU 

Kéo xuống để Tải ngay đề cương bản PDF đầy đủ: Sau “mục lục” và “bản xem trước”

(Nếu là đề cương nhiều công thức nên mọi người nên tải về để xem tránh mất công thức)

Đề cương liên quan: Bộ đề luyên thi đại học toán năm 2011


Mục Lục

Quảng Cáo

Tải ngay đề cương bản PDF tại đây: ĐỀ CƯƠNG ÔN THI ĐẠI HỌC MÔN HOÁ

ĐỀ CƯƠNG ÔN THI ĐẠI HỌC MÔN HOÁ – CHƯƠNG I RƯỢU (ANCOL)­ PHENOL

 

CHƯƠNG I

RƯỢU (ANCOL)- PHENOL – AMIN

 

RƯỢU (ANCOL)

Câu 1. Dãy nào gồm các công thức của rượu đã viết không đúng?

  1. CnH2n+1OH; C3H6(OH)2; CnH2n+2O B. CnH2nOH; CH3-CH(OH)2;  CnH2n-3O                                       
  2. CnH2nO; CH2(OH)-CH2(OH); CnH2n+2On                                                                            D. C3H5(OH)3; CnH2n-1OH;  CnH2n+2O

Câu 2.  Câu nào sau đây là câu đúng:

  1. Ancol là hợp chất hữu cơ trong phân tử có nhóm –OH. B. Hợp chất CH3 – CH2 – OH là ancol etylic
  2. Hợp chất C6H5 – CH2 – OH là phenol. D. Oxi hóa hoàn toàn ancol thu được anđehit

Câu 3.  Tên quốc tế (danh pháp IUPAC) của rượu sau là gì?

CH3

 
   

CH- CH2– CH- CH3

       
       

OH            CH3

  1. 1,3-Đimetylbutanol-1 B. 4,4-Đimetylentanol-2 C. 2- metyl pentanol- 4                      D. 4-metyl pentanol-2

Câu 4. Số đồng phân có cùng có công thức phân tử C4H10O là :

  1. 4 đồng phân C. 6 đồng phân                 B. 7 đồng phân                                    D. 8 đồng phân

Hãy chọn đáp án đúng.

Câu 5.  Rượu nào dưới đây thuộc dãy đồng đẳng có công thức chung CnH2n­O?

  1. CH3CHOH B. CH2 = CH-CHOH                          C. C6H5CHOH                                    D. CH2OH – CHOH

Câu 6. Số đồng phân rượu ứng với công thức phân tử: C3H8O, C4H10O, C5H12O lần lượt bằng:

  1. 2, 4, 8 B. 0, 3,7                                 C. 2, 3, 6                                                D. 1, 2, 3

Hãy chọn đáp án đúng.

Câu 7. Tên gọi nào dưới đây không đúng là của hợp chất (CH3)2CHCH2CH2OH?

  1. 3-metyl butanol-1 B. Rượu iso-pentylic                 C. Rượu iso-amylic                             D. 2-metylbutanol-4.

Câu 8. Công thức tổng quát của rượu no đơn chức bậc 1 có công thức nào sau đây:

  1. R-CH2OH B. CnH2n+1OH                                      C. CnH2n+1CH2OH                                                D. CnH2n+2O

 

Câu 10. Theo danh pháp IUPAC, tên gọi nào sau đây không đúng với công thức?

  1. 2-metylhexaol-1 ó CH3-CH2-CH2-CH2-CH(CH3) -CH2-OH              B. 4,4-đimetylpentanol-2  ó CH3-C(CH3)2-CH(OH)-CH3
  2. 3-etylbutanol-2 ó CH3-CH(C2H5)-CH(OH)-CH3                                 D. 3-metylpentanol-2 ó CH3-CH2-CH(CH3)-CH(OH)-CH3

Câu 11.Một rượu no có công thức nghiệm (C2H5O)n. Vậy CTPT của rượu là công thức nào?

  1. C6H15O3 B. C4H10O2 C. C4H10O                                              B. C6H14O3

Câu 12. Chất nào sau đây không nên sử dụng để làm khan rượu?

  1. CaO B. C2H5ONa C. H2SO4 đặc                                        D. Mg(ClO4)2

Câu 13. Liên kết hiđro bền nhất trong hỗn hợp metanol-nước theo tỉ lệ mol 1:1 là liên kết nào?

  1. … O – H … O – H … B. … O – H … O – H …        

  H             CH3                                                                                                      CH3             H

  1. … O – H … O – H … D. … O – H … O – H …        

   CH3        CH3                                                                                                      H                       H

Câu 14. Khối lượng riêng của etanol và benzen lần lượt là 0,78g/ml và 0,88 g/ml. Khối lượng riêng của một hỗn hợp gồm 600ml etanol và 200ml C6H6 là bao nhiêu? Biết rằng các khối lượng riêng được đo trong cùng điều kiện giả sử khi pha trộn thể tích hỗn hợp tạo thành bằng tổng thể tích các chất pha trộn.

  1. 0,805 g/ml B. 0,795 g/ml C. 0,826 g/ml                                        D. 0,832 g/ml

Câu 15. Trong rượu 900 có thể tồn tại 4 điều kiện hiđro. Kiểu chiếm đa số là kiểu nào?

  1. … O – H … O – H … B. … O – H … O – H …        
           
     
         
 

    C2H5   C2H5                                                                                                       H             C2H5

  1. … O – H … O – H … D. … O – H … O – H …        

  C2H5        H                                                                                                             H                 H

Câu 16. Trong dãy đồng đẳng của rượu no đơn chức, khi mạch cacbon tăng, nói chung:

  1. Nhiệt độ sôi tăng, khả năng tan trong nước tăng B. Nhiệt độ sôi tăng, khả năng tan trong nước giảm
  2. Nhiệt độ sôi giảm, khả năng tan trong nước tăng D. Nhiệt độ sôi giảm, khả năng tan trong nước giảm

Hãy chọn đáp đúng.

Câu 17. Đun nóng rượu A với H2SO4 đậm đặc ở 1700C thu được 1olefin duy nhât. Công thức tổng quát của rượu A là công thức nào?

  1. CH2n+1CH2OH B. CH2n+1OH                                       C. CH2n+1O                                           D. CH2n-1CH2OH

Câu  18.Dung dịch rượu etylic 250 có nghĩa là

  1. 100 gam dung dịch có 25 ml rượu etylic nguyên chất. B. 100 ml dung dịch có 25 gam rượu etylic nguyên chất.
  2. 200 gam dung dịch có 50 gam rượu etylic nguyên chất D. 200 ml dung dịch có 50 ml rượu etylic nguyên chất.

Câu 19. Trong dung dịch rượu (B) 94% (theo khối lượng), tỉ lệ số mol rượu: nước = 43:7 (B) có công thức hóa học như thế nào?

  1. CH3OH B. C2H5OH                                            C. C3H7OH                                            D. C4H9OH

Câu 20. Phương pháp điều chế etanol nào sau đây chỉ dùng trong phòng thí nghiệm

  1. Cho hỗn hợp khí etilen và hơi nước đi tháp chứa H3PO4 B. Cho  etilen tác dụng với dung dịch H2SO4 loãng, nóng
  2. Lên men glucozơ. D. Thủy phân dẫn xuất halogen trong môi trường kiềm.

Câu 21. Phương pháp sinh hóa điều chế rượu etylic là phương pháp nào?

  1. Hiđrat hóa anken B. Thủy phân dẫn xuất halogen trong dung dịch kiềm
  2. Lên men rượu. D.  Hiđro hóa anđehit

Câu 22. Rượu etylic có thể điều chế trực tiếp từ chất nào?

  1. Metan B. Etanal                                               C. Etilenglicol                                       D. Dung dịch saccarozơ

Câu 23. Rượu etylic không thể điều chế trực tiếp bằng một phản ứng từ chất nào?

  1. Etilen B. Etanal                                               C. Metan                                               D. Dung dịch saccarozơ

Câu 24. Sản phẩm chính của phản ứng cộng nước vào propilen (xúc tác H2SO4 loãng) là chất nào?

  1. rượu isopropylic B. rượu n-propylic C. rượu etylic                                        D. rượu sec-butylic

Câu 25. X là rượu bậc II, công thức phân tử C6H14O. Đun X với H2SO4 đặc ở 1700C chỉ tạo một anken duy nhất. Tên của X là gì?

  1. 2,2-Đimetylbutanol-3 B. 3,3-Đimetybutanol-2 C. 2,3-Đimetylbutanol-3              D. 1,2,3-Trimetylbutanol-1

Câu 26. X là hỗn hợp gồm 2 rượu đồng phân cùng CTPT C4H10O. Đun X với H2SO4 ở 1700C chỉ được một anken duy nhất. Vậy X gồm các chất nào?

  1. Butanol-1 và butanol-2 B. 2-Metylprapanol-1 và 2-metylpropanol-2.
  2. 2-Metylprapanol-1 và butanol-1 D. 2-Metylprapanol-1 và butanol-2

Câu 27. Đốt 11g chất hữu cơ X được 26,4g CO2 và 5,4 g H2O. Biết Mx < 150 (g/mol). Công thức phân tử của X là công thức nào?

  1. C3H3O B. C6H6O2                                              C. C4H8O2                                              D. C8H10O

Câu 28. Đốt hết 6,2 gam rượu Y cần 5,6 lít O2(đktc) được CO2 và hơi H2O theo tỉ lệ ;  = 2:3. Công thức phân tử của Y là công thức nào?

  1. CH4O B. C2H6O                                               C. C2H6O2                                              D. C3H8O2

Câu 29. Oxi hóa 4 gam rượu đơn chức Z bằng O2 (có mặt xúc tác) thu được 5,6 gam hỗn hỡp gồm anđehit, rượu và nước. Tên của Z và hiệu suất phản ứng là ở đáp án nào?

  1. Metanol; 7,5% B. Etanol; 75% C. Propanol-1; 80%                            D. Metanol; 80%

Câu 30. Hỗn hợp khí X gồm 2 anken đồng đẳng kế tiếp. Đốt hoàn toàn 5 lít X cần 18 lít O­2 (cùng điều kiện). Hiđrat hóa hoàn toàn một thể thích X ở điều kiện thích hợp cho hỗn hợp Y chứa 2 rượu. % khối lượng mỗi rượu trong Y tương ứng là bao nhiêu?

  1. 11,12% và 88,88% B. 91,48% và 8,52% C. 84,26% và 10,74%                        D. 88,88% và 11,12%

Câu 31. Đốt cháy hỗn hợp 2 rượu đơn chức cùng dãy đồng đẳng có số mol bằng nhau, ta thu được khí CO2 và hơi H2O với tỉ lệ mol : = 3 : 4. Công thức phân tử 2 rượu là công thức nào?

  1. CH4O và C3H8O B. C2H6O và C4H10O C. C2H6O và C3H8O                            D. CH4O và C2H6O

Câu 32. Cho hỗn hợp rượu metylic từ từ đi qua ống chứa đồng oxit nóng đỏ. Toàn bộ sản phẩm khí của phản ứng được đưa vào một dãy ống chữ U lần lượt chứa H2SO4 đặc và dung dịch KOH dư. Sau thí nghiệm, khối lượng ống chứa H2SO4 tưng 54 gam và khối lượng ống chứa KOH tăng 73,33 gam. Khối lượng của mỗi rượu tham gia phản ứng tương ứng là bao nhiêu gam?

  1. 32; 7,5 B. 30,0; 12,0                                         C. 22; 11,5                                            D. 32; 15,33

Câu 33. Cho hỗn hợp gồm không khí (dư) và hơi của 24g metanol đi qua chất xúc tác Cu nung nóng người ta được 40ml fomalin 36% có khối lượng riêng bằng 1,1 g/ml. Hiệu suất của quá trình trên là bao nhiêu?

  1. 80,4% B. 70,4%                                               C. 65,5%                                               D. 76,6%

Câu 34. Đun một rượu P với hỗn hợp (lấy dư) KBr và H2SO4 đặc, thu được chất hữu cơ Q. Hơi của 12,3g Q nói trên chiếm một thể tích bằng thể tích của 2,8g nitơ trong cùng điều kiện. Khi đun nóng với CuO, rượu P không tạo thành anđehit. Công thức cấu tạo P là công thức nào?

  1. CH3OH B. C2H5OH                 C. CH2CH2CH2OH                              D. CH3CH(OH)CH3

Câu 35. Đun 57,5g etanol với H2SO4 đậm đặc ở 1700C. Dẫn các sản phẩm khí và hơi lần lượt đi qua các bình chứa riêng rẽ các chất: CuSO4 khan; dung dịch NaOH; dung dịch (dư) brom trong CCl4 . Sau thí nghiệm, khối lượng bình cuối cùng tăng thêm 2,1g. Hiệu suất chung của quá trình đehitđrat hóa etanol là bao nhiêu?

  1. 59%                 B. 55%                                                   C. 60%                                                   D. 70%

Câu 36. Đun 1,66g hỗn hợp hai rượu với H2SO4 đậm đặc thu được hai anken đồng đẳng kế tiếp của nhau. Hiệu suất phản ứng giả thiết là 100%. Nếu đốt hỗn hợp anken đó cần dùng 2,688 lít O2 (đktc). Tìm công thức cấu tạo hai rượu biết ete tạo thành từ hai rượu là ete có mạch nhánh.

  1. C2H5OH, CH3CH2OH                                                                 B. C2H5OH, (CH3)2CHOH                
  2. (CH3)2CHOH, CH3(CH2)3OH D. (CH3)2CHOH, (CH3)3COH

Câu 37. Cho 1,24g hỗn hợp hai rượu đơn chức tác dụng vừa đủ với Na thấy thoát ra 336ml H2 (đktc). Hỗn hợp các chất chứa Na được tạo ra có khối lượng là bao nhiêu?

  1. 1,93g                 B. 2,83g                                                 C. 1,9g                                                   D. 1,47g

Câu 38. Khử nước hai rượu đồng đẳng hơn kém nhau hai nhóm –CH2 ta thu được hai anken ở thể khí. Vậy công thức phân tử của hai rượu là ở đáp án nào sau đây?

  1. CH3OH và C3H7OH C3H7OH và C5H11OH C. C2H4O và C4H8O                            D. C2H6O và C4H10O

Câu 39. Một chất khí bị oxi hóa bởi CuO cho sản phẩm có khả năng tham gia phản ứng tráng gương. Chất đó là chất nào?

  1. Rượu isoproylic B. Rượu tert-butylic C. Rượu n-propylic                              D. Rượu sec-butylic

Câu 40. Một ankanol A có 60% cacbon theo khối lượng trong phân tử. Nếu cho 18gam A tác dụng hết với Na thì thể tích khí hiđro thoát ra (ở đktc) là bao nhiêu lít?

  1. 1,12 lít B. 2,24 lít                                              C. 3,36 lít                                              D. 4,48 lít

Câu 41. Anken sau đây:   CH3 – CH = C(CH3)2                  là sản phẩm loại nước của rượu nào?

  1. 2-Metylbutanol-1 B. 2,2-Đimetylpropanol-1 C. 2-Metylbutanol-2                           D. 3-Metylbutanol-1

Câu 42. Đồng phân nào của C4H9OH khi tách nước sẽ cho 2 olefin đồng phân?

  1. 2-Metylpropanol-1 B. 2-Metylpropan ol-2 C. Butanol-1                                         D. Butan ol -2

Câu 43. Đun nóng từ từ hỗn hợp etanol và propanol-2 với xúc tác H2SO4 đậm đặc, có thể thu được tối đa bao nhiêu sản phẩm hữu cơ chỉ chứa tối đa 3 nguyên tố C, H, O?

  1. 2 sản phẩm B. 3 sản phẩm C. 4 sản phẩm                                      D. 5 sản phẩm

Câu 44. Rượu nào dưới đây khó bị oxi hóa nhất?

  1. 2-Metylbutanol-1 B. 2-Metylbutanol-2 C. 3-Metylbutanol-2                           D. 3-Metylbutanol-1

Câu 45. Cho natri tác dụng hoàn toàn với 18,8 gam hỗn hợp hai rượu no đơn chức kế tiếp trong dãy đồng đẳng sinh ra 5,6 lít khí H2 (đktc). Công thức phân tử của hai rượu là ở đáp án nào dưới đây?

  1. CH3OH và C2H5OH B. C3H7OH và C4H9OH C. C2H5OH và C3H7OH                      D. C4H9OH và C5H11OH

Câu 46. Cho 1,24 gam hỗn hợp 2 rượu đơn chức tác dụng vừa đủ với Na thấy thoát ra 336ml H2 (đktc). Hỗn hợp các chất chứa natri tạo ra có khối lượng là bao nhiêu?

  1. 1,93 gam B. 2,93gam C. 1,90 gam                                          D. 1,47gam

Câu 47. Chia m gam hỗn hợp hai rượu thành hai phần bằng nhau.

Phần 1: Đốt cháy hoàn toàn, thu được 2,24 lít khí CO2 (đktc).

Phần 2: Đehiđrat hóa hoàn toàn thu được hỗn hợp 2 anken. Nếu đốt cháy hết 2 anken thì thu được bao nhiêu gam nước?

  1. 0,36 gam B. 0,9 gam C. 0,54 gam                                          D. 1,8 gam

Câu 48. Chia hỗn hợp X gồm hai rượu no đơn chức thành hai phần bằng nhau. Đốt cháy hết phần (1) thu được 5,6 lít CO2 (đktc) và 6,3 g nước. Phần (2) tác dụng hết với natri thì thấy thoát ra V lít khí (đktc). Thể tích V là bao nhiêu lít?

  1. ,12 lít B. 0,56 lít C. 2,24 lít                                              D. 1,68 lít

Câu 49. Đốt cháy hết hỗn hợp gồm hai rượu no đơn chức kế tiếp nhau trong dãy đồng đẳng thu được 5,6 lít CO2 (đktc) và 6,3 g nước. Công thức phân tử của hai rượu là:

  1. C2H4O và C3H6O B. CH3OH và C2H5OH C. C2H5OH và C3H7OH                      D. C3H7OH và C4H9OH

Câu 50. Đốt cháy hết hỗn hợp gồm hai rượu no đơn chức kế tiếp nhau trong dãy đồng đẳng thu được 11,2 lít CO2 (đktc) và 12,6 g nước. Thành phần % theo khối lượng của mỗi rượu trong hỗn hợp là ở đáp án nào đây?

  1. 43,4% và 56,6% B. 25% và 75% C. 50% và 50%                                    D. 44,77% và 55,23%

Câu 51. Etanol được dùng làm nhiên liệu. Tính nhiệt tỏa ra khi đốt cháy hoàn toàn 10ml etanol tuyệt đối (D=0,8 g/ml). Biết rằng:

C2H5OH + 3O2 -> 2CO2 + 3H2O + 1374 kJ

  1. 298,50 kJ B. 238,96kJ C. 276,60 kJ                                         D. 402,70kJ

Câu 52. Rượu nào sau đây khi tách nước tạo 1 anken duy nhất?

  1. Rượu metylic B. Rượu butanol-2 C. Rượu benzylic                                                 D. Rượu isopropylic

Câu 53. Đốt cháy một ete E đơn chức thu được khí CO2 và hơi nước theo tỉ lệ số mol n(CO2) : n(H2O) = 5:6. E là ete tạo ra từ rượu nào?

  1. Rượu etylic                                                                 B.   Rượu metylic và rượu etylic
  2. Rượu metylic và rượu isopropylic D.  Rượu etylic và rượu isopropylic

Câu 54. Cho các chất : C2H5Cl (I); C2H5OH (II); CH3COOH (III); CH3OOC2H5 (IV). Trật tự tăng dần nhiệt độ sôi của các chất trên (từ trái sang phải) như thế nào là đúng?

  1. (I), (II), (III), (IV) B. (II), (I),(III), (IV) C. (I), (IV), (II), (III)                            D. (IV), (I),(III), (II)

Câu 55. Cho 1,06 g hỗn hợp hai rượu đơn chức đồng đẳng liên tiếp tác dụng hết với Na thu được 224ml H2(đktc). Công thức phân tử của hai rượu là ở dãy nào?

  1. CH3OH và C2H5OH B. C2H5OH và C3H7OH C. C3H5OH và C4H7OH                      D. C4H9OH và C5H10OH

Câu 56. Đehiđrat hóa rượu bậc hai M thu được olefin. Cho 3 gam M tác dụng với Na dư thu được 0,56lít H2 (đktc). Đun nóng M với H2SO4 đặc ở 1300C thì sản phẩm tạo thành là chất nào?

  1. Propen B. Điisopropyl ete                                C. Buten-2                                            D. đi sec-butylete

Câu 57. Cho các chất:       (I) CH3CH(OH) CH2CH3                   (II) CH3CH2OH

(III) (CH3)3COH                                  (IV) CH3CH(OH)CH3

Chất nào khi đề hiđrat hóa tạo được 3 anken?

  1. (I) B. (II) và (III)                                       C. (IV)                                                    D. (II)

Câu 58. Rượu nào dưới đây khi oxi hóa không hoàn toàn tạo ra xeton?

  1. rượu n-butylic B. rượu isobutylic C. rượu sec-butylic                              D. rượu tert-butylic

Câu 59. Cho các chất CH4 (I); CH º CH (II); HCHO (III); CH2Cl2 (IV); CH3Cl (V); HCOOCH3 (VI). Chất có thể trực tiếp điều chế metanol là những chất nào?

  1. (II), (III), (V), (VI) B. (I), (III), (IV), (V) C. (I), (III), (V), (VI)                            D. (II), (III), (VI)

Câu 60. Cho sơ đồ chuyển hóa sau:  M C3H6Br2 Nanđehit 2 chức

Kết luận nào sau đây đúng?

  1. M là C3H6 và N là CH3CH(OH) CH2(OH) B. M là C3H6 và N là CH2(OH)CH2CH2(OH)
  2. M là xiclopropan và N là CH2(OH)CH2CH2(OH) D. M là C3H8, N là glierin (glixerol) C3H5(OH)3

Câu 61. Cho sơ đồ : Xenlulozơ  C6H12O6   C2H5OH   C4H6  Cao su buna.

Khối lượng gỗ cần để sản xuất 1 tấn cao su là bao nhiêu?

  1. » 24,797 tấn B. » 12,4 tấn C. » 1 tấn                                              B. » 22,32 tấn

Câu 62. Cho sơ đồ chuyển hóa: (X) C4H10O  X1   X2  X3   đi xeton

Công thức cấu tạo của X có thể là công thức nào?

  1. CH2(OH)CH2CH2CH3 B. CH3CH(OH)CH2CH3                     C. CH3CH(CH3)CH2OH                     D. CH3C(CH3)2OH

Câu 63. Cho sơ đồ chuyển hóa: X   +   H2O   X1   C2H6O

Công thức cấu tạo của X là công thức nào?

  1. CH3CHO                                 B.  CH2 = CH2                                      C. CH º CH                                          D. CH3C(CH3)2OH

Câu 64. Tách nước hoàn toàn hỗn hợp rượu X ta thu được hỗn hợp Y gồm các olefin. Nếu đốt cháy hoàn toàn X để thu được 1,76gam CO2 thì khi đốt cháy hoàn toàn Y, tổng khối lượng H2O và CO2 tạo ra là bao nhiêu gam?

  1. 2,94g B. 2,48g C. 1,76g                                                 D. 2,76g

Câu 65. Cho 11 gam hỗn hợp hai rượu no đơn chức, kế tiếp nhau trong dãy đồng đẳng tác dụng hết với Na dư thu được 3,36 lít H2 (đktc). Hai rượu đó là ở đáp án nào?

  1. C2H5OH và C3H7OH B. C4H9OH và C5H11OH C. C3H7OH và C4H9OH                      D. CH3OH và C2H5OH

Câu 66. Cho 0,1 mol rượu X phản ứng hết với Na dư thu được 2,24 lít khí H2(đktc). Số nhóm chức-OH của rượu X là bao nhiêu?

  1. 3 B. 1 C. 4                                                         D. 2

Câu 67. Dãy đồng đẳng của rượu etylic có công thức chung là ở đáp án nào sau đây?

  1. CnH2n-1OH (n³3) B. CnH2n+1OH (n³1) C. CnH2n+2-x (OH)x (n³x, x>1)             D. CnH2n-7OH (n³6)

Câu 68. Dãy gồm các chất đều phản ứng được với C2H5OH là :

  1. Na, HBr, CuO B. CuO, KOH, HBr                              C. Na, Fe, HBr                                      D. NaOH, Na, HBr

Câu 69. Khi điều chế C2H4 từ C2H5OH và H2SO4 đặc ở 1700C thì khí sinh ra có lẫn SO2. Để thu được C2H4 tinh khiết có thể loại bỏ SO2 bằng chất nào sau đây?

  1. dung dịch Br2 B. dung dịch KOH                               C. Dung dịch K2CO3                            D. dung dịch KMnO4

Câu 70. Đốt cháy hoàn toàn 1,80g một hh chất hữu cơ X thu được 3,96g CO2 và 2,16g H2O. Tỉ khối hơi của X so với không khí bằng 2,069. X tác dụng được với Na, bị oxi hóa bởi oxi khi có Cu xúc tác tạo ra anđehit. Công thức cấu tạo của X là công thức nào?

  1. n-C3H7OH B. C3H5OH C. C3H8O2                                              D. iso-C3H7OH

C.2 PHENOL

 

Câu 1. Phenol là những hợp chất hữu cơ mà phân tử của chúng có nhóm hiđroxyl

  1. liên kết với nguyên tử cácbon no của gốc hiđrocacbon. B. liên kết trực tiếp với nguyên tử cacbon của vong benzen
  2. liên kết với nguyên tử cacbon no của gốc hiđrocacbon không no D. gắn trên nhánh của hiđrocacbon thơm.

Câu 2. Số đồng phân thơm có cùng công thức phân tử C7H8O vừa tác dụng được với Na vừa tác dụng được với NaOH là bao nhiêu?

  1. 3 B. 1 C. 2                                                         D. 4

Câu 3. Cho chất hữu cơ X có công thức phân tử C6H6O2. Biết X tác dụng với KOH theo tỉ lệ mol 1 : 2. Vậy số đồng phân cấu tạo của X là bao nhiêu?

  1. 1 B. 2 C. 3                                                         D. 4

Câu 4. Nguyên tử hiđro trong nhóm –OH của phenol có thể được thay thế bằng nguyên tử Na khi cho:

  1. phenol tác dụng với Na B. phenol tác dụng với NaOH C. phenol tác dụng với NaHCO3      D. cả A và B đều đúng

Câu 5. X là một dẫn xuất của benzen, không phản ứng với dung dịch NaOH, có công thức phân tử C7H8O. Số đồng phân phù hợp của X là bao nhiêu?

  1. 2 đồng phân B. 3 đồng phân                                    C. 4 đồng phân                                    D. 5 đồng phân

Câu 6. Cho các chất: C6H5OH (X), CH3-C6H4-OH (Y), C6H5 –CH2OH (Z). Cặp các chất đồng đẳng của nhau là cặp chất nào?

  1. X và Y B. Y và Z C. X và Z                                               D. X, Y và Z

Câu 7. Trong các câu sau đây, câu nào không đúng?

  1. Phenol cũng có liên kết hiđro liên phân tử B. Phenol có liên kết hiđro với nước
  2. Nhiệt độ sôi của phenol thấp hơn nhiệt độ sôi của etylbenzen D. Phenol ít tan trong nước lạnh

Câu 8. Câu nào sau đây không đúng?

  1. Phenol là chất rắn, tinh thể không màu, có mùi đặc trưng C. Phenol dễ tan trong nước lạnh.
  2. Để lâu ngoài không khí, phenol bị oxi hóa một phần nên có màu hồng D. Phenol rất độc, gây bỏng nặng đối với da

Câu 9. Nhận xét nào dưới đây không đúng?

  1. Phenol là axit, còn anilin là bazơ
  2. Dung dịch phenol làm quý tìm hóa đỏ, còn dung dịch anilin làm quý tím hóa xanh.
  3. Phenol và anilin đều dễ tham gia phản ứng cộng và đều tạo hợp chất vòng no khi tham gia phản ứng cộng với hiđro.

Câu 10. Phản ứng: C6H5ONa + CO2 + H2O -> C6H5OH + NaHCO3 xảy ra được là do:

  1. Phenol có tính axit yếu hơn axit cacbonic B. Phenol có tính axit mạnh hơn axit cacbonic
  2. Phenol có tính oxi hóa yếu hơn axit cacbonic . D. Phenol có tính oxi hóa mạnh hơn axit cacbonic.

Hãy chọn đáp án đúng

Câu 11. Dung dịch phenol không phản ứng được với chất nào sau đây?

  1. Natri và dung dịch NaOH B. Nước brom C. Dung dịch NaCl              D. Hỗn hợp axit HNOvà H2SO4 đặc

Câu 12. Hợp chất X tác dụng với Na nhưng không phản ứng với NaOH. X là chất nào trong số các chất cho dưới đây?

  1. C6H5CH2OH B. p-CH3C6H4OH C. HOCH2C6H4OH                              D. C6H5-O-CH3

Câu 13. Cho 18,4 gam 2,46-trinitrophenol vào một chai bằng gang có thể tích không đổi 560 cm3(không có không khí). Đặt kíp nổ vào chai rồi cho nổ ở 19110C. Tính áp suất trong bình tại nhiệt độ đó biết rằng sản phẩm nổ là hỗn hợp CO, CO2 , N2 (trong đó tỉ lệ thể tích VCO : = 5 : 1) và áp suất thực tế nhỏ hơn áp suất lí thuyết 8%.

  1. 207,36 atm B. 211,968 atm B. 211,968 atm                 C. 201 atm B. 223,6 atm                   D. 223,6 atm

Câu 14. Cho dãy chuyển hóa điều chế sau: Toluen  X   Y   D.  D là chất nào:

  1. Benzyl clorua B. m-Metylphenol                              
  2. o-Metylphenol và p-metylphenol                 D. o-Clo toluen và p-clotoluen

Câu 15. Cho 4 chất: phenol, rượu benzylic, axit axetic, rượu etylic. Độ linh động của nguyên tử hiđro trong phân tử các chất trên giảm dần theo thứ tự ở dãy nào?

  1. phenol > rượu benzylic > axit axetic > rượu etylic B. rượu benzylic > rượu etylic > phenol > axit axetic
  2. axit axetic > phenol > rượu etylic > rượu benzylic D. axit axetic > rượu etylic > phenol > rượu benzylic

***************************

Câu 17 Phát biển nào sau đây đúng?

(1)           Phenol có tính axit mạnh hơn etanol vì nhân bezen hút electron của nhóm –OH bằng hiệu ứng liên hợp, trong khi nhóm –C2H5 lại đẩy electron vào nhóm –OH.

(2)           Phenol có tính axit mạnh hơn etanol và được minh hoạt bằng phản ứng phenol tác dụng với dung dịch NaOH còn C2H5OH thì không.

(3)           Tính axit của phenol yếu hơn H2CO3 vì sục CO2 vào dung dịch C6H5ONa ta sẽ được C6H5OH.

(4)           Phenol trong nước cho môi trường axit, làm quý tím hóa đỏ.

  1. (1), (2) B. (2), (3)                                               C. (3), (1)                                               D. (1), (2), (3)

Câu 18 Trong số  các dẫn xuất của benzen có công thức phân tử C8H10O, có bao nhiêu đồng phân (X) thỏa mãn các điều kiện sau:

(X)  +  NaOH   ->  không phản ứng

(X) (Y)   polime (Z)                        

  1. 1 B. 2                                                         C. 3                                                         D. 4

Câu 19.  (Y) là một đồng phân (cùng nhóm chức) với (X). Cả 2 đều là sản phẩm trung gian khi điều chế nhựa phenolfomanđehit từ phenol và anđehit fomic. (X), (Y) có thể là:

  1. Hai đồng phân o- và p – HOC6H4CH2OH B. Hai đồng phân o- và m – HOC6H4CH2OH
  2. Hai đồng phân m- và p – HOC6H4CH2OH D. Hai đồng phân o- và p – CH3C6H3(OH)2

Hãy chọn đáp án đúng

Câu 20.  Hợp chất hữu cơ X được điều chế từ etylbenzen theo sơ đồ:

                                Etyl benzen  X    Y   Z. 

Vậy Z có công thức cấu tạo là:

  1. Đồng phân o- của O2N-C6H4-COOC2H5 B. Đồng phân m- của O2N-C6H4-COOC2H5
  2. Đồng phân p- của O2N-C6H4-COOC2H5 D.  Hỗn hợp đồng phân o- và p- của O2N-C6H4-COOC2H5

 Hãy chọn đáp án đúng.

****************************

Câu 22.Có 4 hợp chất: phenol, benzen, axit axetic, rượu etylic.Thứ tự các chất hóa học dùng làm thuốc thử để phân biệt 4 chất đó là:

  1. Dùng Na nhận ra rượu, dùng quỳ tím nhận ra axit, dùng nước brom nhận ra phenol, còn lại là benzen.
  2. Dùng dung dịch NaOH nhận ra axit, dùng nước brom nhận ra phenol, dùng Na nhận ra rượu, còn lại là benzen.
  3. Dùng nước brom nhận ra phenol, dùng quý tìm nhận ra axit, dùng Na nhận ra rượu, còn lại là benzen.
  4. Dùng HNO3 (H2SO4 đặc) đun nóng nhận ra benzen, dùng brom nhận ra phenol, dùng quý tìm nhận ra axit, còn lại là rượu.

Hãy chọn đáp án đúng.

 

C.3 AMIN

 

Câu 1. Công thức của amin chứa 15,05% khối lượng nitơ là công thức nào?

  1. C2H5NH2 B. (CH3)2 NH                                        C. C6H5NH2                                          D. (CH3)3 NH

Câu 2. Công thức phân tử C3H9N ứng với bao nhiêu đồng phân?

  1. hai đồng phân B. bốn đồng phân C. ba đồng phân                                  D. năm đồng phân

Câu 3. Cho amin có cấu tạo: CH3-CH(CH3)-NH2 . Tên gọi đúng của amin là trường hợp nào sau đây?

  1. n-Propylamin B. etylamin C. Đimetylamin                                   D. iso-Propylamin

Câu 4. Có bao nhiêu đồng phân amin ứng với công thức phân tử C3H7N?

  1. 1 đồng phân B. 5 đồng phân C. 4 đồng phân                                    D. 3 đồng phân

Câu 5. Tìm câu sai trong số các câu sau đây:

  1. Etylamin dễ tan trong nước do có liên kết hiđro với H2O.
  2. Tính chất hóa học của etylamin là có khả năng tạo muối với bazơ mạnh.
  3. Etylamin tan trong nước tạo dung dịch có phản ứng với dung dịch FeCl3 tạo ra kết tủa.
  4. Etylamin có tính bazơ do nguyên tử nitơ còn cặp electron chưa liên kết có khả năng nhận proton.

Câu 6. Tên gọi của chất có công thức cấu tạo C6H5NH2 là :

  1. Benzil amoni B. Benzyl amoni                                  C. Hexyl amoni                                   D. Anilin

Câu 7. Hợp chất hữu cơ mạch hở X chứa các nguyến tố C, H, N trong đó có 23,72% khối lượng N.  X tác dụng với HCl theo tỉ lệ mol 1 : 1.  Câu trả lời nào sau đây là sai?

  1. X là hợp chất amin B. Cấu tạo của X là amin đơn chức, no
  2. Nếu công chức X là CxHyNz thì có mối liên hệ: 2x-y= 45 D. Nếu công thức X là CxHyNz thì z = 1

Câu 8. Phát biểu nào sau đây không đúng?

  1. Amin được cấu thành bằng cách thay thế H của amoniac bằng một hay nhiều gốc hiđrocacbon.
  2. Bậc amin là bậc của nguyên tử cacbon liên kết với nhóm amin.
  3. Tùy thuộc cấu trúc của gốc hiđrocacbon, có thể phân biệt amin thành amin no, chưa no và thơm.
  4. Amin có từ hai nguyên tử cacbon trong phân tử bắt đầu xuất hiện tượng đồng phân.

Câu 9. Amin nào dưới đây là amin bậc hai?

  1. CH3 – CH2 – NH2 B. CH3 – CH – CH2 C. CH3 – NH – CH3                                            D. (CH3)2NCH2– CH3

Câu 10. Công thức nào dưới đây là công thức chung của dãy đồng đẳng amin thơm (chứa 1 vòng benzen), đơn chức, bậc nhất?

  1. CnH2n-7NH2 B. CnH2n+1NH2                                      C. C6H5NHCnH2n+1                              D. CnH2n-3NHCnH2n-4

************

Câu 12. Amin nào dưới đây có bốn đồng phân cấu tạo?

  1. C2H7N B. C3H9N                                               C. C4H11N                                              D. C5H13N

Câu 13. Phát biểu nào dưới đây về tính chất vật lí của amin là không đúng?

  1. Metyl-, etyl-, đimetyl-, trimetylamin là những chất khí, dễ tan trong nước.
  2. Các amin khí có mùi tương tự amoniac, độc.
  3. Anilin là chất lỏng, khó tan trong nước, màu đen
  4. Độ tan của amin giảm dần khi số nguyên tử cacbon trong phân tử tăng.

Câu 14. Các giải thích về quan hệ cấu trúc – tính chất nào sau không hợp lí?

  1. Do có cặp electron tự do trên nguyên tử N mà amin có tính bazơ.
  2. Do nhóm –NH2 đẩy electron nên anilin dễ tham gia phản ứng thế vào nhân thơm hơn và ưu tiên vị trí o-, p-.
  3. Tính bazơ của amin càng mạnh khi mật độ electron trên nguyên tử N càng lớn.
  4. Với amin RNH2, gốc R- hút electron làm tăng độ mạnh của tính bazơ và ngược lại.

Câu 16. Sở dĩ  anilin có tính bazơ yếu hơn NH3 là do yếu tố nào?

  1. Nhóm -NH2 còn một cặp electron chưa liên kết.
  2. Nhóm -NH2 có tác dụng đẩy electron về phía vòng benzen làm giảm mật độ electron của N.
  3. Gốc phenyl có ảnh hưởng làm giảm mật độ electron của nguyên tử N.
  4. Phân tử khối của anilin lớn hơn so với NH3.

Câu 17. Hãy chỉ ra điều sai trong các nhận xét sau

  1. Các amin đều có tính bazơ B. Tính bazơ của anilin yếu hơn của NH3
  2. Amin tác dụng với axit cho muối. D. Amin là hợp chất hữu cơ có tính chất lưỡng tính.

Câu 18. Dung dịch etylamin tác dụng được với dung dịch nước của chất nào sau đây?

  1. NaOH B. NH3                                                   C. NaCl                                                  D. FeCl3 và H2SO4

Câu 19. Hợp chất nào dưới đây có tính bazơ yếu nhất?

  1. Anilin B. Metylamin                                       C. Amoniac                                          D. Đimetylamin

Câu 20. Chất nào sau đây có tính bazơ mạnh nhất?

  1. NH3 B. CH3CONH2 C. CH3CH2CH2OH                              D. CH3CH2NH2

Câu 21. Sắp xếp các hợp chất sau theo thứ tự giảm dần tính bazơ:  (1) C6H5NH2 ; (2) C2H5NH2 ;  (3) (C6H5)2NH ;  (4) (C2H5)2NH ;  (5) NaOH ; (6) NH3 .   Dãy nào sau đây có thứ tự sắp xếp đúng?

  1. (1) > (3) > (5) > (4) > (2) > (6) B. (6) > (4) > (3) > (5) > (1) > (2)
  2. (5) > (4) > (2) > (1) > (3) > (6) D. (5) > (4) > (2) > (6) > (1) > (3)

Câu 22. Tính bazơ giảm dần theo dãy nào sau đây?

  1. đimetylamin; metylamin; amoniac; p-metylanilin; anilin; p-nitro anilin
  2. đimetylamin; metylamin; anilin; p-nitroanilin; amoniac; p-metylanilin
  3. p-nitroanilin; anilin; p-metylanilin; amoniac; metylamin; đimetylamin
  4. anilin; p-metylanilin; amoniac; metylamin; đimetylamin; p-nitroanilin

Câu 23. Tính bazơ của các chất tăng dần theo thứ tự ở dãy nào sau đây?

  1. C6H5NH2; NH3; CH3NH2; (CH3)2 NH B. NH3; CH3NH2; (CH3)2 NH; C6H5NH2
  2. (CH3)2 NH; CH3NH2; NH3; C6H5NH2 D. NH3; C6H5NH2; (CH3)2 NH;  CH3NH2

Câu 24. Tính bazơ của các chất tăng dần theo thứ tự ở dãy nào sau đây?

  1. NH3 < C6H5NH2 < CH3NHCH3 < CH3CH2NH2 B. NH3 < CH3CH2NH2 < CH3NHCH3 < C6H5NH2
  2. C6H5NH2 < NH3 < CH3CH2NH2 < CH3NHCH3 D. C6H5NH2 < NH3 < CH3NHCH3< CH3CH2NH2

Câu 25. Trật tự tăng dần độ mạnh tính bazơ của dãy nào dưới đây là không đúng?

  1. NH3 < C6H5NH2 B.  NH3 < CH3NH2< CH3CH2NH2   
  2. CH3CH2NH2 < CH3NHCH3 D.  p-O2NC6H4NH2 < p-CH3C6H4NH2

Câu 26. Phản ứng nào dưới đây không thể hiện tính bazơ của amin?

  1. CH3NH2 + H2O -> CH3NH3+ + OH B.  C5H5NH2 + HCl -> C6H5NH3Cl
  2. Fe3+ + 3CH3NH2 + 3H2O -> Fe(OH)3 + 3CH3NH3+ D.  CH3 NH2 + HNO-> CH3OH + N2 + H2O

Câu 27. Dung dịch chất nào dưới đây không làm đổi màu quỳ tím?

  1. C6H5NH2 B. NH3                                                   C. CH3CH2NH2                                      D. CH3NHCH2CH3

Câu 28. Phương trình hóa học nào sau đây không đúng?

  1. 2CH3NH+ H2SO4 ®  (CH3NH3)2SO4                                                      B.  3CH3NH2 + 3H2O + FeCl3  ®  Fe(OH)3 + 3CH3NH3 Cl
  2. C6H5NH2 + 2Br2 ® 3,5-Br2C6H3NH2 + 2HBr                                          D. C6H5NO2 + 3 Fe + 7HCl ® C6H5NH3Cl + 3FeCl2 + 2H2O

Câu 30. Dung dịch etylamin không tác dụng với chất nào sau đây?

  1. axit HCl B. dung dịch FeCl3                               C. nước brom                                       D. Cu(OH)2

Câu 31. Dung dịch etylamin tác dụng được với chất nào sau đây?

  1. giấy đo pH B. dung dịch AgNO3 C. Thuốc thử Felinh                            D. Cu(OH)2

Câu 32. Phát biểu nào sai?

  1. Anilin là bazơ yếu hơn NH3 vì ảnh hưởng hút electron của nhân lên nhóm –NH2 bằng hiệu ứng liên hợp
  2. Anilin không làm đổi máu quỳ tím.
  3. Anilin ít tan trong nước vì gốc C6H5 – kị nước
  4. Nhờ tính bazơ, anilin tác dụng được với dung dịch Br2

Câu 33. Dùng nước brom không phân biệt được hai chất trong cặp nào sau đây?

  1. Dung dịch anilin và dung dịch amoniac B. Anilin và xiclohexylamin (C6H11NH2)
  2. Anilin và phenol D. Anilin và benzen

Câu 34. Các hiện tượng nào sau đây được mô tả không chính xác?

  1. Nhúng quỳ tím vào dd etylanmin thầy quỳ chuyển màu xanh.
  2. Phản ứng giữa khí metylamin và khí hiđro clorua làm xuất hiện “khói trắng”
  3. Nhỏ vài giọt nước brom vào ống nghiệm đựng dd anilin thấy có kết tủa trắng.
  4. Thêm vài giọt phenolphtalein vào dd đimetylamin thấy xuất hiện màu xanh.

Câu 35. Phương trình hóa học nào dưới đây là đúng?

  1. C2H5NH2 + HNO2 + HCl ® C2H5NH2+Cl + 2H2O B. C2H5NH2 + HNO3 + HCl ® C6H5NH2+Cl + 2H2O
  2. C6H5NH2 + HNO2 + HCl C6H5NH2+Cl + 2H2O D. C6H5NH2 + HNO2   C6H5 OH + N2 +H2O

Câu 36. Không thể dùng thuốc thử trong dãy nào sau đây để phân biệt các chất lỏng phenol, anilin và benzen?

  1. Dung dịch brom B. Dung dịch HCl, dung dịch NaOH
  2. Dung dịch HCl, dung dịch brom D. Dung dịch NaOH, dung dịch brom

Câu 37. Để tinh chế anilin từ hỗn hợp phenol, anilin, cách thực hiện nào dưới đây là hợp lý?

  1. Hòa tan trong dd HCl dư, chiết lấy phần tan. Thêm NaOH dư và chiết lấy anilin tinh khiết.
  2. Hòa tan trong dung dịch brom dư, lọc kết tủa, đehalogen hóa thu được anilin.
  3. Hòa tan trong dung dịch NaOH, dư, chiết phần tan và thổi CO2 vào đó đến dư thu được anilin tinh khiết.
  4. Dùng dung dịch NaOH để tách phenol, sau đó dùng brom để tách anilin ra khỏi benzen.

Câu 38. Giải pháp thực tế nào sau đây không hợp lí?

  1. Rửa lọ đựng anilin bằng axit mạnh
  2. Khử mùi tanh của cá bằng giấm ăn
  3. Tổng hợp chất màu thực phẩm bằng phản ứng của amin thơm với dung dịch hỗn hợp NaNO2 và HCl ở nhiệt độ thấp.
  4. Tạo chất màu bằng phản ứng giữa amin no và HNO2 ở nhiệt độ cao.

Câu 39. Phản ứng điều chế amin nào dưới đây không hợp lí?

  1. CH3I + NH3 -> CH3NH2 + HI B. 2C2H5I + NH3 -> (C2H5)2NH + 2HI
  2. C6H5NO2 + 3H2 -> C6H5NH2 + 2H2O D. C6H5CN + 4H C6H5CH2NH2

Câu 40. Để phân biệt phenol, anilin, benzen, stiren người ta lần lượt sử dụng các thuốc thử như ở đáp án nào sau đây?

  1. Quỳ tím, dung dịch brom B. Dung dịch NaOH, dung dịch brom
  2. Dung dịch brom, quỳ tím. D. Dung dịch HCl, quỳ tím

Câu 41. Đốt cháy hoàn toàn một amin chưa no, đơn chức chứa một liên kết C=C thu được COvà H2O theo tỉ lệ mol nCO2 : nH2O = 8: 9.  Công thức phân tử của amin là công thức nào?

  1. C3H6N B. C4H8N                                               C. C4H9N                                               D. C3H7N              

Câu 42. Đốt cháy hoàn toàn một amin đơn chức, bậc thu được CO2 và H2O theo tỉ lệ mol nCO2 : nH2O = 6: 7.  . Amin đó có thể có tên gọi là gì?

  1. propylamin B. phenylamin C. isoproylamin                                   D. propenylamin

Câu 43.  Đốt cháy một đồng đẳng của metylamin, người ta thấy tỉ lệ thể tích các khí và hơi của các sản phẩm sinh ra nCO2: nH2O= 2 : 3. Công thức phân tử của amin là công thức nào?

  1. C3H9N B. CH5N                                                                C. C2H7N                                               D. C4H11N

Câu 44. Cho 20 gam hỗn hợp gồm 3 amin đơn chức, đồng đẳng kế tiếp nhau tác dụng vừa đủ với dung dịch HCl 1M, rồi cô cạn dung dịch thì thu được 31,68 gam hỗn hợp muối. Thể tích dung dịch HCl đã dùng là bao nhiêu mililit?

  1. 100ml B. 50ml                                                  C. 200ml                                               D. 320ml

Câu 45. Cho 20 gam hỗn hợp gồm 3 amin đơn chức, đồng đẳng kế tiếp nhau tác dụng vừa đủ với dung dịch HCl 1M, rồi cô cạn dung dịch thì thu được 31,68 gam hỗn hợp muối. Biết phân tử khối của các amin đều < 80. Công thức phân tử của các amin là ở đáp án A, B, C hay D?

  1. CH3 NH2; C2H5NH2 và C3H7NH2 B. C2H3 NH2; C3H5NH2 và C4H7NH2
  2. C2H5 NH2; C3H7NH2 và C4H9NH2 D. C3H7 NH2; C4H9NH2 và C5H11NH2

Câu 46. Cho 10 gam hỗn hợp gồm 3 amin đơn chức, đồng đẳng kế tiếp nhau tác dụng vừa đủ với dung dịch HCl 1M, rồi cô cạn dung dịch thì thu được 15,84 gam hỗn hợp muối. Nếu trộn 3 amin trên theo tỉ lệ mol 1 : 20 : 5 theo thứ tự phân tử khối tăng dần thì công thức phân tử của 3 amin là ở đáp án nào sau đây?

  1. CH5N, C2H7N, C3H7NH2                 B. C2H7N, C3H9N, C4H11N
  2. C3H9N, C4H11N, C5H11N D. C3H7N, C4H9N, C5H11N

Câu 47. Đốt cháy hoàn toàn 6,2 gam một amin no, đơn chức phải dùng hết 10,08 lít khí oxi (đktc). Công thức của amin đó là công thức nào sau đây?

  1. C2H5NH2 B. CH3NH2                                            C. C4H9NH2                                                                D. C3H7NH2

Câu 48. Hợp chất hữu cơ tạo bởi các nguyên tố C, H, N là chất lỏng, không màu, rất độc, ít tan trong nước, dễ tác dụng với các axit HCl, HNO2 và có thể tác dụng với nước brom tạo kết tủa. Hợp chất đo có công thức phân tử như thế nào?

  1. C2H7N B. C6H13N                                              C. C6H7N                                                                       D. C4H12N2

Câu 49. Đốt cháy hoàn toàn 100ml hỗn hợp gồm đimetylamin và hai hiđrocacbon đồng đẳng kế tiếp thu được 140ml CO2 và 250ml hơi nước (các thể tích đo ở cùng điều kiện). Công thức phân tử của hai hiđrocacbon là ở đáp án nào?

  1. C2H4 và C3H6 B. C2H2 và C3H4 C. CH4 và C2H6                                    D. C2H6 và C3H8

Câu 50. Trung hòa 3,1 gam một amin đơn chức X cần 100ml dung dịch HCl 1M. Công thức phân tử của X là ở đáp án nào?

  1. C2H5N B. CH5N C. C3H9N                                                                       D. C3H7N

Câu 51. Đốt cháy hoàn toàn hỗn hợp hai amin no đơn chức đồng đẳng liên tiếp, ta thu được hỗn hợp sản phẩm khí với tỉ lệ thể tích nCO2: nH2O = 8 : 17.  Công thức của hai amin là ở đáp án nào?

  1. C2H5NH2, C3H7NH2 B. C3H7NH2, C4H9NH2 C. CH3NH2, C2H5NH2                         D. C4H9NH2, C5H11NH2

Câu 52. Đốt cháy hoàn toàn một amin đơn chức chưa no có một liên kết đôi ở mạch cacbon ta thu được CO2 và H2O theo tỉ lệ mol = 8:11. Vậy công thức phân tử của amin là công thức nào?

  1. C3H6N B. C4H9N C. C4H8N                                               D. C3H7N

Câu 53. Cho 9,3 gam một ankylmin tác dụng với dung dịch FeCl3 dư thu được 10,7 gam kết tủa. Ankylamin đó có công thức như thế nào?

  1. CH3NH2 B. C2H5NH2                                          C. C3H7NH2                                                                D. C4H9NH2

Câu 54. Cho 1,52 gam hỗn hợp hai amin no đơn chức (được trộn với số mol bằng nhau) tác dụng vừa đủ với 200ml dung dịch HCl, thu được 2,98g muối. Kết luận nào sau đây không chính xác.

  1. Nồng độ mol của dung dịch HCl bằng 0,2M. B. Số mol của mỗi chất là 0,02mol
  2. Công thức thức của hai amin là CH5N và C2H7N D. Tên gọi hai amin là metylamin và etylamin

Câu 55. Phân tích định lượng 0,15g hợp chất hữu cơ X thấy tỉ lệ khối lượng các nguyên tố C:H:O là 4,8 :1 : 6,4 : 2,8. Nếu phân tích định lượng m g chất X thì tỉ lệ khối lượng các nguyên tố C: H : O : N là bao nhiêu?

  1. 4 : 1 : 6 : 2 B. 2,4 : 0,5 : 3,2 : 1,4                          C. 1,2 : 1 : 1,6 : 2,8                              D. 1,2 : 1,5 : 1,6 : 0,7

Câu 56. Người ta điều chế anilin bằng cách nitro hóa 500g benzen rồi khử hợp chất nitro sinh ra. Khối lượng anilin thu được là bao nhiêu, biết hiệu suất mỗi giai đoạn 78%?

  1. 346,7gam B. 362,7gam C. 463,4gam                                         D. 358,7 gam

Câu 57. Cho lượng dư anilin phản ứng hoàn toàn với dung dịch chứa 0,05mol H2SO4 loãng. Khối lượng muối thu được bằng bao nhiêu gam?

  1. 7,1gam B. 14,2gam                                           C. 19,1gam                                           D. 28,4 gam

Câu 59. Cho một hỗn hợp A chứa NH3, C6H5NH­2 và C6H5OH. A được trung hòa bởi 0,02 mol NaOH hoặc 0,01 mol HCl. A cũng phản ứng với đủ với 0,075 mol Br2 tạo kết tủa. Lượng các chất NH3, C6H5NH­3 và C6H5OH lần lượt bằng bao nhiêu?

  1. 0,01 mol; 0,005mol và 0,02mol B. 0,05 mol; 0,005mol và 0,02mol
  2. 0,05 mol; 0,002mol và 0,05mol. D. 0,01 mol; 0,005mol và 0,02mol

Câu 60. Đốt cháy hoàn toàn 100ml hỗn hợp gồm đimetylamin và 2 hiđrocacbon đồng đẳng kế tiếp thu được 140ml CO2 và 250ml hơi nước (các thể tích đo ở cùng điều kiện). Thành phần % thể tích của ba chất trong hỗn hợp theo độ tăng phân tử khối lần lượt bằng bao nhiêu?

  1. 20%; 20% và 60% B. 25%; 25% và 50%                         C. 30%; 30% và 40%                         D. 20%; 60% và 20%

 

CHƯƠNG II

ANĐEHIT – AXIT CACBONXILIC-ESTE

 

.1. ANĐEHIT – XETON

 

Câu 1. Câu nào sau đây là câu không đúng?

  1. Hợp chất hữu cơ có chứa nhóm CHO liên kết với H là anđehit.
  2. Anđehit vừa thể hiện tính khử, vừa thể hiện tính oxi hóa.
  3. Hợp chất R-CHO có thể điều chế được từ R-CH2OH.
  4. Trong phân tử anđehit, các nguyên tử chỉ liên kết với nhau bằng liên kết d.

Câu 2. Cho các câu sau:

  1. Anđehit là hợp chất hữu cơ trong phân tử có nhóm –CHO
  2. Anđehit và xeton có phản ứng cộng hiđro giống etilen nên chúng thuộc loại hợp chất không no.
  3. Anđehit giống axetilen vì đều tác dụng với dung dịch AgNO3/NH3
  4. Anđehit no, đơn chức, mạch hở có công thức phân tử CnH2nO.
  5. Hợp chất có công thức phân tử CnH2nO là anđehit no, đơn chức.

Những câu đúng là:

  1. a, b, c, d B. a, b, d C. a, b, đ, e                                            D. a, b, c, e

Câu 3.  Tìm phát biểu sai:

  1. Phân tử HCHO có cấu tạo phẳng, các gốc HCH và HCO đều » 1200. Tương tự liên kết C = C, liên kết C = O gồm 1 liên kết d bền và 1 liên kết p kém bền; tuy nhiên, khác với liên kết C = C, liên kết C = O phân cực mạnh.
  2. Tương tự rượu metylic và khác với metyl clorua, anđehit fomic tan rất tốt trong nước vì trong HCHO tồn tại chủ yếu ở dạng HCH(OH)2 (do phản ứng cộng nước) dễ tan. Mặt khác, nếucòn phân tử H-CHO thì phân tử này cũng tạo được liên kết hiđro với nước.
  3. Anđehit fomic vừa có tính oxi hóa vừa có tính khử.
  4. Fomol hay fomalin là dd chứa khoảng 37-40% HCHO trong rượu.

Câu 4. Công thức phân tử của anđehit có dạng tổng quát CnH2n+2-2a-2kOk.

  1. Các chỉ số n, a, k thỏa mãn điều kiện n ≥1; a ≥ 0; k ≥ 1
  2. Nếu a = 0, k =1 thì đó là anđehit no, đơn chức
  3. Nếu anđehit 2 chức và 1 vòng no thì công thức phân tử có dạng CnH2n-4O2 (n ≥5)
  4. Tổng số liên kết p và vòng là độ bất bão hòa của công thức.

Câu 5. Câu nào sau đây là không đúng?

  1. Anđehit cộng hiđro tạo thành ancol bậc một.
  2. Anđehit tác dụng với dung dịch bạc nitrat trong amoniac sinh ra bạc kim loại.
  3. Anđehit no, đơn chức có công thức phân tử dạng tổng quát là CnH2n+2O
  4. Khi tác dụng với hiđro, xeton bị khử thành ancol bậc II.

Câu 6. Thứ tự tăng dần nhiệt độ sôi của các chất: anđehit propionic (X); propan (Y); rươu etylic (Z) và đimetyl ete (T) ở dãy nào là đúng?

  1. X<Y<Z<T B. T<X <Y<Z                                 C. Z<T< X<Y                                        D. Y<T<X <Z       

Câu 7. Trong công nghiệp, anđehit fomic được điều chế trực tiếp từ chất nào trong các chất sau?

  1. rượu etylic B. axit fomic C. rượu metylic                                    D. metyl axetat

Câu 8. Cho 4 chất : benzen, metanol, phenol, ađehit fomic. Thứ tự các chất được dùng để phân biệt 4 chất trên được sắp xếp ở dãy nào đúng?

  1. nước brom ; dung dịch AgNO3/NH3; Na B. dung dịch AgNO3/NH3; Na; nước brom
  2. dung dịch AgNO3/NH3; nước brom; Na D. Na; nước brom ; dung dịch AgNO3/NH3

Câu 9. Cho các phản ứng:  (X) + dd NaOH                    (Y) + (Z)    (1);      (Y) + NaOH rắn   (T) ­ + (P)   (2)

(T)                (Q) + H2­    (3) ;                               (Q) + H2O              (Z)           (4)

Các chất (X) và (Z) có thể là những chất được ghi ở dãy nào sau đây?

  1. HCOOCH=CH2 và HCHO B. CH3COOCH=CH2 và HCHO
  2. CH3COOCH=CH2 và CH3CHO D. CH3COOC2H5 và CH3CHO

Câu 10. Cho sơ đồ sau:  X   Y    Z   T   G (axit acrylic)

Các chất X và Z có thể là những chất được ghi ở dãy nào sau đây?

  1. C3H8 và CH3CH2-CH2-OH B. C2H6 và CH2 = CH- CHO
  2. C3H6 và CH2 = CH – CHO                                                 D. C3H6 và CH2 = CH- CH2OH

Câu 11. Xét các loại hợp chất hữu cơ mạch hở sau:

Rượu đơn chức no (X); anđehit đơn chức no (Y); rượuđơn chức không no có 1 nối đôi (Z); anđehit đơn chức, không no có 1 nối đôi (T). Ứng với công thức tổng quát CnH2nO chỉ có 2 chất, đó là những chất nào?

  1. X, Y B. Y, Z                                                   C. Z, T                                                    D. X, T

Câu 12. Đốt cháy một hỗn hợp các đồng đẳng của anđehit ta thu được số mol CO= số mol H2O. Các chất đó thuộc dãy đồng đẳng nào trong các dãy sau?

  1. Anđehit đơn chức no B. Anđehit vòng no C. Anđehit hai chức no       D. Anđehit không no đơn chức

Câu 13. Lấy 0,94 gam hỗn hợp hai anđehit đơn chức no kế tiếp nhau trong dãy đồng đẳng cho tác dụng hết với dung dịch AgNO3NH3 thu được 3,24gam Ag. Công thức phân tử hai anđehit lần lượt là ở đáp án nào sau đây?

Công thức phân tử hai anđehit lần lượt là ở đáp án nào sau đây?

  1. CH3CHO và HCHO B. C2H5CHO và C3H7CHO C. CH3CHO và C2H5CHO         D. C3H7CHO và C4H9CHO

Câu 14. X, Y là các hợp chất hữu cơ đồng chức chứa các nguyên tố C, H, O. Khi tác dụng với AgNO3 trong NH3 thì 1 mol X hoặc Y tạo ra 4 mol Ag. Còn khi đốt cháy X, Y thì tỉ lệ số mol O2 tham gia đốt cháy, CO2 và H2O tạo thành như sau:

Đối với X, ta có n(O2): n(CO2): n(H2O) = 1:1:1

Đối với Y, ta có n(O2): n(CO2): n(H2O) = 1,5:1:1

Công thức phân tử và công thức cấu tạo của X, Y là ở đáp án nào sau đây?

  1. CH3CHO và HCHO B. HCHO và C2H5CHO C. HCOOH và HCHO                   D. HCHO và O=CH-CHO

Câu 15. Hợp chất hữu cơ X khi đun nhẹ với dung dịch AgNO3/NH3 (dùng dư) thu được sản phẩm Y. Khi Y tác dụng với dung dịch HCl hoặc dung dịch NaOH đều cho 2 khí thuộc loại chất vô cơ A, B. Công thức phân tử của X là ở đáp án nào sau đây?

  1. H-CHO B. H-COOH                                          C. HCOO-NH4                                                         D. HCOO-CH3

Câu 16. Cho 13,6g một chất hữu cơ X (C, H, O) tác dụng vừa đủ với 300ml dung dịch AgNO3 2M trong NH4OH thu được 43,2g bạc. Biết tỉ khối hơi của X đối với oxi bằng 2,125. X có công thức cấu tạo là ở đáp án nào sau đây?

  1. CH3-CH2 -CHO B. CH2=CH-CH2-CHO C. HCºC-CH2 –CHO                          D. HCºC–CHO

Câu 17. Dẫn hỗn hợp gồm H2 và 3,92 lít (đktc) hơi anđehit axetic qua ống chứa Ni nung nóng. Hỗn hợp các chất sau phản ứng được làm lạnh và cho tác dụng hoàn toàn với Na thấy thoát ra 1,84 lít khí (270C là 1 atm). Hiệu suất của phản ứng khử anđehit là bao nhiêu?

  1. 60,33% B. 82,44%                                             C. 84,22%                                             D. 75,04%            

Câu 18. Anđehit X mạch hở, cộng hợp với H2 theo tỉ lệ 1:2 (lượng H2 tối đa) tạo ra chất Y. Cho Y tác dụng hết với Na thu được thể tích H­2 bằng thể tích X phản ứng để tạo ra Y (ở cùng t0, p). X thuộc loại chất nào sau đây?

  1. Anđehit no, đơn chức B. Anđehit không no (chứa một nối đôi C = C), đơn chức
  2. Anđehit no, hai chức. D. Anđehit không no (chứa một nối đôi C=O), hai chức

Câu 19. Cho 1,74gam một anđehit no, đơn chức phản ứng hoàn toàn với AgNO3/NH3 sinh ra 6,48gam bạc kim loại. Công thức cấu tạo của anđehit là ở đáp án nào sau đây?

  1. CH3-CH=O B. CH3CH2-CH=O                               C. CH3CH2CH2-CH=O                       D. (CH3)2CH-CH=O

Câu 20. Hợp chất X có công thức C3H6O tác dụng được với nước brom và tham gia phản ứng tráng gương. Công thức cấu tạo của X là ở đáp án nào sau đây?

A.CH2 = CH – CH2OH                       B. CH2 = CH – CH2OH                      C. CH3CH2CH2-CH=O                       D. CH3CO-CH3

Câu 21. Cho 50 gam dung dịch anđehit axetic tác dụng với dung dịch AgNO3 trong NH3 (đủ) thu được 21,6 gam Ag kết tủa. Nồng độ của anđehit axetic trong dung dịch đã dùng là bao nhiêu?

  1. 4,4% B. 8,8% C. 13,2%                                               B. 17,6%

Câu 22. Trong công nghiệp, anđehit fomic được điều chế trực tiếp (Hãy chọn câu đúng)

  1. chỉ từ metan B. chỉ từ axit fomic C. chỉ từ rượu metylic         D. từ metan hoặc từ rượu metylic

Câu 22. Cho 0,92 gam hỗn hợp gồm axetilen và anđehit axetic phản ứng hoàn toàn với dung dịch AgNO3 trong NH3 thu được 5,64gam hỗn hợp rắn. Thành phần % các chất trong hỗn hợp đầu lần lượt là:

  1. 26,28% và 74,71% B. 28,26% và 71,74% C. 28,74% và 71,26%                        D. 28,71% và 74,26%

Câu 24. Nhỏ dung dịch anđehit fomic vào ống nghiệm chứa kết tủa Cu(OH)2, đun nóng nhẹ sẽ thấy kết tủa đỏ gạch. Phương trình hóa học nào sau đây biểu diễn đúng hiện tượng xảy ra?

  1. H – CH = O + Cu(OH)2 H – COOH + Cu + H2O B. H–CH= O + Cu(OH)2 H–COOH  + CuO + H2
  2. H–CH =O + 2Cu(OH)2 H – COOH + Cu2O + H2O D. HCH=O+2Cu(OH)2HCOOH + 2CuOH + H2O

Câu 25. Cho 280cm3 (đktc) hỗn hợp A gồm axetilen và etan lội từ từ qua dung dịch HgSO4 ở 800C. Toàn bộ khí và hơi ra khỏi dung dịch được cho phản ứng với dung dịch AgNO3 (dư)/NH3 thu được 1,08gam bạc kim loại. Thành phần % thể tích các chất trong A lần lượt là:

  1. 50% và 50% B. 30% và 70%                                 C. 60% và 40%                                    D. 40% và 60%   

Câu 26. Cho dung dịch chứa 0,58 gam chất hữu cơ đơn chức X (chỉ gồm các nguyên tố C, H, O) tác dụng với dung dịch AgNO3 (dư) trong NH3 thu được 2,16 gam bạc kết tủa.  Công thức cấu tạo thu gọn của X là ở đáp án nào sau đây?

  1. H-CH=O B. CH3-CH=O                                      C. CH3– CH2-CH=O                            D. CH2=CH- CH =O

Câu 27. Dẫn hơi của 3,0gam etanol đi vào trong ống sứ nung nóng chứa bột CuO (lấy dư). Làm lạnh để ngưng tụ sản phẩm hơi đi ra khỏi ống sứ, được chất lỏng X. Khi X phản ứng hoàn toàn với lượng dư dung dịch AgNO3 trong NH3 thấy có 8,1 gam bạc kết tủa. Hiệu suất của quá trình oxi hóa etanol bằng bao nhiêu?

  1. 55,7% B. 60%                                                   C. 57,5%                                               D. 75%

Câu 28. Hợp chất X có công thức phân tử C4H8O tác dụng được với dung dịch AgNO3 trong NH3. Công thức nào sau đây là công thức cấu tạo của X?

  1. CH3COCH3 B. CH3COCH2CH3                 C. CH2 = CHCH = O                           D. CH3CH2CH2CH = O

Câu 29. Khi oxi hóa 2,2 g một anđehit đơn chức, ta thu được 3g axit tương ứng. Biết hiệu suất phản ứng là 100%, công thức cấu tạo của anđehit là công thức nào sau đây?

  1. H – CH = O B. CH3 – CH =O C. CH3 – CH2 – CH  = O                      D. CH2 = CH – CH  = O

Câu 30. Oxi hóa m gam hỗn hợp 2 anđehit (X) bằng oxi hóa ta thu được hỗn hợp 2 axi tương ứng (Y). Giả thiết hiệu suất phản ứng đạt 100%. Tỉ khối (hơi) của Y so với X bằng 145/ 97. Thành phần % khối lượng của mỗi anđehit trong X theo chiều tăng của phân tử khối là ở đáp án nào sau đây?

  1. 73,27% và 26,73% B. 77,32% và 22,68%                        C. 72,68% và 27,32%                        D. 27,32% và 72,78%

Câu 31. Khi oxi hóa (có xúc tác) m gam hỗn hợp Y gồm H-CH=O và CH3–CH=O bằng oxi ta thu được (m + 1,6) gam hỗn hợp Z. Giả thiết hiệu suất phản ứng đạt 100%. Còn nếu cho m gam hỗn hợp Y tác dụng với dung dịch AgNO3 dư trong amoniac thì thu được 25,92g Ag. Thành phần % khối lượng của 2 axit trong hỗn hợp Z tương ứng là bao nhiêu?

  1. 25% và 75% B. 40% và 60%                                    C. 25% và 75%                                    D. 40% và 60%

Câu 32. X và Y là hai chất hữu cơ đồng đẳng kế tiếp, phân tử chỉ chứa C, H, O. Biết % mO trong X, Y lần lượt là 53,33% và 43,24%. Biết chúng đều tác dụng với Na và có phản ứng tráng gương. CTCT của X và Y là ở đáp án nào sau đây?

  1. X là HO – CH2 – CHO và Y là HO – CH2 – CH2 – CHO B. X là HO – CH(CH3) – CHO và Y là HOOC – CH2 – CHO
  2. X là HO – CH2 – CH2 – CHO và Y là HO – CH2 – CHO D. X là HO – CH2 – CHO và Y là HO– CH2 – CH2 – COOH

.2   AXIT CACBOXYLIC

 

Câu 1. Trong các nhóm chức sau, nhóm chức nào là axit cacboxylic?

  1. R-COO- B. –COOH                                            C. –CO-                                                 D. –COO-R

Câu 2. Số đồng phân ứng với công thức phân tử C4H8O2 mà tác dụng được với đá vôi  là bao nhiêu?

  1. 2 B. 3                                                         C. 1                                                         D. 4

Câu 3. Công thức đơn giản nhất của một axit no đa chức là (C3H4O3)n. Công thức cấu tạo thu gọn của axit đó là công thức nào sau đây?

  1. C2H5(COOH)2 B. C4H7 (COOH)3 C. C3H5 (COOH)3                                                 D. HOC­2H2COOH

Câu 4. Công thức cấu tạo thu gọn của axit cacbonxilic C4H6O2 có đồng phân cis-trans là công thức nào sau đây?

  1. CH2 = CH-CH2-COOH B. CH2 = C(CH3)-COOH C. CH3 –CH=CH-COOH                    D. (CH2)2CH-COOH

Câu 5. So sánh nhiệt độ sôi của các chất sau: Rượu etylic (1), etyl clorua (2), đietyl ete (3) và axit axetic (4).

  1. (1) > (2) > (3) > (4) B. (4) > (3) > (2) > (1)                          C. (4) > (1) > (2) > (3)                          D. (1) > (2) > (4) > (3)

Câu 6. Sắp xếp các chất CH3COOH (1), HCOO-CH2CH3 (2), CH3CH2COOH (3), CH3COO-CH2CH3 (4), CH3CH2CH2OH (5) theo thứ tự nhiệt độ sôi giảm dần. Dãy nào có thứ tự sắp xếp đúng?

  1. (3) > (5) > (1) > (4) > (2) B. (1) > (3) > (4) > (5) > (2)
  2. (3) > (1) > (4) > (5) > (2) D. (3) > (1) > (5) > (4) > (2)

Câu 7. Nhiệt độ sôi 100,50C ; 78,30C; 118,20C là của ba chất C2H5OH, HCOOH, CH3COOH. Dãy nào sau đây ghi đúng nhiệt độ sôi của mỗi chất?

CH3COOH            C2H5OH                 HCOOH

  1. 118,20C 100,50C                 78,30C   
  2. 100,50C 78,30C                    118,20C
  3. 118,20C 78,30C                    100,50C
  4. 78,30C 100,50C                 118,20C

Câu 8. Cho các chất: anđehit axetic, axit fomic, rượu etylic, đimetyl ete và các số liệu về nhiệt độ sôi: 100,70;210C; -230C ; 78,30C. Đáp án nào sau đây ghi nhiệt độ sôi đúng với mỗi chất?

anđehit axetic

axit fomic

rượu etylic

đimetyl ete

A.

100,70C

210C

-230C

78,30C

B.

210C

100,70C

78,30C

-230C

C.

-230C

100,70C

78,30C

210C

D.

78,30C

-230C

210C

100,70C

Câu 9. Trong các chất sau, chất có tính axit mạnh nhất là chất nào?

  1. CCl3-COOH B. CH3COOH C. CBr3-COOH                                     D. CF3-COOH

Câu 10. Tính axit của các chất giảm dần theo thứ tự nào?

  1. H2SO4 > CH3COOH > C6H5OH > C2H5OH B. H2SO4 > C6H5OH > CH3COOH > C2H5OH
  2. C2H5OH > C6H5OH >CH3COOH > H2SO4 D. CH3COOH > C6H5OH > C2H5OH > H2SO4

Câu 11. So sánh tính axit của các chất sau đây:

CH2Cl – CH2COOH (1)                      CH3COOH (2)                                      HCOOH (3)                                          CH3 –CHCl – COOH (4)

Câu 12. Các hợp chất: CH3COOH, C2H5OH và C6H5OH xếp theo thứ tự tăng tính axit ở dãy nào là đúng?

  1. C2H5oh < CH3COOH < C6H5OH B. C6H5OH < C2H5oh < CH3COOH
  2. CH3COOH < C6H5OH < CH5oh D. C2H5oh < C6H5OH < CH3COOH

Câu 13. Axit fomic có thể tác dụng với tất cả các chất trong dãy nào sau đây?

  1. Mg, Cu, dung dịch NH3, NaHCO3 B. Mg, Ag, CH3OH/H2SO4 đặc, nóng.
  2. Mg, dung dịch NH3, NaHCO3 D. Mg, dung dịch NH3, dung dịch NaCl.

Câu 14. Axit acrylic có thể tác dụng với tất cả các chất trong dãy nào sau đây?

  1. Na, Cu, Br2, dung dịch NH3, dung dịch NaHCO3, CH3OH (H2SO4 đặc)
  2. Mg, H2, Br2, dung dịch NH3, dung dịch NaHCO3, CH3OH (H2SO4 đặc)
  3. Ca, H2, Cl2, dung dịch NH3, dung dịch NaCl, CH3OH (H2SO4 đặc)
  4. Ba, H2, Br2, dung dịch NH3, dung dịch NaHSO4, CH3OH (H2SO4 đặc)

Câu 15. Điều chế axit axetic chỉ bằng một phản ứng, người ta chọn một hiđrocacbon nào sau đây?

  1. CH4 B. CH3-CH3                                          C. CH3-CH2-CH3                                 D. CH3-CH2-CH2-CH3

Câu 16. Hai chất hữu cơ X và Y có cùng công thức C3H4O2. X phản ứng với Na2CO3, rượu etylic và tham gia phản ứng trùng hợp. Y phản ứng với dung dịch KOH, biết rằng Y không tác dụng được với kali. X, Y có công thức cấu tạo lần lượt là ở đáp án nào sau đây?

  1. C2 H5COOH và CH3COOCH3 B. HCOOH và CH2 = CH – COO – CH3
  2. CH2 = CH­ – COO – CH3 và CH3 – COO – CH = CH2 D. CH2 = CH – COOH và HCOO – CH = CH2

Câu 17. Cho quỳ tìm vào dung dịch axit axetic, quỳ tím có đổi màu không, nếu có thì màu gì?

  1. đổi sang màu hồng B. đổi sang màu xanh                        C. không đổi màu                                                D. bị mất màu

Câu 18. Để phân biệt hai dung dịch axit axetic và axit acrylic, ta dùng chất nào trong các chất sau?

  1. quỳ tìm B. natri hiđroxit                                    C. natri hiđrocacbonat                       D. nước brom

Câu 19. Không làm chuyển màu giấy quỳ trung tính là dung dịch nước của chất nào sau đây?

  1. axit acrylic B. axit ađipic C. axit aminoaxetic                            D axit glutamic

Câu 20. Khối lượng axit axetic cần để pha 500ml dung dịch 0,01M bao nhiêu gam?

  1. 3 gam B. 0,3 gam                                 C. 0,6 gam                                            D. 6 gam               

Câu 21. Trung hòa hoàn toàn 3 gam một axit cacboxilic no đơn chức X cần dùng vừa đủ 100ml dung dịch NaOh 0,5M. Tên gọi của X là gì?

  1. axit fomic B. axit propionic                                  C. axit acrylic                                       D. axit axetic

Câu 22. Đốt cháy 14,6g một axit no đa chức có mạch cacbon không phân nhánh ta thu được 0,6 mol CO2 và 0,5 mol H2O. Công thức cấu tạo thu gọn của axit đó là công thức nào sau đây?

  1. HOOC-CH2-COOH B. HOOC-CH2 –CH2 –COOH C. HOOC-(CH2)3-COOH                 D. HOOC-(CH2)4COOH

Câu 23. Axit đicacboxylic mạch phân nhánh có thành phần nguyên tố : %C = 40,68; %H = 5,08 và %O = 54,24. Công thức cấu tạo thu gọn của axit đó là công thức nào sau đây?

  1. CH3 CH2CH(COOH)2 B. CH3CH(COOH)2 C. (CH3)2 C(COOH)2                 D. HOOCCH2CH(CH3)COOH

Câu 24. Trung hòa 16,6 gam hỗn hợp axit axetic và axit fomic bằng dung dịch natri hiđroxit thu được 23,2 gam hỗn hợp hai muối. Thành phần % khối lượng mỗi axit tương ứng là ở đáp nào sau đây?

  1. 27,71% và 72,29% B. 72,29% và 27,71%                        C. 66,67% và 33,33%                        D. 33,33% và 66,67%

Câu 25. Trung hòa 250 gam dung dịch 7,4% của một axit đơn chức cần 200ml dung dịch kali hiđroxit 1,25M. Công thức cấu tạo của axit đó là công thức nào sau đây?

  1. H-COOH B. CH3 – COOH C. CH3CH2 – COOH                           D. CH2 = CH – COOH

Câu 26. Muốn trung hòa dung dịch chứa 0,9047g một axit cacboxylic thơm (X) cần 54,5 ml dd NaOH 0,2M. (X) không làm mất màu dd Br2. Công thức phân tử (X) là công thức nào sau đây?

  1. C6H4(COOH)2 B. C6H3(COOH)3                                  C. CH3C6H3(COOH)2                          D. CH3 = CH2 – COOH

Câu 27. Khối lượng axit axetic chứa trong giấm ăn thu được khi lên men 100 lít rượu 80 thành giấm ăn là bao nhiêu gam? Biết khối lượng riêng của rượu etylic là 0,8g/ml và giả sử phản ứng lên men giấm đạt hiệu suất 80%.

  1. 834,78 gam B. 677,83 gam C. 667,83 gam                                     D. 843,78 gam

Câu 28. Chất X có công thức phân tử C4H8O2, khi tác dụng với dung dịch NaOH sinh ra chất Y có công thức C4H7O2Na. X thuộc loại chất nào sau đây?

  1. axit B. este                                                    C. anđehit                                             D. ancol

Câu 29. Để trung hòa 8,8gam một axit cacboxilic mạch không phân nhánh thuộc dãy đồng đẳng của axit axetic cần 100ml dung dịch NaOH 1M. Công thức cấu tạo của axit trên là công thức nào sau dây?

  1. H-COOH B. (CH3)3CH-COOH                           C. CH3CH2-COOH                              D. CH3CH2CH2-COOH

Câu 30. Cho 90g axit axetic tác dụng với 69gam rượu etylic (H2SO4 xúc tác). Khi phản ứng đạt tới cân bằng thì 66% lượng axit đã chuyển thành ete, khối lượng este sinh ra là bao nhiêu gam?

  1. 174,2 gam                 B. 87,12gam                                         C. 147,2gam                                         D. 78,1gam

Câu 31. Chất X có công thức phân tử CH8O2 , khi tác dụng với dd NaOH sinh ra chất Y có công thức C3H5O2Na. X thuộc loại chất nào sau đây?

  1. Axit B. Este                                                   C. Anđehit                                             D. Ancol

Câu 32. Thêm 26,4 gam một axit cacboxylic (X) mạch không phân nhánh thuộc dãy đồng đẳng của axit axetic vào 150g dd axit axetic 6% . Để trung hòa hỗn hợp thu được cần 300ml dd KOH 1,5M. Công thức cấu tạo của x là công thức nào sau đây?

  1. H-COOH                 B. CH3CH2COOH                               C. (CH­3)2CH-COOH                           D. CH­3CH2CH2-COOH

Câu 33. Cho các chất : axit fomic, anđehit axetic, rượu etylic, axit axetic. Thứ tự các hóa chất dùng làm thuốc thử để phân biệt các chất trên ở dãy nào là đúng?

  1. Na, dd NaOH, dd AgNO3/NH3 B. Quỳ tím, 2 dd NaHCO3/NH3; và dd AgNO3/NH3
  2. Quỳ tím, 2 dd AgNO3/NH3 D. Dung dịch AgNO3/NH3; dd NaOH.

Câu 34. Cho 1 g axit axetic vào ống nghiệm thứ nhất và c ho 1 gam axit fomic vào ống nghiệm thứ hai, sau đó cho vào cả hai ống nghiệm trên một lượng dư bột CaCO3. Khi phản ứng xảy ra hoàn toàn thì thể tích CO2 thu được ở cùng t0, p được xác định ở dãy nào sau đây là đúng?

  1. Từ hai ống nghiệm bằng nhau. B. Từ ống thứ nhất nhiều hơn ống thứ hai
  2. Từ ống thứ hai nhiều hơn ống thứ nhất D. Từ cả hai ống đều lớn hơn 22,4 lít (đktc)

Câu 35. Cho 3,15 gam hỗn hợp X gồm axit axetic, axit acrylic, axit propionic vừa đủ để làm mất màu hoàn toàn dung dịch chứa 3,2g brom. Để trung hòan toàn 3,15 gam hỗn hợp X cần 90ml dd NaOH 0,5M. Thành phần % khối lượng từng axit trong hỗn hợp lần lượt ghi ở đáp án nào đúng?

  1. 25,00%; 25,00%; 50,00% B. 19,04%; 35,24%; 45,72% C. 19,04%; 45,72%; 35,24                       D. 45,71%; 35,25%; 19,04%

Câu 36. Để trung hòa 150g dd 7,2% của axit mạch hở đơn chức X cần dùng 100 ml dd NaOH 1,5M. Công thức cấu tạo của X là ở đáp án nào sau đây?

  1. H-COOH B. CH3-COOH C. CH3CH2-COOH                              D. CH2=CH-COOH

Câu 37. Hỗn hợp M có khối lượng 10g gồm axit axetic và anđehit axetic. Cho M tác dụng với lượng dư dd AgNO3 trong amoniac thấy có 21,6g Ag kết  tủa . % khối lượng mỗi chất trong hỗn hợp bằng bao nhiêu ?

  1. 50% và 50% B. 56% và 44 %                                   C. 54% và 46%                                    D 40% và 60 %

Câu 38. Hỗn hợp X có khối lượng 10g gồm axit axetic và anđehit axetic. Cho X tác dụng với lượng dư dd AgNO3 trong amoniac thấy có 21,6g Ag kết tủa. Để trung hòa X cần Vml dd NaOH 0,2M. Trị số của V bằng bao nhiêu?

  1. 500 B. 200                                                    C. 466,6                                                 D. 300

Câu 39. Hỗn hợp P có khối lượng 9 gam gồm axit fomic và anđehit axetic. Cho P tác dụng với lượng dư dd Ag2O trong amoniac thấy có 43,2g Ag kết tủa . % khối lượng mỗi chất là bao nhiêu?

  1. 50% và 50%                 B. 56% và 44%                                    C. 54% và 46%                                    D. 51,11% và 48,89%

Câu 40. Chia 0,6 mol hỗn hợp hai axit hữu cơ no thành hai phần bằng nhau. Phần (1) đem đốt cháy hoàn toàn thu được 11,2 lít CO2 (đktc). Để trung hòa hoàn toàn phần (2) cần 250 ml dd NaOH 2M . Vậy công thức cấu tạo của hai axit là công thức nào sau đây?

  1. CH3-COOH, CH2=CH-COOH B. H-COOH, HOOC-COOH
  2. CH3-COOH, HOOC-COOH                 D. CH3– CH2-COOH, H-COOH

Câu 41. Đốt cháy hoàn toàn 0,1mol axit hữu cơ X thu được không quá 4,016 lít khí Y (đktc). Công thức cấu tạo của axit y là công thức nào sau đây?

  1. H-COOH B. CH3COOH C. HO-CH2-COOH                              D. C2H5COOH

Câu 42. Hỗn hợp A gồm rượu n-propylic và axit propionic phản ứng vừa hết với 100 ml dd NaHCO3 4,04% (d= 1,04g/ml) giải phóng một thể tích khí CO2 bằng 1/18 thể tích CO2 thu đựơc khi đốt cháy cùng lượng X (các thể tích khí đo ở cùng t0, p). Thành phần % khối lượng các chất trong hỗn hợp lần lượt là

  1. 19,79% và 80,21% B. 19,21% và 80,79% C. 80,21% và 19,79%                        D. 19,80% và 80,20%.

Câu 43. Cho 10,9 g hỗn hợp gồm axit acrylic và axit propionic phản ứng hoàn toàn với Na thoát ra 1,68 lít khí (đktc). Nếu cho hỗn hợp trên tham gia phản ứng cộng H2 hoàn toàn thì khối lượng sản phẩm cuối cùng là bao nhiêu /

  1. 7,4gam B. 11,1 g                am                                          C. 14,8 gam                                          D. 22,2 gam

Câu 44. Người ta điều chế axit axetic từ etilen với hiệu suất phản ứng 96% . Thể tích etilen (đktc) cần dùng điều chế 1 tấn axit axtic 60% là bao nhiêu?

  1. 373333,00 lít B. 497777,33lít C. 746666,00 lít                                   D. 995554, 66lít.

 

.3. ESTE

 

Câu 1. Phản ứng tương tác của rượu tạo thành este có tên gọi là gì?

  1. Phản ứng trung hòa B Phản ứng ngưng tụ C. Phản ứng este hóa                          D. Phản ứng kết hợp.

Câu 2. Phản ứng thủy phân este trong môi trường kiềm khi đun nóng được gọi là?

  1. Xà phòng hóa B. Hiđrát hóa                                       C. Crackinh                                          D. Sự lên men.

Câu 3. Metyl propionát là tên gọi của hợp chất nào sau đây?

  1. HCOOC3H7                 B. C2H5COOCH3                                                  C. C3H7COOH                                      D. C2H5COOH

Câu 4. Một este có công thức phân tử là C4H6O2 khi thủy phân trong môi trường axit thu được đimetyl xeton. Công thức cấu tạo thu gọn của C4H6O2  là công thức nào ?

  1. HCOO-CH=CH-CH3 B. CH3COO-CH=CH2 C. HCOO-C(CH3)=CH                      D.CH2=CH-COOCH3

Câu 5. Este đựoc tạo thành từ axit no , đơn chức và ancol, đơn chức có công thức cấu tạo như ở đáp án nào sau đây?

  1. CnH2n-1COOCmH2m+1 B. CnH2n-1COOCmH2m-1 C. CnH2n+1COOCmH2m-1                       D. CnH2n+1COOCmH2m-1

Câu 6. Một este có công thức phân tử là C3H6O2 có phản ứng tráng gương với dd AgNO3 trong NH3 Công thức cấu tạo của este đó là công thức nào?

  1. HCOOC2H5 B. CH3COOCH3 C. HCOOC3H7                                         D. C2H5COOCH3

Câu 7. Phản ứng este hóa giữa rượu và etylic và axit axtic tạo thành sản phẩm có tên gọi là gì?

  1. Metyl axetat B. Axyl etylat C. Etyl axetat                                       D. Axetyl etylat

Câu 8. Khi thủy phân este vinyl axetat trong môi trường axit thu được những chất gì?

  1. Axit axetic và rượu vinylic B. Axit axetic và anđehit axetic C. Axit axetic và rượu etylic         D. Axetic và rượu vinylic

Câu 9. Thủy phân este C4H6O2 trong môi trường axit thì ta thu được một hỗn hợp các chất đều có phản ứng tráng gương. Vậy công thức cấu tạo của este có thể là ở đáp án nào sau đây?

  1. CH3-COO-H-CH=CH2 B. H-COO-CH2-CH=CH2 C. H-COO-CH=CH-CH3                    D. CH2=CH-COO-CH3

Câu 10. Dãy chất nào sau đây được sắp xếp theo chiều nhiệt độ sôi của các chất tăng dần?

  1. CH3COOH, CH3COOC2H5, CH3CH2CH2OH B. CH3COOH, CH3CH2CH2OH CH3COOC2H5,
  2. CH3CH2CH2OH , CH3COOH, CH3COOC2H5 D. CH3COOC2H5 ,CH3CH2CH2OH , CH3COOH

Câu 11. Một este có công thức phân tử là C4H8O2, khi thủy phân trong môi trường axit thu đựoc rượu etylic,CTCT của C4H8O2

  1. C3H7COOH B. CH3COOC2H5                                 C. HCOOC3H7                                      D. C2H5COOCH3

Câu 12. Đun 12 g axit axetic với một lượng dư ancol etylic (có axit H2SO4 đặc làm xúc tác). Đến khi phản ứng dừng lại thu được 11g este. Hiệu suất của phản ứng este hóa là bao nhiêu?

  1. 70% B. 75%                                                   C. 62,5%                                               D. 50%

Câu 13. Hỗn hợp gồm rượu đa chức và axit đơn chức bị este hóa hoàn toàn thu đựơc một este. Đốt cháy hoàn toàn 0,11g este này thì thu được 0,22 gam CO2 và 0,09g H2O . Vậy công thức phân tử của rượu và axit là công thức nào cho dưới đây?

  1. CH4O và C2H4O2 B. C2H6O và C2H4O2 C.  C2H6O và CH2O2                           D. C2H6O và C3H6O2

Câu 14. Khi đun nóng 25,8g hỗn hợp rượu etylic và axit axetic có H2SO4 đặc làm xúc tác thu được 14,08g este. Nếu đốt cháy hoàn toàn lượng hỗn hợp đó thu được 23,4ml nước. Tìm thành phần % hỗn hợp ban đầu và hiệu suất  của phản ứng hóa este.

  1. 53,5% C2H5OH; 46,5%CH3COOH và hiệu suất 80% B. 55,3% C2H5OH; 44,7%CH3COOH và hiệu suất 80%
  2. 60,0% C2H5OH; 40,0% CH3COOH và hiệu suất 75%; D. 45,0% C2H5OH; 55,0% CH3COOH và hiệu suất 60%;

Câu 15. Cho chất hữu cơ A chỉ chứa một loại nhóm chức tác dụng với 1 lít dd NaOH 0,5M thu được a gam muối và 0,1 mol rượu. Lượng NaOH dư có thể trung hòa hết 0,5 lít dd HCl 0,4M. Công thức tổng quát của A là công thức nào?

  1. R-COO-R’ B. (R-COO)2R’ C. (R-COO)3R’                                     D. (R-COOR’)3

Câu 16. Cho 21,8 gam chất hữu cơ A chỉ chứa một loại nhóm chức tác dụng với 1 lít dd NaOH 0,5M thu được 24,6gam muối và 0,1 mol rượu. Lượng NaOH dư có thể trung hòa hết 0,5 lít dd HCl 0,4 M . Công thức cấu tạo thu gọn của A là công thức nào?

  1. CH3COOC2H5 B. (CH3COO)2C2H4 C. (CH3COO)3C3H5                             D. C3H5 (COOCH3)3

Câu 17. Tỷ khối của một este so với hiđro là 44. Khi phân hủy este đó tạo nên hai hợp chất . Nếu đốt cháy cùng lượng mỗi hợp chất tạo ra sẽ thu được cùng thể tích CO2 ( cùng t0, p). Công thức cấu tạo thu gọn của este là công thức nào dưới đây?

  1. H- COO- CH3 B. CH3COO- CH3 C. CH3COO- C2H5                               D. C2H5COO- CH3

Câu 18. Đun nóng axit axetic với isoamylic (CH3)2CH-CH2– CH2 CH2OH có H2SO4 đặc xúc tác thu được isoamyl axetat (dầu chuối). Tính lượng dầu chuối thu được từ 132,35 gam axit axetic đung nóng vứoi 200gam rượu isoamylic. Biết hiệu suất phản ứng đạt 68%.

  1. 97,5gam B. 195,0gam                                         C. 292,5gam                                         D. 159,0gam

Câu 19. Các este có công thức C4H6O2 được tạo ra từ axit và rượu tương ứng có thể có công thức cấu tạo như thế nào?

  1. CH2=CH-COO-CH3; CH3COO-CH= CH2; H- COO- CH2-CH= CH2; H-COO- CH=CH- CH3 và H-COO- C(CH3)=CH2.
  2. CH2=CH-COO-CH3; CH3COO-CH= CH2; H- COO- CH2-CH= CH2; H-COO- CH=CH- CH3
  3. CH2=CH-COO-CH3; H- COO- CH2-CH= CH2
  4. CH2=CH-COO-CH3; CH3COO-CH= CH2; H- COO- CH2-CH= CH2

Câu 20. Đun một lượng dư axit axetic với 13,80 gam ancol etylic (có axit H2SO4 đặc làm xúc tác). Đến khi phản ứng dừng lại thu được 11,0 gam este. Hiệu suất của phản ứng este hóa là bao nhiêu?

  1. 75.0% B. 62.5% C. 60.0%                                               D. 41.67%

Câu 21. Một este có công thức phân tử là C3H6O2, có phản ứng tráng gương với dung dịch AgNO3 trong NH3 , công thức cấu tạo của este đó là công thức nào?

  1. HCOOC2H5 B. HCOOC3H7                                      C. CH3 COOCH3                                  D. C2H5COO CH3

Câu 22. Xà phòng hóa hoàn toàn 9,7 gam hỗn hợp hai este đơn chức X, Y cần 100 ml dung dịch NaOH 1,50M. Sau phản ứng cô cạn dung dịch  thu được hỗn hợp hai rượu đồng đẳng kế tiếp và một muối duy nhất. Công thức cấu tạo thu gọn của 2 este là ở đáp án nào sau đây?

  1. H-COO-CH3 và H-COO-CH2CH3 B. CH3COO-CH3 và CH3COO-CH2CH3 
  2. C2H5COO-CH3 và C2H5COO-CH2CH3 D. C3H7COO-CH3 và C4H9COO-CH2CH3

Câu 23. Một este tạo bởi axit đơn chức và rượu đơn chức có tỷ khối hơi so với khí CO2 bằng 2. Khi đun nóng este này với dung dịch NaOH tạo ra muối có khối lượng lớn hơn bằng este đã phản ứng. Công thức cấu tạo thu gọn của este này là?

  1. CH3COO-CH3 B. H-COO- C3H7 C.  CH3COO-C2H5                               D. C2H5COO- CH3

Câu 24. Một este tạo bởi axit đơn chức và rượu đơn chức có tỷ khối hơi so với khi CO2 bằng 2. Khi đun nóng este này với dung dịch NaOH tạo ra muối có khối lượng  bằng 17/ 22 lượng este đã phản ứng. Công thức cấu tạo thu gọn của este này là?

  1. CH3COO-CH3 B. H-COO- C3H7 C.  CH3COO-C2H5                               D. C2H5COO- CH3

Câu 25. Một este tạo bởi axit đơn chức và rượu đơn chức có tỷ khối hơi so với khi CO2 bằng 2. Khi đun nóng este này với dung dịch NaOH tạo ra muối có khối lượng  bằng 93,18% lượng este đã phản ứng. Công thức cấu tạo thu gọn của este này là?

  1. CH3COO-CH3 B. H-COO- C3H7 C.  CH3COO-C2H5                               D. C2H5COO-CH3

Câu 26. Tính khối lượng este mety metacrylat thu được khi đun nóng 215 gam axit metacrylic với 100 gam rượu metylic. Giả thiết phản ứng hóa este đạt hiệu suất 60%.

  1. 125 gam B. 150gam                                            C. 175gam                                            D. 200gam

Câu 27. Cho 35,2 gam hỗn hợp 2 etse no đơn chức là đồng phân của nhau có tỷ khối hơi đối với H2 bằng 44 tác dụng với 2 lít dd NaOH 0,4M, rồi cô cạn dd vừa thu được, ta được 44,6 gam chất rắn B. Công thức cấu tạo thu gọn của 2 este là :

  1. H-COO-C2H5 và CH3COO-CH3 B. C2H5 COO-CH3 và CH3COO- C2H5
  2. H-COO-C3H7 và CH3COO-C2H5 D. H-COO-C3H7 và CH3COO-CH3

Câu 28. Este X có công thức phân  tử C7H12O4 , khi cho 16 gam X tác dụng vừa đủ với 200 gam dd NaOH 4% thì thu được một rượu Y và 17,80 gam hỗn hợp 2 muối. Công thức cấu tạo thu gọn của X là công thức nào?

  1. H-COO- CH2– CH2– CH2– CH2-OOC- CH3 B. CH3COO- CH2– CH2– CH2-OOC- CH3 
  2. C2H5 – COO- CH2– CH2– CH2-OOC- H D. CH3COO- CH2– CH2-OOC- C2H5 

Câu 29. Chất thơm P thuộc loại este có công thức phân tử C8H8O2. Chất P không được điều chế từ phản ứng của axit và rượu tương ứng, đồng thời không có khả năng dự phản ứng trang gương. Công thức cấu tạo thu gọn của P là công thức nào?

  1. C6H5 – COO- CH2 B. CH3COO- C6H5 C. H-COO- CH2 – C6H5                       D.H-COO-C6H4-CH3

Câu 30.  Cho 1,76 gam một este cacboxilic no, đơn chức và một rượu no, đơn chức phản ứng vừa hết với 40 ml dd NaOH 0,50M thu được chất X và chất Y đốt cháy hoàn toàn 1,20 gam chất Y cho 2,64 gam CO2 và 44 gam nước . Công thức cấu tạo của este là công thức nào?

  1. CH3COO- CH2CH2CH3 B. CH3CH2COOCH3                 C. CH3COOCH3                                          D. H-COO- CH2CH2CH3

Câu 31. Cho ancol X tác dụng với axit Y thu được este Z. Làm bay hơi 4,30 gam Z thu được thể tích hơi bằng thể tích của 1,60 gam oxi (ở cùng t0, p) > Biết MX >MY. Công thức cấu tạo thu gọn của Z là công thức nào?

  1. CH3COO- CH=CH2 B. CH2=CH- COO- CH3 C. H-COO-CH=CH-CH3             D. H-COO- CH2– CH=CH2

Câu 32. Chất X có công thức phân tử C4H8O2 khi tác dụng với dd NaOH sinh ra chất Y có công thức C2H3O2Na và chất Z có công thức C2H6O. X thuộc loại chất nào sau đây?

  1. Axit B. Este                                                   C. Anđehit                                             D. Ancol

 

 

 

 

CHƯƠNG III

GLIXERIN – LIPIT

 

 

Câu 1. Etileglicol và glixerin là.

  1. Rượu bậc hai và rượu bậc ba B. Hai rượu đa chức C. Hai rượu đồng đẳng                       D. Hai rượu tạp chức.

Câu 2. Công thức phân tử của glixerin là công thức nào?

  1. C3H8O3                 B. C2H4O2                                                                     C. C3H8O                                                                       D. C2H6O

Câu 3. Glixerin thuộc loại chất nào?

  1. Rượu đơn chức B. Rượu đa chức C. este                                                    D. Gluxit.

Câu 4. Công thức nào sau đây là công thức cấu tạo của glixerin?

  1. CH2OH-CHOH-CH2OH B. CH3CHOH-CHOH-CH2OH C. CH2OH- CH2OH                             D. CH2OH-CH2OH-CH3

Câu 5. Trong công nghiệp, glixerin được sản xuất theo sơ đồ nào dưới dây?

  1. Propan ® propanol ® gilxerin B. Butan                  ®   axit butylc   ®  gilxerin            
  2. Propen ®  anlyl clorua ®  1,3- điclopropanol-2  ®gilxerin                D.  Metan ®  etan                 ®  propan  ®   gilxerin

Câu 6. Nhỏ vài giọt quỳ tím vào dd gilxerin, quỳ tím chuyển sang màu gì?

  1. Xanh B. Tím                                                   C. Đỏ                                                      D. Không màu.

Câu 7. Tính chất đặc trưng của gilxerin là:

(1) chất lỏng (2) màu xanh lam (3) có vị ngọt (4) tan nhiều trong nước.

                Tác dụng được với: (5) kim loại kiềm; (6) trùng hợp ;(7) phản ứng với axit.

                (8) phản ứng với đồng (II) hiđroxit; (9) phản ứng với NaOH.

                Những tính chất nào đúng?

  1. 2, 6, 9                 B. 1, 2, 3, 4, 6,8.                                   C. 9,7,5,4,1                                           D. 1,3,4,5,7,8

Câu 8. Trong công nghiệp, gilxerin điều chế bằng cách nào?

  1. Đun nóng dẫn xuất halogen (ClCH2-CHCl- CH2Cl) với dd kiềm. B. Cộng nước vào anken tương ứng với xúc tác axit.
  2. Đun nóng dầu thực vật hoặc mỡ động vật với dd kiềm. D. Hiđro hóa anđehit tương ứng với xúc tác Ni.

Câu 9. Đun 9, 2 gilxerin và 9g CH­3COOH có xúc tác được m gam sản phẩm hữu cơ E chứa 1 loại nhóm chức. Biết hiệu suất phản ứng = 60%. M có giá trị là bao nhiêu?

  1. 8,76 B. 9,64                                                   C. 7,54                                                   D. 6,54

Câu 10. Đốt cháy hoàn toàn 1 mol rượu no chưa  biết cần 2,5 mol CO2. Công thức cấu tạo thu gọn của rượu no đó là công thức nào?

  1. C2H4(OH)2                         B. C2H5OH                                            C. C3H5(OH)3                                        D. C3H6(OH)2

Câu 11.  ứng dụng quan trọng nhất của glixerin là gì?

  1. Điều chế thuốc nổ glixerin tristearat B. Làm mềm vải, da trong công nghiệp dệt.
  2. Dung môi cho mực in, mực viết, kem đánh răng. D. Dung môi sản xuất kem chống nè.

Câu 12. Một rượu no (đơn hoặc đa chức) có phân tử khối = 92 đvC. Khi cho 4,6g rượu trên phản ứng với Na cho ra 1,68 lít H2 (đktc). Vậy số nhóm -OH trong phân tử rượu trên là bao nhiêu?

  1. 1                 B. 2                                                         C. 3                                                         D. 4

Câu 13. Để phân biệt glixerin và rượu etylic đựng trong hai lọ không có nhãn, ta dùng thuốc thử nào?

  1. Dung dịch NaOH B. Na                                                      C. Cu(OH)2                                           D. nước brom

Câu 14. Glixerin được điều chế bằng cách đun nóng dầu thực vật hoặc mỡ động vật với dd NaOH. Sau phản ứng thu được 2,3 glixerin. Hãy cho biết khối lượng NaOH cần dùng khi hiệu suất phản ứng là 50%.

  1. 3 gam                 B. 6 gam                                                                C. 12 gam                                             D. 4,6 gam.

Câu 15. Cho các chất sau: HOCH2– CH2OH(1); HOCH2– CH2– CH2OH(2);  HOCH2-CHOH- CH2OH(3); CH3-CH2-O- CH2– CH3(4) và CH3– CHOH- C2H5OH (5). Những chất tác dụng được với Cu(OH)2 là chất nào?

  1. (1), (2), (3) , (5). B. (2), (4), (5), (1). C. (3), (5), (4)                                        D. (1), (3), (5).

Câu 16.  Cho 4,6g rượu no, đa chức (A) tác dụng với Na (dư) sinh ra 1,68 lít H2 (đktc) . Biết rượu A có phân tử khối £ 92 đvC. Công thức phân tử của A là ở đáp án nào sau đây?

  1. C2H4(OH)2 B. C3H5(OH)3 C. C3H6(OH)2                                        D. C4H8(OH)2

Câu 17. Cho 30,4 g hỗn hợp gồm glixerin và một rượu no, đơn chức phản ứng với Na (dư) thoát ra 8,96 lít khí (đktc). Cùng lượng hỗn hợp trên chỉ hòa tan được với 9,8 g Cu(OH)2 . Công thức phân tử của rượu chưa biết là công thức nào?

  1. CH3OH                 B. C2H5OH                                            C. C3H7OH                                            D. C4H9OH

Câu 18. Để hoà tan Cu(OH)2 người ta dùng glixerin . Vậy để hòa tan 9,8g Cu(OH)2 cần bao nhiều gam glixerin?

  1. 4,6 g B. 18,4 g                                                                C. 46 g                                                   D. 23g

Câu 19. Cho các hợp chất sau : HOCH2-CH2OH; HOCH2-CH2-CH2OH; CH3-CHOH-CH2OH; HOCH2-CHOH-CH2OH. Có bao nhiêu chất là đồng phân của nhau?

  1. 1.                 B. 2                                                         C. 3                                                         D. 4

Câu 20. Cho các chất  a, HOCH2-CH2OH     b,  HOCH2-CH­2-CH2OH;  c, CH3-CHOH-CH2OH       d, HOCH2-CHOH-CH2OH

                Những chất thuộc cùng dãy đồng đẳng là những chất nào?

  1. a với c B. a với d                                               C. a với b                                               D. a với b, c

Câu 21. Cho các chất sau:                1. HOCH2– CH2OH;                            2. HOCH2– CH2 – CH2OH;                 3. HOCH2– CHOH-CH2OH

  1. CH3– CH2– O- CH2– CH3  ;             5. CH3- CHOH- CH2OH

Những chất nào tác dụng được với Na là :

  1. 1, 2, 3 B. 2, 4, 5                                 C. 1, 2, 3, 5                                            D. 1, 4, 5.

Câu 22. Glixerin trinitrat có tính chất như thế nào?

  1. Dễ cháy B. Dễ bị phân hủy.                              C. Dễ nổ khi đun nóng nhẹ                                D. Dễ tan trong nước.

Câu 23. Glixerin  khác với rượu etylic ở phản ứng nào?

  1. Phản ứng với Na B. Phản ứng este hóa                         
  2. Phản ứng với Cu(OH)2 D. Phản ứng với HBr (H2SO4 đặc nóng)

Câu 24. Để phân biệt rượu etylic và glixerin , có thể dùng phản ứng nào?

  1. Tráng gương tạo kết tủa. B. Khử CuO khi đun nóng tạo đồng kim lọai màu đỏ.
  2. Este hóa bằng axit axetic tạo este. D. Hòa tan Cu(OH)2 tạo dd màu xanh lam.

Câu 25. Trong các hợp chất sau, hợp chất nào thuộc loại lipit?

  1. (C17H31COO)3C3H5 B. (C16H33COO)3C3H5                         C. (C6H5COO)3C3H5                            D. (C2H5COO)3C3H5

Câu 26. Cho các câu sau:

(1)  Chất béo thuộc loại hợp chất este;                                                          

(2)  Các este không tan trong nước do nhẹ hơn nước.

(3)  Các este không tan trong nước do không có liên kết hiđro với nước.

(4)  Khi đun chất béo lỏng với hiđro có Ni xúc tác thì thu được chất béo rắn.

(5)  Chất béo lỏng là các triglixerit chứa gốc axit không no.

                Những câu đúng là những câu nào?

  1. (1) (4) (5) B. (1) (2) (4)                                          C. (1) (3) (4) (5)                                    D. (1) (2) (3) (5)

Câu 27. Cho các câu sau:

                (1) Chất béo thuộc loại hợp chất este.

                (2) Các este không tan trong nước do nhẹ hơn nước.

                (3)  Các este không tan trong nước do không có liên kết hiđro với nước.

                (4)  Khi đun chất béo lỏng với hiđro có Ni xúc tác thì thu được chất béo rắn.

                (5)  Chất béo lỏng là các triglixerit chứa gốc axit không no.

                Những câu không đúng là những câu nào?

  1. (1) (4) B. (2) (3)                                                C. (1) (2) (4) (5)                                    D. (2)

Câu 28. Chọn đáp án đúng.

  1. Chất béo là trieste của glixerin với axit. B. Chất béo là trieste của ancol với axit béo.
  2. Chất béo là trieste của glixerin với axit vô cơ. D. Chất béo là trieste của glixerin với axit béo.

Câu 29. Khi thủy phân chất nào sau đây sẽ thu được glixerol?

  1. Muối B. Este đơn chức                                  C. Chất béo                                          D. Etyl axetat

Câu 31. Đặc điểm của phản ứng thủy phân lipit trong môi trường axit là gì?

  1. Phản ứng thuận nghịch B. Phản ứng xà phòng hóa. C. Phản ứng không thuận nghịch     D. Phản ứng cho-nhận e.

Câu 32. Tính chất đặc trưng của lipit là:

  1. Chất lỏng 2. Chất rắn                            3. Nhẹ hơn nước                                  4. Không tan trong nước
  2. Tan trong xăng 6. Dễ bị thủy phân 7. Tác dụng với kim loại kiềm          8. Cộng H2 vào gốc rượu.

Các tính chất không đúng là những tính chất nào?

  1. 1, 6, 8 B. 2, 5, 7 C. 1, 2, 7, 8                                            D. 3, 6, 8.

Câu 33. Để biến một số dầu thành mỡ rắn, hoặc bơ nhân tạo người ta thực hiện quá trình nào sau đây?

  1. Hiđro hóa (có xúc tác Ni) B. Cô cạn ở nhiệt độ cao. C. Làm lạnh                                         D. Xà phòng hóa.

Câu 34. Trong cơ thể, lipit bị ôxi hóa thành những chất nào sau đây ?

  1. Amoniac và cacbonic B. NH3, CO2, H2O                                C. H2O và CO2,                                    D. NH3 và H2O

Câu 36. Giữa lipit và este của rượu với axit đơn chức khác nhau về:

  1. Gốc axit trong phân tử. B. Gốc rượu trong lipit cố định là của glixerin
  2. Gốc axit trong lipit phải là gốc của axit béo. D. Bản chất liên kết trong phân tử.

                Hãy chỉ ra kết luận sai.

Câu 37. Có hai bình không nhẵn đựng riêng biệt hai hỗn hợp: dầu bôi trơn máy, dầu thực vật. Có thể nhận biết hai hỗn hợp trên bằng cách nào?

  1. dùng KOH dư B. Dùng Cu(OH)2
  2. Dùng NaOH đun nóng. D. Đun nóng với dd KOH, để nguội, cho thêm từng giọt dd CuSO4.

Câu 38. Khối lượng glixerin thu được chỉ đun nógn 2,225 kg chất béo (loại glixerin tristearat) có chứa 20% tạp chất với dung dịch NaOH (coi như phản ứng xảy ra hoàn toàn) là bao nhiêu kg?

  1. 1,78kg B. 0,184kg                                            C. 0,89kg                                               D. 1,84kg

Câu 39. Thể tích H2 (đktc) cần thiết hiđro hóa hoàn toàn 1 tấn olein (glixrin trioleat) nhờ chất xúc tác Ni là bao nhiêu lít?

  1. 76018 lít B. 760,18 lít C. 7,6018 lít                                          D. 7601,8 lít

Câu 40. Khối lượng olein cần để sản xuất 5 tấn stearin là bao nhiêu kg?

  1. 4966,292kg B. 49600kg C. 49,66kg                                            D. 496,63kg

Câu 41. Mỡ tự nhiên là:

  1. Este của axit panmitic và đồng đẳng v.v.. B. Muối của axit béo.
  2. Hỗn hớp của các triglixerin khác nhau. D. Este của axit oleic và đồng đẳng v.v..

Câu 42. Xà phòng được điều chế bằng cách nào trong các câu sau?

  1. Phân hủy mỡ B. Thủy phân mỡ trong kiềm           
  2. Phản ứng của axit với kim loại D. Đehiđro hõa mỡ tự nhiên.

 

 

 

 

 

CHƯƠNG IV

GLUXIT

Câu 1.    Các chất: Glucozơ (C6H12O6), fomanđehit (HCHO), axetanđehit (CH3CHO), metyl fomiat (H-COOCH3), phân tử đều có nhóm- CHO nhưng trong thực tế để tráng gương người ta chỉ dùng một trong các chất trên, đó là chất nào?

  1. CH3CHO B. HCOOCH3                                       C. C6H12O6                                            D. HCHO

Câu 2. Dữ kiện thực nghiệm nào sau đây không dùng để chứng minh được cấu tạo của glucozơ ở dạng mạch hở?

  1. Khử hoàn toàn glucozơ cho n- hexan. B. Glucozơ có phản ứng tráng bạc.
  2. Glucozơ tạo este chứa 5 gốc axit CH3COO- D. Khi cáo xúc ác enzim, dung dịch Glucozơ lên men tạo rượu etylic.

Câu 3. Dữ kiện thực nghiệm nào sau đây dùng để chứng minh được cấu tạo của Glucozơ ở dạng mạch vòng?

  1. Khử hoàn toàn Glucozơ cho n- hexan B. Glucozơ có phản ứng tráng bạc.
  2. Glucozơ có hai nhiệt độ nóng chảy khác nhau. D. Glucozơ tác dụng với Cu(OH)2 ch dd màu xanh lam.

Câu 4. Cần bao nhiêu gam saccarozơ để pha 500 ml dung dịch 1M?

  1. 85,5gam B. 171 gam                 C. 342 gam                                           D. 684 gam.

Câu 5. Dựa vao tính chất nào sau đây, ta có thể kết luận tinh bột và xenlulozơ là những polime thiên nhiên có công thức (C6H10O5)n?

  1. Tinh bột và xenlulozơ khi bị đót cháy đều cho tỷ lệ mol nCO2 : nH2O = 6: 5
  2. Tinh bột và xenlulozơ đều có thể làm thức ăn cho người và gia súc.
  3. Tinh bột và xenlulozơ đều không tan trong nước.
  4. Thủy phân tinh bột và xenlulozơ đến tận cùng trong môi trường axit đều thu được glucozơ C6H12O6

Câu 6. Đồng phân của glucozơ là chất nào?

  1. Saccarozơ B. Xenlulozơ                                         C. Mantozơ                                          D. Fructozơ.

Câu 7. Khi thủy phân tinh bột, ta thu được sản phẩm cuối cùng là chất nào?

  1. Fructozơ B. Glucozơ                                            C. Saccarozơ                                        D. Mantozơ         

Câu 8. Phân tử Mantozơ được cấu tạo bởi những thành phần nào?

  1. Một gốc Glucozơ và 1 gốc Fructozơ B. Hai gốc Fructozơ ở dạng mạch vòng
  2. Nhiều gốc Glucozơ D. Hai gốc Glucozơ ở dạng mạch vòng.

Câu 9. Chất nào sau đây có phản ứng tráng gương?

  1. Saccarozơ B. Tinh bột C. Glucozơ                                            D. Xenlulơzơ.

Câu 10. Để xác định Glucozơ trong nước tiểu của người bị bệnh đái tháo đường người ta dùng chất nào sau đây?

  1. Axit axetic B. Đồng (II) oxit. C. Natri hiđroxit                                   D. Đồng (II) hiđrôxit.

Câu 11. Qua nghiên cứu phản ứng este hóa xelulozơ, người ta thấy mỗi gốc glucozơ (C6H10O5) có mấy nhóm hiđroxil?

  1. 5. B. 4.                                                        C. 3                                                         D. 2.

Câu 12. Glicogen còn được gọi là gì?

  1. Glixin B. Tinh bột động vật.                          C. Glixerin                                             D. Tinh bột thực vật.

Câu 13. Hãy tìm một thuốc thử để nhận biết được tất cả các chất riêng biệt sau: Glucozơ, glixerol; etanol; andehit axetic.

  1. Na kim loại B. Nước brom. C. Cu(OH)2 trong môi trường kiềm. D. Ag2O/ dd NH3.

Câu 14. Bốn chất X, Y, Z, T có cùng công thức đơn giản nhất . Khi đốt cháy mỗi chất đều có số mol CO2= số mol H2O = số mol O2 tham gia phản ứng cháy. Phân tử khối của mỗi chất đều nhỏ hơn 200 đvC và chúng có quan hệ chuyển hóa theo sơ đồ sau.                                                            X   ®      Y    ®  T   ¬   Z

Y là chất nào?

  1. CH2O B. C2H4O2                                              C. C3H6O3                                              D. C6H12O6

Câu 15. Saccarozơ có thể tác dụng với dãy các chất nào sau đây?

  1. H2/Ni, t0 Cu(OH)2 đun nóng. B. Cu(OH)2, đun nóng CH3COOH/H2SO4 đặc, t0
  2. Cu(OH)2, đung nóng, dd AgNO3/NH3. D. H2/Ni, t0 CH3COOH/H2SO4 đặc, t0

Câu 16. Hỗn hợp A gồm glucozơ và tinh bột được chia đôi. Phần thứ nhất được khuấy trong nước, lọc và cho nước phản ứng với dd AgNO3 (dư )/NH3 thấy tách ra 2,16 g Ag. Phần thứ hai được đun nóng với dd H2SO4 loãng, trung hòa hỗn hợp thu được bằng dd NaOH rồi cho sản phẩm tác dụng với dd AgNO3 (dư)/NH3 thấy tách ra 6,48 g Ag. Giả sử các phản ứng xảy ra hoàn toàn . Hỗn hợp ban đầu có % khối lượng mỗi chất là bao nhiêu?

  1. 64,29 % glucozơ và 35,71% tinh bột về khối lượng. B. 64,71 % glucozơ và 35,29% tinh bột về khối lượng
  2. 35,29 % glucozơ và 64,71% tinh bột về khối lượng. A. 35,71 % glucozơ và 64,29% tinh bột về khối lượng

Câu 17. Cacbonhiđrat (gluxit, saccarit) là:

  1. Hợp chất đa chức, có công thức chung là Cn(H2­­O)m B. Hợp chất đa chức, đa số có công thức chung là Cn(H2­­O)m
  2. Hợp chất chứa nhiều nhóm hiđroxyl và nhóm cacbonyl D. Hợp chất chỉ có nguồn gốc từ thực vật.

Câu 18. Glucozơ lên men thành rượu etylic, toàn bộ khí sinh ra được dẫn vào dd Ca(OH)2 dư tách ra 40 gam kết tủa, biết hiệu suất lên men đạt 75% . Khối lượng glucozơ cần dùng bằng bao nhiêu gam?

  1. 24 gam B. 40 gam                                             C. 50 gam                                             D. 48 gam

Câu 19. Để chứng minh glucozơ có nhóm chức anđehit, có thể dùng một trong ba phản ứng hóa học . Trong các phản ứng sau, phản ứng nào không chứng minh được nhóm chức anđehit của glucozơ.

  1. Oxi hóa glucozơ bằng AgNO3/NH3. B. Oxi hóa glucozơ bằng Cu(OH)2 đun nóng.
  2. Lên men glucozơ bằng xúc tác enzim. D. Khử glucozơ bằng H2/Ni, t0.

Câu 20. Đốt cháy hoàn toàn 0,5130 gam một cacbonhiđrat (X) thu được 0,4032 lít CO2(đktc) và 2,97 gam nước. X có phân tử khối < 400 đvC và có khả năng dự phản ứng tráng gương. Tên gọi của X là gì?

  1. glucozơ B. Saccarozơ C. Fructozơ                                           D. Mantozơ

Câu 21. Fructozơ không phản ứng với chất nào sau đây?

  1. H2/Ni, t0 B. Cu(OH)2                                           C. Ag2O / dd NH3                                                  D. Dung dịch brom.

Câu 22. Dùng 340,1 kg xenlulozơ và 420 kg HNO3 nguyên chất có thể thu được bao nhiêu tấn xenlulozơ trinitrat, biết sự hao hụt trong quá trình sản xuất là 20% .

  1. 0,75 tấn B. 0,6 tấn C. 0,5 tấn                                              D. 0,85 tấn

Câu 23. Phản ứng nào sau đây chuyển glucozơ và fructozơ   thành một sản phẩm duy nhất?

  1. Phản ứng với Cu(OH)2 đun nóng B. Phản ứng với dd Ag/NH3
  2. Phản ứng với H2/Ni, t0 D. Phản ứng với Na.

Câu 24. Khi CO2 chiếm 0,03% thể tích không khí. Muốn có đủ CO2 cho phản ứng quang hợp để tạo ra 500g tinh bột thì cần một thể tích không khí là bao nhiêu lít?

  1. 1382666,7lít B. 1402666,7lít                                    C. 1382600,0lít                                    D. 1492600,0 lít

Câu 25. Đặc điểm giống nhau giữa glucozơ và saccarozơ là gì?

  1. Đều có trong củ cải đường. B. Đều tham gia phản ứng tráng gương.
  2. Đều hòa tan Cu(OH)2 ở nhiệt độ thường cho dd màu xanh. D. Đều được sử dụng trong y học làm “huyết thanh ngọt”

Câu 26. Cho 2,5 gam glucozơ chứa 20% tạp chất lên men thành rượu. Tính thể tích rượu 400 thu được, biết rượu nguyên chất có khối lượng riêng 0,8 g/ml và trong quá trình chế biến, rượu bị hao hụt mất 10%.

  1. 3194,4ml B. 2785,0ml                                          C. 2875,0ml                                          D. 2300,0ml

Câu 27. Câu nào sai trong các câu sau?

  1. Không thể phân biệt mantozơ và đường nho bằng cách nếm.
  2. Tinh bột và xenlulozơ không tham gia phản ứng tráng gương vì phân tử đều không chứa nhóm chức -CH=O.
  3. Iot làm xanh tinh bột vì tinh bột có cấu trúc đặc biệt nhờ liên kết hiđro giữa các vòng xoắn amilozơ hâp thụ iot.
  4. Có thể phân biệt manozơ với saccarozơ bằng phản ứng tráng gương.

Câu 28. Có thể tổng hợp rượu etylic từ CO2 theo sơ đồ sau:      CO2 ®   Tinh bột   ®  Glucozơ   ®   Rượu etylic

Tính thể tích CO2 sinh ra kèm theo sự tạo thành rượu etylic nếu CO2 lúc đầu dùng là 1120 lít (đktc) và hiệu suất của mỗi quá trình lần lượt là 50% , 75%, 80%.

  1. 373,3 lít B. 280,0 lít                                            C. 149,3 lít                                            D. 112,0 lít

Câu 29. Mô tả nào dưới đây không đúng với glucozơ ?

  1. Chất rắn, màu trắng, tan trong nước và có vị ngọt. B. Có mặt trong hầu hết các bộ phận của cây, nhất là trong quả chín.
  2. Còn có tên gọi là đường nho. D. Có 0,1% trong máu người.

Câu 30. Khử glucozơ bằng hiđro để tạo socbitol. Khối lượng glucozơ dùng để tạo ra 1,82 gam socbitol với hiệu suất là bao nhiêu gam?

  1. 2,25 gam B. 1,44 gam                                          C. 22,5 gam                                          D. 14,4 gam.

Câu 31.Glucozơ không có được tính chất nào dưới đây.

  1. Tính chất của nhóm anđehit                 B. Tính chất của poliol
  2. Tham gia phản ứng thủy phân D. Lên men tạo  rượu etylic.

Câu 32. Xenlulozơ trinitrat là chất dễ cháy, nổ mạnh. Muốn điều chế 29,7 kg  xenlulozơ trinitrat từ xenlulozơ và axit nitric với hiệu suất 90% thì thể tích HNO3 96% (D= 1,52g/ml) cần dùng là bao nhiêu lít?

  1. 14,390 lít B. 15,000 lít.                                         C. 1,439 lít                                            D. 24,390 lít.

Câu 33. Cho 8,55 gam cácbonhiđrat A tác dụng với dung dịch HCl, rồi sản hẩm thu được tác dụng với lượng dư AgNO3/NH3 tạo thành 10,8 gam Ag kết  tủa. A có thể là chất nào trong các chất sau?

  1. Glucozơ B. Fructozơ                                           C. Saccarozơ                                        D. Xenlulozơ.

Câu 34. Câu nào đúng trong các câu sau? Tinh bột và xenlulozơ khác nhau về

  1. Công thức phân tử.                                                                                 B. Tính tan trong nước lạnh.
  2. Cấu trúc phân tử.                                                                 D. Phản ứng thủy phân.

Câu 35. Tính khối lượng kết tủa Ag hình thành khi tiến hành tráng gương hoàn toàn dd chứa 18gam glucozơ.

  1. 2,16g am B. 5,40gam                                           C. 10,80gam                                         D. 21,60gam.

Câu 36. Cho xenlulozơ, toluten, phenol, glixerin tác dụng với HNO3/H2SO4 đặc. Phát biểu nào sau đây sai về các phản ứng này?

  1. Sản phẩm của các phản ứng đều chứa nitơ. B. Sản phẩm của các phản ứng đều có nước tạo thành.
  2. Sản phẩm của các phản ứng đều thuộc loại hợp chất nitơ, dễ cháy, nổ. D. Các phản ứng đèu thuộc cùng một loại.

Câu 37. Quá trình thủy phân tinh bột bằng enzim không xuất hiện chất nào dưới dây?

  1. Đextrin B. Saccarozơ.                                       C. Mantozơ                                          D. Glucozơ.

Câu 38. Cho glucozơ lên men với hiệu suất 70% hấp thụ toàn bộ sản phẩm khí thoát ra vào 2 lít dd NaOH 0,5M (D= 1,05ml) thu được dd chứa hai muối với tổng nồng độ là 12,27 % khối lượng glucozơ đã dùng là.

  1. 129,68 gam                 B. 168,29gam                                      C. 192,86 gam                                     D. 186,92 gam

Câu 39. Để phân biệt glucozơ và fructozơ thì nên chọn thuốc thử nào dưới dây?

  1. Dung dịch Ag2O trong NH3 B. Cu(OH)2 / OH. C. Dung dịch brom                              D.ddCH3COOH/H2SO4 đ

Câu 40. Lên men a gam glucozơ với hiệu suất 90%, lượng CO2 sinh ra được hấp thụ hết bởi dd nước vôi trong thu đựơc 10 gam kết tủa và khối lượng dd giảm 3,4 ga . a có giá trị như thế nào?

  1. 13,5 gam B. 15,0 gam                                          C. 20,0 gam                                          D. 30,0 gam

Câu 41. Để phân biệt saccarozơ, tinh bột và xenlulozơ  ở dạng bột nên dùng cách nào sau đây?

  1. Cho từng chất tác dụng với HNO/H2SO4. B. Cho từng chất tác dụng với dd iot.
  2. Hòa tan từng chất vào nước, đun nóng nhẹ và thử với dd iot. D. Cho từng chất vào nước, đun nóng nhẹ và thử với dd iot.

Câu 42. Xenlulozơ tác dụng với anhiđrit axetic (H2SO4 đặc xúc tác) tạo ra 9,84 gam este axetat và 4,8 gam CH3COOH. Công thức của este axetat có dạng.

A.[C6H7O2(OOC-CH3)3]n                                                                                     B. [C6H7O2(OOC-CH3)2OH]n            

  1. [C6H7O2(OOC-CH3)2(OH)2]n D. [C6H7O2(OOC-CH3)3]n và [C6H7O2(OOC-CH3)2OH]n

Câu 43. Phát biểu nào dưới đây chưa chính xác?

  1. Monosaccarit là cacbonhiđrat không thể thủy phân được.
  2. Disaccarit là cacbonhiđrat thủy phân sinh ra hai phân tử monosaccartit.
  3. Polisaccarit là cacbonhiđrat thủy phân sinh ra hai phân tử monosaccartit.
  4. Tinh bột, mantozơ và glucozơ lần lượt là poli- đi- và monosaccarit.

Câu 44. Thực nghiệm nào sau đây không tương ứng với cấu trúc của glucozơ?

  1. Khử hoàn toàn tạo n- hexan.
  2. Tác dụng với : AgNO3/NH3 tạo kết tủa Ag, với Cu(OH)2 /OH tạo kết tủa đỏ gạch và làm nhạt màu nước brom.
  3. Tác dụng với Cu(OH)2 tạo dd màu xanh lam, tác dụng với (CH3CO)2O tạo este tetraaxetat.
  4. Có hai nhiệt độ nóng chảy khác nhau

Câu 45. Glucozơ không có tính chất nào dưới đây?

  1. Tính chất của nhóm anđehit. B. Tính chất của poliol.
  2. Tham gia phản ứng thủy phân. D. Tác dụng với CH3OH trong HCl.

Câu 47. Khối lượng kết tủa đồng (I) ôxit tạo thành khi đun nóng dd hỗn hợp chứa 9 gam glucozơ và lượng dư đồng (II) hiđroxit trong môi trường kiềm là bao nhiêu gam?

  1. 1,44 gam B. 3,60gam                                           C. 7,20 gam                                          D. 14,4 gam.

Câu 48. Cho lên men 1m3 nước rỉ đường glucozơ thu đựoc 60 lít cồn 960. Khối lượng glucozơ có trong thùng nước rỉ đường glucozơ là bao nhiêu kg? Biết khối lượng riêng của ancol etylic bằng 0,789 g/ml ở 200 và hiệu suất quá trình lên men đạt 80%.

  1. » 71kg                 B. » 74kg                                               C. » 89kg                                               D. » 111kg

Câu 49. Lên men a gam glucozơ với hiệu suất 90% lượng CO2 sinh ra hấp thụ hết vào dd nước vôi trong thu được 10 gam kết tủa và khối lượng dd giảm 3,4 gam, a có giá trị là bao nhiêu?

  1. 13,5 gam B. 15,0 gam                                          C. 20,0 gam                                          D. 30,0 gam

Câu 50. Ứng dụng nào dưới đây không phải là ứng dụng cảu glucozơ?

  1. Làm thực phẩm dinh dưỡng và thuốc tăng lực. B. Tráng gương, tráng phích.
  2. Nguyên liệu sản xuất ancol etylic. D. Nguyên liệu sản xuất PVC.

Câu 51. Saccarozơ và mantozơ sẽ tạo thành sản phẩm giống nhau khi tham gia phản ứng nào dưới đây?

  1. Tác dụng với Cu(OH)2 B. Tác dụng với Ag2O/ ddNH3 C. Thủy phân                                       D. Đốt cháy hoàn toàn.

Câu 52. Cacbonhiđrat Z tham gia chuyển hóa:

                Z      dd xanh lam         kết tủa đỏ gạch

                Vậy Z không thể là chất nào trong các chất cho dưới đây?

  1. Glucozơ                 B. Fructozơ                                           C. Saccarozơ                                        D. Mantozơ.

Câu 53. Nhận xét nào dưới đây không đúng?

  1. Ruột bánh mì ngọt hơn vỏ bánh mì. B. Khi cơm, nếu nhai kỹ sẽ thấy vị ngọt.
  2. Nhỏ dd iot lên miếng chuối xanh xuất hiện màu xanh. D. Nước ép chuối chín cho phản ứng tráng bạc.

Câu 54. Từ 10 kg gạo nếp (có 80% tinh bột), khi lên men sẽ thu được bao nhiêu lít cồn 960? Biết hiệu suất quá trình lên men đạt 80% và khối lượng riêng của cồn là 960 là 0,807 g/ml.

  1. » 4,7 lít B. » 4,5 lít                                             C. » 4,3 lít                                             D. » 4,1 lít

Câu 55. Tinh thể dd HNO3 96% (D= 1,52g/ml) cần dùng để tác dụng với lượng dư xenlulozơ tạo 29,7 gam xenlulozơ trinitrat?

  1. 24,39 lít                 B. 15,00 lít                                            C. 14,39 lít                                            D. 1,439 lít

Câu 56. Phát biểu nào dưới dây về ứng dụng của xenlulozơ là không đúng?

  1. Xenlulozơ dưới dạng tre, gỗ, nứa… làm vật liệu xây dựng, đồ dùng gia đình , sản xuất giấy..
  2. Được dùng để sản xuất một số tơ tự nhiên và nhân tạo.
  3. Là nguyên liệu sản xuất ancol etylic.
  4. Là thực phẩm cho con người.

 

CHƯƠNG V

AMINO AXIT- PROTIT

 

Câu 1. Phát biểu nào dưới dây về aminoaxit  là không đúng?

  1. Aminoaxit là hợp chất hữu cơ tạp chức, phân tử chứa đồng thời nhóm amino và nhóm cacboxil
  2. Hợp chất H2N-COOH là aminoaxit đơn giản nhất.
  3. Aminoaxit ngoài dạng phân tử (H2NRCOOH) còn có dạng ion lưỡng cực (H3N+RCOO).
  4. Thông thường dạng ion lưỡng cực là dạng tồn tại chính của aminoaxit .

Câu 2. Tên gọi của aminoaxit nào dưới đây là đúng?

  1. H2N-CH2-COOH ó (glixerin) B. CH3-CH(NH2)-COOH ó (anilin)
  2. CH3-CH (CH3)-CH(NH2)-COOH ó (valin) D.  HOOC-(CH2)2-CH(NH2)-COOH ó (axit glutaric)

Câu 3. Trường hợp nào dưới dây không có sự phù hợp giữa cấu tạo và tên gọi?

  1. C6H5-CH2-CH(NH2)-COOH ó axit 2- amino- 3 phenylpropanoic (phenylalanin)
  2. CH3-CH(NH2)-CH(NH2)-COOH ó axit 3- amino- 2 metylbutanoic
  3. CH3– CH(CH3)- CH2 – CH(NH2)-COOH ó axit 2- amino- 4 metylpentanoic             
  4. CH3-CH2– CH(CH3)- CH(NH3+)-COOH ó axit 2- amino- 3 metylpentanoic (isoloxin)

Câu 4. Khẳng định về tính chất vật lý nào của amio axit dưới đây không đúng?

  1. Tất cả đều là chất rắn B. Tất cả đều là tinh thể, màu trắng
  2. Tất cả đều tan trong nước D. Tất cả đều có nhiệt độ nóng chảy cao.

Câu 5. Aminoaxit không thể phản ứng với loại chất nào dưới đây?

  1. Ancol                                                                                 B. Dung dịch brom                                             
  2. Axit (H+) và axit nơtrơ D. Kim loại, oxit bazơ , bazơ và muối.

Câu 6. Cho  0,01 mol amioaxit A phản ứng vừa đủ với 0,02 mol HCl hoặc 0,01 mol NaOH. Công thức của A có dạng như thế nào?

  1. H2NRCOOH B. (H2N)2RCOOH C. H2NR(COOH)2                                D. (H2N)2R(COOH)2

Câu 7. Cho 0,1 mol A (- aminoaxit dạng H2NRCOOH) phản ứng hết với HCl tạo 11,15 gam muối. A là chất nào sau đây?

  1. Glixin B.Alamin C. Phenylalanin                   D. Valin

Câu 8. Cho – aminoaxit mạch thẳng A có công thức H2NR(COOH)2 phản ứng hết với 0,1 mol NaOH tạo 9,55 gam muối. A là chất nào sau đây?

  1. Axit 2- aminopropanđioic B. Axit 2- aminobutanđioic
  2. Axit 2- aminopentanđioic D. Axit 2- amino hexanđioic

Câu 9. Cho các dãy chuyển hóa.     Glixin  A   X

Glixin   B   Y

                X và Y lần lượt là chất nào?

  1. Đều là ClH3NCH2COONa B. ClH3NCH2COONa và ClH3NCH2COONa
  2. ClH3NCH2COONa và H2NCH2COONa D. ClH3NCH2COONa và H2NCH2COONa

Câu 10. Cho glixin (X) phản ứng với các chất dưới dây, trường hợp nào phương trình hóa học được viết không đúng?

  1. X + HCl ® ClH3NCH2COONa B. X + NaOH ® H2NCH2COONa
  2. X + CH3OH+ HCl D ClH3NCH2COONa + H2O                                     D. X + HNO2 ® HOCH2COOH+ N2+ H2O

Câu 11. Một hợp chất hữu cơ X có tỉ lệ khối lượng C, H, O, N là 9 : 1,75 : 8 : 3,5 tác dụng với dd NaOH và dd HCl đều theo tỷ lệ mol 1: 1 và mỗi trường hợp chỉ tạo một muối duy nhất. Một đồng phân Y của X cũng tác dụng được với dd NaOH và dd HCl theo tỷ lệ 1: 1 nhưng đồng phân này có khả năng làm mất màu dd brom.

Công thức phân tử của X, công thức cấu tạo của X, Y lần lượt là ở đáp án nào sau đây?

  1. C3H7O2N; H2N-C2H4-COOH;H2N-CH2-COO-CH3 B. C3H7O2N; H2N-C2H4-COOH;CH2 =CH-COONH4
  2. C2H5O2N; H2N-C2H4-COOH;H2N-CH2-COO-CH3 D. C3H5O2N; H2N-C2H2-COOH;CH=C-COONH4

Câu 12. (X) là hợp chất hữu cơ có công thức phân tử  C3H11O2N. Đun X với dd NaOH thu được một hỗn hợp chất có công thức phân tử C2H4O2NNa và chất hữu cơ (Y), cho hơi (Y) qua CuO/t0 thu được chất hữu cơ (Z) có khả  năng tham gia phản ứng tráng gương. Công thức cấu tạo của (X) là công thức nào dưới đây?

  1. CH3 (CH2)4N O2 B. NH2-CH2COO-CH2-CH2-CH3   
  2. NH2-CH2 -COO-CH(CH3)2 D.  H2N -CH-CH2– COOC2H5

Câu 13. X là một a-aminoaxit no chỉ chứa một nhóm -NH2 và một nhóm – COOH. Cho 10,3 gam X tác dụng với dd HCl dư thu được 13,95 gam muối clohiđrat của X. Công thức cấu tạo thu gọn của X là công thức nào sau đây?

  1. CH3CH(NH2)COOH B. H2NCH2COOH C. H2NCH2CH2COOH        D. CH3CH2CH(NH2)COOH

Câu 14. Cho các chất sau (X1) C6H5NH2; (X2) CH3NH2; (X3) H2NCH2COOH; (X4) HOOCCH2CH2CH(NH2) COOH;

                (X5) H2NCH2 CH2CH2CH2 CH2 (NH2 )COOH.  Dung dịch nào dưới đây làm quỳ tím hóa xanh?

  1. X1; X2; X5; B. X2; X3; X4;                                        C.  X2; X5;                                              D. X1; X5; X4;

Câu 15.  Cho các dung dịch sau: (1). H2NCH2 COOH;                (2) Cl- NH3+– CH2COOH;                   (3) H2NCH2 COO;

(4)   H2N(CH2)2CH(NH2)COOH;      (5)    HOOC(CH2)2CH(NH2)COOH.     Dung dịch nào làm quỳ tím hóa đỏ?

  1. (3)                 B. (2)                                                      C. (2), (5)                                               D. (1); (4).

Câu 16. X là chất hữu cơ có công thức phân tử là C5H11O2N. Đun X với dd NaOH thu được một hỗn hợp chất có CTPT C2H4O2Na và chất hữu cơ B. Cho hơi của B qua CuO/t0 thu được chất D có khẳ năng cho phản ứng tráng gương . Công thức cấu tạo thu gọn của A là công thức nào sau đây?

  1. CH3(CH2)4NO2 B. H2NCH2COONH2CH2CH2CH3.
  2. H2NCH2COOCH(CH3)2 D. H2NCH2CH2COOC2C2H5.

Câu 17. Este X được điều chế tà aminoaxti và rượu etylic. Tỉ khối hơi của X so với hiđro 5,15 . Đốt cháy hoàn tàon 10,3 gam X thu được 17,6gam khí CO2, 8,1gam nước và 1,12 lít nitơ (đktc). Công thức cấu tạo thu gọn của X là công thức nào sau đây?

  1. H2N- (CH2)2 – COO-C2H5. B. H2N- CH(CH3) – COO C. H2N- CH2 CH(CH3) – COOH             ­D. H2N-CH2 -COO-CH

Câu 19. Tên gọ nào sau đây là của peptit.

                                H2NCH2CONHCH(CH3)CONHCH2COOH

  1. Glixialaninglyxi C. Glixylalanylglyxin. B. Alanylglyxylalanin                         D. Anlanylglyxyglyxyl.

Câu 20. Trong bốn ống nghiệm mất nhãn chứa riêng biệt từng dd : glixerin, lòng trắng trứng gà, tinh bột, xà phòng. Thứ  tự hóa chất dùng làm thuốc thử để nhận ra ngay mỗi dd là ở đáp án nào sau đây?

  1. Quỳ tím, dd iot, Cu(OH)2, HNO3 đặc. B. Cu(OH)2, dd iot, quỳ tím, HNO3 đặc.
  2. dd iot, HNO3 đặc, Cu(OH)2, quỳ tím, D. Cu(OH)2,quỳ tím, HNO3 đặc dd iot.

Câu 21. Câu nào sau đây không đúng?

  1. Khi nhỏ axit HNO3 đặc vào lòng trắng trứng thấy có màu vàng. B. Phân tử các protit gồm các mạch dài polipepti tạo nên.
  2. Protit rất ít tan trong nước và dễ tan khi đun nóng. D. Khi cho Cu(OH)2 vào lòng trắng trứng thâý có màu tím xanh.

Câu 22. Một hợp chất chứa các nguyên tố C, H, O, N có phân tử khối = 89 đvC. Đốt cháy hoàn toàn 1 mol hợ chất thu được 3 mol CO2 0,5 mol N2 và a mol hơi nước. Công thức phân tử của hợp chất đó là công thức nào dưới đây?

  1. C4H9O2N                                 B. C2H5O2N                                           C. C3H7 ­NO2                                          D. C3H5 NO2

Câu 23. Thủy phân hợp chất:

                H2N –  CH2 – CO – NH – CH(CH2COOH)-CO-NH-CH(CH2-C6H5)-CO-NH-CH2-COO   thu được các aminoaxit nào sau đây?

  1. H2N-CH2-COOH B. HOOC-CH2– CH (NH2)-COOH   C. C6H5-CH2– CH (NH2)-COOH       D. 3 aminoaxit A, B, C.

Câu 24. Trong các chất sau : Cu, HCl, C2H5OH, HNO2, KOH, Na2SO3, CH3OH/khí HCl. Axit aminoaxetic tác dụng được với những chất nào?

  1. Tất cả các chất. B. HCl, HNO2, KOH, Na2SO3, CH3OH/khí HCl
  2. C2H5OH, HNO2, KOH, Na2SO3, CH3OH/Khí HCl, Cu. D. Cu, KOH, Na2SO3, HCl, HNO2, CH3OH/Khí HCl.

Câu 25. X là một aminoaxit no chỉ chứa 1 nhóm – NH2 và 1 nhóm COOH. Cho 0,89 gam X tác dụng với HCl vừa đủ tạo r a 1,255 gam muối. Công thức cấu tạo của X là công thức nào sau đây?

  1. H2N- CH2-COOH B. CH3– CH(NH2)-COOH. C. CH3-CH(NH2)-CH2-COOH.          D. C3H7-CH(NH2)-COOH

Câu 26. Cho dung dịch của các chất riêng biệt sau: C6H5-NH2(X1) (C6H5 là vòng benzen); CH3NH2 (X2); H2N- CH2-COOH (X3); HOOC-CH2– CH2CH(NH2)- COOH (X4);   H2N-(CH2)4-CH(NH2)-COOH (X5).  Những dd làm giấy quỳ tím hóa xanh là dd nào?

  1. X1, X2, X5 B. X2, X3, X4                                          C.  X2, X5                                               D. X3, X4, X5         

Câu 27. X là một – amioaxit no chỉ chứa 1 nhóm -NH2 và 1 nhóm -COOH. Cho 15,1 gam X tác dụng với HCl dư thu được 18,75 gam muối. Công thức cấu tạo của X là công thức nào?

  1. C6H5– CH(NH2)-COOH B. CH3– CH(NH2)-COOH       C. CH3-CH(NH2)-CH2-COOH             D. C3H7CH(NH2)CH2COOH

Câu 28. Protit (protein) có thể được mô tả như thế nào?

  1. Chất polime trùng hợp B. Chất polieste. C. Chất polime đồng trùng hợp        D. Chất polime ngưng tụ

Câu 29. Khi dùng lòng trắng trứng gà để làm trong môi trường (aga, nước đường) ta đã ứng dụng tính chất nào sau đây?

  1. Tính bazơ của protit B. Tính axit của protit C. Tính lưỡng tính của protit.
  2. Tính động tụ ở nhiệt độ cao và đông tụ không thuận nghịch của abumin.

Câu 30. X là một – amioaxit no chỉ chứa 1 nhóm -NH2 và 1 nhóm -COOH. Cho 23,4 gam X tác dụng với HCl dư thu được 30,7  gam muối. Công thức cấu tạo  thu gọn của X là công thức nào?

  1. CH3-CH(NH2)-COOH B. H2N-CH2-COOH C. H2N-CH2CH2 -COOH       D.CH2=C(CH3)CH(NH2)COOH

Câu 31. Hợp chất C3H7O2 tác dụng được với NaOH, H2SO4 và làm mất màu dd Br2 có. Hợp chất đó có công thức cấu tạo như thế nào?

  1. CH3CH(NH2)COOH B. H2NCH2CH2COOH                        C. CH2=CHCOONH4                        D.CH2=CH-CH2-COONH4

Câu 32. Aminoaxit là những hợp chất hữu cơ trong phân tử chứa.

  1. Nhóm amino B. Nhóm cacboxyl                              C. Một nhóm amino và một nhóm Cacboxyl
  2. Một họăc nhiều nhóm amino và một họăc nhiều nhóm cacboxyl

Câu 33. – amino axit là amino axit mà nhóm amino gắn ở cácbon ở vị trí thứ mấy?

  1. 1 B. 2                                                         C. 3.                                                        D. 4.

Câu 34. Cho các  chất :     X: H2N- CH2-COOH;             T: CH3-CH2-COOH ;       Y: H3C-NH-CH2-CH3 ;   Z: C6H5-CH(NH2)-COOH.

G:  HOOC-CH2-CH(NH2)COOH  và    P:   H2N-CH2-CH2-CH2-CH(NH2)COOH .   Aminoa xit là những chất nào?

  1. X, Z, T, P B. X, Y, Z, T                                          C. X, Z, G, P                                          D. X, Y, G, P

Câu 35. C4H9O2N có mấy đồng phân aminoaxit (với nhóm amin bậc nhất)?

  1. 2 B. 3.                                                        C. 4                                                         D. 5

Câu 36. Cho quỳ tím vào mỗi dd dưới đây, dd làm quỳ tím hóa xanh là dd nào?

  1. CH3COOH B. H2N-CH2-COOH C. H2N-CH2(NH2)COOH                    D. HOOC-(CH2)2 CH(NH2)COOH

Câu 37. Tên gọi của hợp chất C6H5-CH2-CH(NH2)-COOH như thế nào?

  1. Axit amino phenyl propionic. B. Axit 2-amino-3-phenylpropinic.
  2. Phenylalamin. D. Axit 2 mino-3-phenylpropanoic.

Câu 38. Cho dung dịch quỳ tím vào 2 dd sau :X. H2N-CH2-COOH;        Y: HOOC-CH(NH2)-CH2-COOH.     Hiện tượng xảy ra là gì?

  1. X và Y đều không đổi màu quỳ tím. B. X làm quỳ chuyên màu xanh, Y làm quỳ chuyển màu dỏ.
  2. X không đổi màu quỳ tím, Y là quỳ chuyển màu đỏ. D. Cả hai đều làm quỳ chuyển sang màu đỏ.

Câu 39. C3H7O2N có bao nhiêu đồng phân aminoaxit (với nhóm amin bậc nhất)?

  1. 2 B.3                                                          C. 4                                                         D. 5.

Câu 40. Phản ứng giữa alanin và axit clohiđric tạo ra chất nào sau đây?

A.H2N-CH(CH3)-COCl                       B. H3N-CH(CH3)-COCl                      C. HOOC-CH(CH3)-NH3Cl     D. HOOC-CH(CH2 Cl)-NH2

Câu 41. Axit – aminopronic tác dụng được  với tất cả các chất trong dãy nào sau đây?

  1. HCl, NaOH, C2H5OH có mặt HCl, K2SO4, H2N-CH2-COOH B. HCl, NaOH, CH3OH có mặt HCl, H2N-CH2-COOH, Cu.
  2. HCl, NaOH, CH3OH có mặt HCl, H2N-CH2-COOH D. HCl, NaOH, CH3OH/ HCl, H2N-CH2-COOH, NaCl.

Câu 42. Chất A có % khối lượng các nguyên tố C, H, O, N lần lượt là 32%, 6,67% 42,66%, 18,67%. Tỉ khối hơi của A so với không khí nhỏ hơn 3. A vừa tác dụng NaOH vừa tác dụng dd HCl, A có công thức cấu tạo như thế nào?

  1. CH3-CH(NH2)-COOH B. H2N-(CH2)2-COOH C. H2N-CH2-COOH                             D. H2N-(CH2)3-COOH

Câu 43. Chất A có thành phân % các nguyên tố C, H, N lần lượt là 40,45%, 7,86%, 15,73% còn lại là oxi. Khối lượng mol phân tử của A <100 g/mol. A tác dụng được với NaOH và với HCl, có nguồn gốc từ thiên nhiên, A có CTCT như thế nào.

  1. CH3-CH(NH2)-COOH B. H2N-(CH2)2-COOH C. H2N-CH2-COOH                             D. H2N-(CH2)3-COOH

Câu 44. Công thức tổng quát của các aminoaxit là công thức nào dưới đây?

  1. R(NH2)(COOH) B. (NH2)x (COOH) C.R(NH2)x (COOH)y                           D. H2N-CxHy-COOH.

Câu 45. Khi đun nóng các phân tử – alinin (axit – aminopronic) có thể tác dụng với nhau tạo sản phẩm nào dưới đây?

  1. [-NH-CH(COOH)-CH2-]n B.  [-CH2-CH(NH2)-CO-]n                  C.  [-NH-CH(CH3)-CO-]n                    A. [-NH-CH2-CO-]n

Câu 46. Có các cách phát biểu sau về protit:

(1). Protit là hợp chất cao phân tử thiên nhiên có cấu trúc phức tạp.

(2). Protit chỉ có trong cơ thể người và động vật.

(3). Cơ thể người và động vật không thể tổng hợp được protit từ những chất vô cơ mà chỉ tổng hợp được từ các aminnoaxit.

(4). Protit bền đối với nhiệt, đối với axit và kiềm.

                Phát biểu nào đúng?

  1. 1, 2 B. 2,3                                                     C. 1,3                                                     D. 3,4

Câu 47. Điền từ thích hợp vào chỗ trống trong câu sau:  Sự kết tủa protit bằng nhiệt được gọi là………………………………protit.

  1. Sự trùng ngưng B. Sự ngưng tụ C. Sự phân hủy                                    D. Sự đông tụ.

Câu 48. Khi nhỏ axi HNO3 đậm đặc vào dd lòng trắng trứng đun nóng hỗn hợp thấy xuất hiện:……….(1)…………….., cho đồng (II) hiđroxit vào dd lòng trắng  trứng thấy màu………..(2)…………..xuất hiện .

  1. (1) kết tủa màu trắng, (2) tím xanh. B. (1) kết tủa màu vàng, (2) tím xanh.
  2. (1) kết tủa màu xanh, (2) vàng. D. (1) kết tủa màu vàng, (2) xanh.

Câu 49. Thủy phân đến cùng protit ta thu được các chất nào?

  1. Các aminoaxit B. Các aminoaxit                                 C. Các chuỗi polipeptit                 D. Hỗn hợp các aminoaxit.

Câu 50. Khi đun nóng protit trong dd axit hoặc kiềm hoặc dưới tác dụng của các men, protit bị thủy phân thành………(1)……., cuối cùng thành………(2)……….

  1. (1). Phân tử protit nhỏ hơn ; (2) aminoaxit B. (1). chuỗi polipepti ; (2) aminoaxit
  2. (1). chuỗi polipepti ; (2) hỗn hợp các aminonaxit. D. (1). chuỗi polipepti  ; (2) aminoaxit

Câu 53. Phát biểu nào sau đây không đúng?

  1. Những hợp chất hình thành bằng cách ngưng tụ hai hay nhiều -aminoaxit được gọi là peptit.
  2. Phân tử có hai nhóm – CO-NH- được gọi là đipeptit, ba nhóm thì được gọi là tripeptit.
  3. Các peptit có từ 10 đến 50 đơn vị amino axit cấu thành được gọi là polipeptit.
  4. Trong mỗi phân tử peptit, các aminoaxit được sắp xếp theo một thứ tự xác định.

Câu 54. Phát biểu nào dưới đây về protein là không đúng?

  1. Protein là những polipeptit cao phân tử (phân tử khối từ vài chục ngàn đến vài triệu đvC).
  2. Protein có vai trò là nền tảng về cấu trúc và chức năng của mọi sự sống .
  3. Protein đơn giản là những protein được tạo thành chỉ từ các gốc – và – aminoaxit.
  4. Protein phức tạp là những protein được tạo thành từ protein đơn giản và lipit, gluxit, axit nucleic…

Câu 56. Khi thủy phân hoàn toàn policaproamit trong dd NaOH nóng, dư được sản phẩm nào sau đây?

  1. H2N(CH2)5COOH B. H2N(CH2)6COONa C. H2N(CH2)5COONa                         D. H2N(CH2)6COO

Câu 57. Cho biết sp thu được khi thủy phân hoàn toàn tơ enan trong dd HCl dư.

  1. ClH3N(CH2)5COOH B. ClH3N(CH2)6COOH                 C. H2N(CH2)5COO                               D. H2N(CH2)6COO

Câu 58. Mô tả hiện tượng nào dưới đây không chính xác?

  1. Nhỏ vài giọt axit nitric đặc vào dd lòng trắng trứng thấy kết tủa màu vàng.
  2. Trộn lẫn lòng trắng trứng, dd NaOH và một ít CuSO4 thấy xuất hiện màu đỏ đặc trưng.
  3. Đun nóng dd lòng trắng trứng thấy hiện tượng đông tụ lại, tách ra khỏi dd.
  4. Đốt cháy một mẫu lòng trắng trứng thấy xuất hiện mùi khét như mùi tóc cháy.

 

 

CHƯƠNG VI

HỢP CHẤT CAO PHÂN TỬ- VẬT LIỆU POLIME

 

Câu1. Điền từ thích hợp vào các chỗ trống trong định nghĩa về polime : “Polime là những hợp chất có phân tử khối …(1)… do nhiều đơn vị nhỏ gọi là ….(2)…. liên kết với nhau tạo nên.

  1. (1)trung bình và (2) monome B. (1)rất lớn và (2) mắt xích
  2. (1)rất lớn và (2) monome D. (1)trung bình và (2) mắt xích.

Câu 2. Cho công thức:   [-NH-(CH2)6-CO-]n  .Giá trị n trong công thức này không thể gọi là gì?

  1. Hệ số polime hóa                 B. Độ polime hóa
  2. Hệ số trùng hợp D. Hệ số trùng ngưng.

Câu 3. Trong bốn polime cho dưới đây, polime nào cùng loại polime với tơ Capron?

  1. Tơ tằm                                 B. Tơ nilon- 6,6
  2. Xenlulozơ trinitrat D. Cao su thiên nhiên.

Câu 4. Trong bốn polime cho dưới đây, polime nào cùng loại  polime với cao su Buna?

  1. Poli vinyl clorua                 B. Nhựa phenolofomanđehit
  2. Poli vinyl axetat D. Tơ Capron

Câu 6.    Polime nào dưới đây có cùng cấu trúc mạch Polime với nhựa bakelit ( mạng không gian)?

  1. Amilozơ                 B. Glicogen                          
  2. Cao su lưu hóa D. Xenlulozơ.

Câu 7. Nhận xét về tính chất vật lý chung của Polime nào dưới đây không đúng?

  1. Hầu hết là những chất rắn, không bay hơi.
  2. Đa số nóng chảy ở một khoảng nhiệt độ rộng, hoặc không nóng chảy mà bị phân hủy khi đun nóng.
  3. Đa số không tan trong các dung môi thông thường, một số tan trong dung môi thích hợ tạo dung dịch nhớt.
  4. Hầu hết Polime đều đồng thời có tính dẻo, tính đàn hồi và có thể kéo thành sợi dai, bền.

Câu 8. Trong các phản ứng giữa các cặp chất dưới dây, phản ứng nào làm giảm mạch Polime?

  1. poli (vinyl clorua) + Cl2 B. Cao su thiên nhiên + HCl
  2. Poli(vinyl axetat) + H2O D. Amilozơ + H2O

Câu 9. Trong phản ứng với các chất hoặc cặp chất dưới dây, phản ứng nào giữ nguyên mạch polime

  1. nilon-6,6 + H2O                                                 B. Cao su Buna + HCl
  2. Polistiren D. Rezol 

Câu 10. Khi clo hóa PVC ta thu được một loại tơ clorin chứa 66,18% clo. Hỏi trung bình 1 phân tử clo tác dụng với bao nhiêu mắt xích PVC.

  1. 1 B. 2.                                                        C.3                                                          D. 4

Câu 12. Quá trình điều chế tơ nào dưới đây là quá trình trùng hợp?

  1. Tơ nitron (tơ olon) từ acrilonitrin. B. Tơ capron từ axit w- aminocaproic
  2. Tơ nilon – 6,6 từ hexametilenđiamin và axit ađipic. D. Tơ lapsan từ etilenglicol và axit terphtalic.

Câu 13. Hợp chất nào dưới dây không thể tham gia phả ứng trùng hợp?

  1. Axit w- aminocaproic B. Caprolactam
  2. Metyl metacrylat                 D. Butađien-1,3.

Câu 14. Hợp chất hoặc cặp hợp chất nào dưới đây không thể tham gia phản ứng trùng ngưng?

  1. Phenol và fomanđehit                 B. Butađien-1,3 và stiren.
  2. Axit ađipic và hexametilen điamin D. Axit w- aminocaproic

Câu 15. Loại cao su nào dưới đây là kết quả của phản ứng đồng trùng hợp?

  1. Cao su Buna B. Cao su Buna-S C. Cao su isopren                                                D. Cao su clopren.

Câu 17. Polime nào dưới dây thực tế không sử dụng làm chất dẻo?

  1. Polimtacrylat B. Poliacrilonitrin D.Poliphenol fomanđehit.                  C. Poli(vinyl clorua)

Câu 18. Mô tả ứng dụng của polime nào dưới đây là không đúng?

  1. PE được dùng nhiều làm màng mỏng, vật liệu điện.
  2. PVC được dùng làm vật liệu điện, ống dẫn nước, vải che mưa..
  3. Poli (metyl metacrylat) làm kính máy bay, ô tô, đồ dân dụng, răng giả.
  4. Nhựa novolac dùng để sản xuất đồ dùng, vỏ máy, dụng cụ điện…

Câu 19. Điền từ thích hợ vào chỗ trống trong định nghĩa về vật liệu compozit. “Vật liệu compozit là vật liệu hỗn hợp gồm ít nhất ….(1)…thành phần vật liệu phân tán vào nhau mà……..(2)….

  1. (1) hai; (2) không tan vào nhau B. (1) hai; (2)   tan vào nhau
  2. (1) ba; (2) không tan vào nhau D. (1) ba; (2) tan vào nhau

Câu 20. Theo nguồn gốc, loại tơ nào dưới đây cùng loại với len?

  1. Bông B. Capron                                             C. Visco                                                 D. Xenlulozơ axetat.

Câu 21. Loại tơ nào dưới đây thường dùng để dệt vải may quần áo ấm hoặc bện thành sợi “len” đan áo rét?

  1. Tơ capron B. Tơ nilon -6,6                                    C. Tơ capron                                        D. Tơ nitron.

Câu 22. Phát biểu về cấu tạo của cao su tự nhiên nào dưới dây là không đúng?

  1. Cao su thiên nhiên là polime cảu isopren. B. Các mắt xích của cao su tự nhiên đếuc có cấu hình trans-
  2. Hệ số trùng hợp của cao su tự nhiên vào khoảng từ 1.500- 15.000 D. Các phân tử cao su soắt lại hoặc cuộn tròn vô trật tự.

Câu 23. Tính chất nào dưới đây không phải là tính chất của cao su tự nhiên?

  1. Không tan trong xăng và benzen.B. Không dẫn điện và nhiệt. C. Không thấm khí và nước. A. Tính đàn hồi   

Câu 24. Polime (- CH2– CH(CH3)-CH2-CH(CH3)=CH-CH2-)n được điều chế bằng phản ứng trùng hợp monome nào sau đây?

  1. CH2=CH-CH3 B. CH2=CH(CH3)-CH-CH2
  2. CH2=CH-CH3 và CH2=CH(CH3)- CH2 -CH-CH2 D. CH2=CH-CH3 và  CH2=CH(CH3)- CH-CH2

Câu 25. Khi điều chế cao su Buna, người ta còn thu được một số sản phẩm phụ là polime có nhánh nào sau đây?

  1. (-CH2– CH(CH3)-CH2)n B. (-CH2– C(CH3)-CH)n                 C. (-CH2– CH- )n                   D. (-CH2– CH(CH3))n          

                                                                                                                                 CH=CH2

Câu 28. Tìm câu sai?

  1. Phản ứng trùng ngưng khác với phản ứng trùng hợp.
  2. Trùng hợp 2- metylbutađien-1,3 đựơc cao su Buna
  3. Cao su isopren có thành phần giống cao su thiên nhiên.
  4. Nhựa phenolfomanđehit được điều chế bằng cách đun nóng phenol với fomanđehit lấy dư, xúc tác bằng bazơ.

Câu 29. Chỉ ra điều sai:

  1. Bản chất cấu tọ hóa học của sợi bông là xenlulozơ. B. Bản chất cấu tạo hóa học của tơ nilon là poliamit.
  2. Quần áo nilon, len, tơ tằm không nên giặt với xà phòng có độ kiềm cao. D. Tơ nilon, tơ tằm, lên rất bền vững với nhiệt độ.

Câu 30. PVC được điều chế từ khí thiên nhiên theo sơ đồ.

                CH4  C2H2     CH2=CHCl  PVC   

Câu 31. Tơ nilon- 6,6 là chất nào sau đây?

  1. Hexacloxiclohexan B. Poliamit của axit ađipic và hexametileddiamin
  2. Poliamit của axit e- aminocaproic D. Polieste của axit ađipic và etilien glucol

Câu 32. Polivinylancol là?

  1. Sản phẩm của phản ứng trùng hợp CH2=CH(OH)
  2. Sản phẩm của phản ứng thủy phân poli(vinly axetat) trong môi trường kiềm.
  3. Sản phẩm của phản ứng cộng nước vào axetilen
  4. Sản phẩm của phản ứng giữa axit axetic với axetilen.

Câu 33. Tơ nilon-6,6 là sản phẩm của phản ứng trùng ngưng giữa cặp chất nào sau đây?

  1. HOOC- (CH2)4-COOHvà H2N-(CH2)4– NH2 B. HOOC- (CH2)4-COOHvà H2N-(CH2)6– NH2
  2. HOOC- (CH2)6-COOHvà H2N-(CH2)6– NH2 D. HOOC- (CH2)4– NH2 và H2N-(CH2)6– COOH.

Câu 34. Dùng poli (vinyl axetat) có thể làm được vật liệu nào sau đây?

  1. Chất dẻo B. Tơ                                                      C. Cao su                                              D. Keo dán.

Câu 35. Một loại polietilen có phân tử khối là 50000. Hệ số trùng hợp của loại polietilen đó xấp xỉ con số nào sau đây?

A.920                                                     B.1230                                                   C.1529                                                   D. 1786

Câu 36. Câu nào sau đây là không đúng?

  1. Tinh bột và xenlulozơ đều là polisaccarit (C6H10O6)n nhưng xenlulozơ có thể kéo sợi, còn tinh bột thì không.
  2. Len, tơ tằm, tơ nilon kém bền với nhiệt, nhưng không bị thuỷ phân bởi môi trường axit hoặc kiềm.
  3. Phân biệt tơ nhân tạo và tơ tự nhiên bằng cách đốt, tơ tự nhiên cho mùi khét
  4. Đa số các polime đều không bay hơi do khối lượng phân tử lớn và lực liên kết phân tử lớn.

Câu 37. Poli (vinyl clorua) (PVC) được điều chế theo sơ đồ.

X ® Y ® Z ® PVC

X là chất nào trong các chất sau?

  1. etan                                 B. butan                                                                C.metan                                                                D. propan

Câu 38. Câu nào không đúng trong các câu sau?

  1. Polime là hợp chất có khối lượng phân tử rất cao và kích thước phân tử rất lớn
  2. Polime là hợp chất mà phân tử gồm nhiều mắt xích liên kết với nhau
  3. Protit không thuộc loại hợp chất Polime
  4. Các Polime đều khó bị hoà tan trong các chất hữu cơ.

Câu 39. Cho các Polime: PE, PVC, polibutađien, poliisopren, amilozơ, amilopectin, xenlulozơ, cao su lưu hoá. Các Polime có cấu trúc mạch thửng là các chất ở dãy nào sau đây?

  1. PE, polibutađien, poliisopren, amilozơ, xenlulozơ, cao su lưu hoá
  2. PE, PVC, polibutađien, poliisopren, xenlulozơ, cao su hoá
  3. PE, PVC, polibutađien, poliisopren, amilozơ, xenlulozơ
  4. PE, PVC, polibutađien, poliisopren, amilozơ, amilopectin, xenlulozơ

Câu 40. Chất nào sau đây có thể trùng hợp thành cao su?

  1. CH2 = C(CH3)- CH = CH2 B. CH3 – CH = C = CH2 C. CH3 – CH = C = CH2                                  D. CH3-CH2-C º CH

Câu 41. Cho các polime, polietilen, xenlulozơ, amilo, amilopectin, poli (vnyl clorua), tơ nilon-6,6; poli (vinyl axetat). Những phân tử có cấu tạo mạch phân nhánh thuộc dãy chất nào sau đây ?

  1. xenlulozơ, amilopectin, poli (vinyl clorua), poli (vinyl axetat) B. amilopectin, PVC, tơ nilon – 6,6; poli (vinyl axetat)
  2. amilopectin, poli (vinyl clorua), poli (vinyl axetat) D. amilopectin, xenlulozơ

Câu  42. Polime thiên nhiên nào sau đây có thể là sản phẩm trùng ngưng: tinh bột (C6H10O5)n; cao su isopren (C5H8)n; tơ tằm (-NH-R-CO)n?

  1. tinh bột (C6H10O5) B. cao su isopren (C5H8)n
  2. tinh bột (C6H10O5); cao su isopren (C5H8)n D. tinh bột  (C6H10O5); tơ tằm (-NH-R-CO-)n

Câu 43. Những chất và vật liệu nào sau đây là chất dẻo: Polietilen; đất sét ướt; plistiren; nhôm; bakelit (nhựa đui đèn); cao su?

  1. Polietilen; đất sét ướt B. Polietilen; đất sét ướt; cao su?
  2. Polietilen; đất sét ướt; plistiren D. Polietilen; plistiren; bakelit (nhựa đui đèn)

Câu 44. Để tổng hợp 120kg poli (metyl metacrylat) với hiệu suất của quá trình hoá este là 60% và quá trình trùng hợp là 80% thì cần các lượng axit và rượu là bao nhiêu?

  1. 170 kg axit và 80 kg rượu B. 85 kg axit và 40 kg rượu
  2. 172 kg axit và 84 kg rượu D. 86 kg axit và 42 kg rượu

Câu 45. Trong các cặp chất sau, cặp chất nào tham gia phản ứng trùng ngưng?

  1. CH2 = CH-Cl và CH2 = CH-OCO – CH3 B. CH2 = CH – CH = CH2 và C6H5-CH=CH2
  2. CH2 = CH-CH=CH2 và CH2 = CH-CN D. H2N-CH2– NH2 và HOOC-CH2-COOH

Câu 46. Da nhân tạo (PVC) được điều chế từ khí thiên nhiên (CH4). Nếu hiệu suất của toàn bộ quá trình là 20% thì để điều chế PVC phải cần một thể tích metan là:

  1. 3500m3 B. 3560m3 C. 3584m3                                             D. 5500m3

Câu 47. Hãy cho biết có tối đa bao nhiêu loại polime được tạo thành từ các rượu bậc II có mạch cacbon phân nhánh cùng công thức C6H14O?

  1. 6 B.7 C. 8                                                         D. 9

Câu 48. Cho sơ đồ: (X)  polime.  Chất (X) thoả mãn sơ đồ là chất nào sau đây?

A.CH3CH2-C6H4-OH                           B. C6H5-CH(OH)-CH3                                     C. CH3-C6H4-CH2OH                          D.C6H5-O-CH2CH3

Câu 49. Từ các aminoaxit có công thức phân tử C3H7O2N có thể tạo thành bao nhiêu loại polime khác nhau (phản ứng trực tiếp)?

  1. 3 loại B. 4 loại C.7 loại                                                  D. 6 loại

Câu 50. Trong số các polime sau đây: tơ tằm, sợ bông, len, tơ enan, tơ visco, nilon-6,6, tơ axetat. Loịa tơ có nguồn gốc xenlulozơ là loại nào?

  1. tơ tằm, sợi bông, nilon-6,6 B. sợi bông, len, tơ axetat
  2. sợi bông, len, nilon-6,6 D. tơ visco, nilon-6,6, tơ axetat

Câu 51. Phản ứng trùng hợp là phản ứng:

  1. cộng hợp liên tiếp nhiều phân tử nhỏ (monome) giống nhau thành nhiều phân tử lớn (polime)
  2. Cộng hợp liên tiếp nhiều phân tử nhỏ (nomome) giống nhau thành một phân tử lớn (polime) và giải phóng phân tử nhỏ (thường là nước).
  3. Cộng hợp liên tiếp nhiều phân tử nhỏ (monome) thành một phân tử lớn (polime) và giải phóng phân tử nhỏ (thường là nước)
  4. Cộng hợp liên hợp nhiều phân tử nhỏ (nomome) giống nhau thành một phân tử lớn (polime).

Hãy chọn đáp án đúng

Câu 52. Chất nào sau đây tạo phản ứng trùng ngưng?

  1. rượu etylic và hexametilenđiamin B. axit aminoenantoic
  2. axit stearic và etilenglicol D. axit eloric và glixerin

Câu 53. Qua nghiên cứu thực nghiệm, cho thấy cao su thiên nhiên là polime của momome nào?

  1. Butađien -1,4 B. Butađien-1,3 C. Butađien-1,2                                   D. 2-Metybutađien-1,3

Câu 54. Bản chất của sự lưu hoá cao su là:

  1. Tạo cầu nối đinunfua giúp cao su có cấu tạo mạng không gian B. Tạo loại cao su nhẹ hơn
  2. Giảm giá thành cao su D. Làm cao su dễ ăn khuôn

Hãy chọn đáp án đúng

Câu 55. X ® Y ® cao su Buna. X là chất nào sau đây?

  1. CHºC-CH­2-CH=O B. CH2=CH-CH2-CH=O C. CH2=CH-CH=O                              D. CH3-CH2-OH

Câu 56. Sản phẩm trùng hợp của butađien -1,3 với CN-CH=CH2 có tên gọi thông thường là gì?

  1. Cao su Buna B. Cao su Buna – S C. Cao su Buna- N                              D. Cao su

Câu 57. Chỉ rõ monome của sản phẩm trùng hợp có tên gọi là polipropilen (PP) trong các chất sau:

D(-CH2-CH2-)n                                                         B. (-CH2-CH(CH3)-)n                                        C. CH2 = CH2                                       D. CH2 = CH-CH3

Câu 58. Tơ sợi axetat được sản xuất từ chất nào?

  1. Viscô B. Sợi amiacat đồng C. Axeton                              D. Este của xenlulozơ và axitaxetic

Câu 59. Dựa vào nguồn gốc, sợ tự nhiên được chia thành những loại gì?

  1. Sợi bông, sợi len, sợi lanh… B. Sợi động vật, sợi thực vật
  2. Sợi ngắn, sợi dài. D. Sợi có nguồn gốc: Khoáng vật, thực vật và động vật

Câu 60. Sự kết hợp các phân tử nhỏ (monome) thành phân tử lớn (polime) đồng thời có loại ra các phân tử nhỏ (như nước, amoniac, hiđro clorua…) được gọi là gì?

  1. Sự peptit hoá B. Sự tổng hợp C. Sự polime hoá                                 D. Sự trùng ngưng

 

CHƯƠNG VII:

ĐẠI CƯƠNG VỀ KIM LOẠI

 

Câu 1. Biết thể tích 1 mol của mỗi kim loại Al, Li, K tương ứng là 10cm3; 13,2cm3; 45,35cm3, có thể tính được khối lượng riêng của mỗi kim loại trên lần lượt là bao nhiêu?

  1. 2,7(g/cm3); 1,54(g/cm3); 0,86(g/cm3) B. 2,7(g/cm3); 0,86(g/cm3); 0,53(g/cm3)
  2. 0,53(g/cm3); 0,86(g/cm3); 2,7(g/cm3) D. 2,7(g/cm3); 0,53(g/cm3); 0,86(g/cm3)

Câu 2. Câu nào sau đây không đúng?

  1. Số electron ở lớp ngoài cùng của nguyên tử kim loại thường có ít (1 đến 3e)
  2. Số electron ở lớp ngoài cùng của nguyên tử phi kim thường có từ 4 đến 7
  3. Trong cùng chu kỳ, nguyên tử kim loại có bán kính nhỏ hơn nguyên tử phi kim
  4. Trong cùng nhóm, số electron ngoài cùng của các nguyên tử thường bằng nhau

Câu 3. Câu nào sau đây đúng?

  1. Số electron ở lớp ngoài cùng của nguyên tử kim loại thường có từ 4 đến 7
  2. Số electron ở lớp ngoài cùng của nguyên tử phi kim thường có từ 1 đến 3
  3. Trong cùng chu kỳ, nguyên tử kim loại có bán kính lớn hơn nguyên tử phi kim
  4. Trong cùng nhóm, số electron ngoài cùng của các nguyên tử thường khác nhau.

Câu 4. Kim loại nhẹ có nhiều ứng dụng trong kỹ thuật và đời sống là kim loại nào?

  1. Mg B. Al                                                       C. Fe                                                       D. Cu

Câu 5. Cho các cấu hình electron nguyên tử sau:

  1. 1s22s22p63s1 B. 1s22s22p63s23p64s2 C. 1s22s1                                                                                                 D. 1s22s22p63s23p1

Các cấu hình đó lần lượt là của những nguyên tố nào?

  1. Ca, Na, Li, Al B. Na, Ca, Li, Al                                   C. Na, Li, Al, Ca                                   D. Li, Na, Al, Ca

Câu 6. Ngâm một lá kẽm trong 100ml dung dịch AgNO3 nồng độ 0,1M. Khi phản ứng kết thúc, thu được bao nhiêu gam Ag?

  1. 2,16Ag B. 0,54gAg                                            C. 1,62gAg                                            D. 1,08gAg

Câu 7. Ngâm một lá kẽm trong 100ml dung dịch AgNO3 nồng độ 0,1M. Khi phản ứng kết thúc, khối lượng lá kẽm tăng thêm bao nhiêu gam?

  1. 0,65g B. 1,51g C. 0,755g                                               D. 1,30g

Câu 8. Ngâm một đinh sắt trong 200ml dung dịch CuSO4. Sau khi phản ứng kết thúc, lấy đinh sắt ra khỏi dung dịch, rửa nhẹ, làm khô thấy khối lượng đinh sắt tăng thêm 1,6 gam. Nồng độ ban đầu của dung dịch CuSO4, là bao nhiêu mol/lit?

  1. 1M B.0,5M C.2M                                                      D.1,5M

Câu 9. Ngâm một vật bằng đồng có khối lượng 10gam trong 250 gam dung dịch AgNO3 4%. Khi lấy vật ra khỏi dung dịch thì khối lượng AgNO3 trong dung dịch giảm 17%. Khối lượng của vật sau phản ứng là bao nhiêu gam?

  1. 27,00g B. 10,76g C.11,08g                                                D. 17,00g

Câu 12. Cho 4 cặp oxi hoá – khử: Fe2+/Fe; Fe3+/Fe2+; Ag+/Ag;Cu2+/Cu. Dãy xếp các cặp theo chiều tăng dần về tính oxi hoá và giảm dần về tính khử là dãy chất nào?

  1. Fe2+/Fe; ;Cu2+/Cu; Fe3+/Fe2+; Ag+/Ag B. Fe3+/Fe2+; Fe2+/Fe; Ag+/Ag; Cu2+/Cu
  2. Ag+/Ag; Fe3+/Fe2+; Cu2+/Cu; Fe2+/Fe D. Cu2+/Cu; Fe2+/Fe; Fe3+/Fe2+; Ag+/Ag

Câu 13. Cho dung dịch Fe2(SO4)3 tác dụng với kim loại Cu được FeSO4 và CuSO4. Cho dung dịch CuSO4 tác dụng với kim loại Fe được FeSO4 và Cu. Qua các phản ứng xảy ra ta thấy tính oxi hoá của các ion kim loại giảm dần theo dãy nào sau đây?

  1. Cu2+; Fe3+; Fe2+ B. Fe3+; Cu2+; Fe2+ C. Cu2+; Fe2+; Fe3+                                               D. Fe2+; Cu2+; Fe3+

Câu 14. Dung dịch FeSO4 có lẫn tạp chất CuSO4. Phương pháp hoá học đơn giản để loại được tạp chất là phương pháp nào?

  1. Điện phân dung dịch với điện cực trưo đến khi hết màu xanh
  2. Chuyển 2 muối thành hiđrôxit, oxit kim loại rồi hoà tan bằng H2SO4 loãng
  3. Thả Mg vào dung dịch cho đến khi hết màu xanh
  4. Thả Fe dư vào dung dịch, chờ phản ứng xong rồi lọc bỏ chất rắn

Câu 15. Để làm sạch một loại thủy ngân có lẫn các tạp chất kẽm, thiếc, chì có thể dùng cách nào sau đây?

  1. Hoà tan loại thuỷ ngân này trong dung dịch HCl dư
  2. Hoà tan loại thuỷ ngân này trong axit HNO3 loãng, dư, rồi điện phân dung dịch.
  3. Khuấy loại thuỷ ngân này trong dung dịch HgSO4 loãng, dư rồi lọc dung dịch
  4. Đốt nóng loại thuỷ ngân này là hòa tan sản phẩm bằng axit HCl

Câu 16. Ngâm một lá Pb trong dung dịch AgNO3 sau một thời gian lượng dung dịch thay đổi 0,8g. Khi đó khối lượng lá Pb thay đổi như thế nào?

  1. Không thay đổi B. Giảm 0,8gam C. Tăng 0,8gam                                   D.Giảm 0,99gam

Câu 17. Ngâm một lá kẽm trong dung dịch muối sunfat có chứa 4,48 gam ion kim loại điện tích 2+. Sau phản ứng, khối lượng lá kẽm tăng thêm 1,88g. Công thức hoá học của muối sunfat là:

  1. CuSO4 B. FeSO4 C. NiSO4                                                                         D. CdSO4

Câu 18. Ngâm một lá kẽm trong dung dịch có hoà tan 4,16g CdSO4. Phản ứng xong, khối lượng lá kẽm tăng 2,35%. Khối lượng lá kẽm trước khi phản ứng là bao nhiêu gam?

  1. 60gam B. 40gam C.80gam                                               D. 100gam

Câu 19. Có các kim loại Cs, Fe, Cr, W, Al. Độ cứng của chúng ta giảm dần theo thứ tự ở dãy nào sau đây?

  1. Cs, Fe, Cr, W, Al B. W, Fe,Cr, Cs, Al                               C. Cr, W, Fe, Al, Cs                              D. Fe, W, Cr, Al, Cs

Câu 20. Có các kim loại Os, Li, Mg, Fe, Ag. Tỉ khối của chúng tăng dần theo thứ tự ở dãy nào sau đây?

  1. Os, Li, Mg, Fe, Ag B. Li, Fe, Mg, Os, Ag C. Li, Mg, Fe, Os, Ag                           D. Li, Mg, Fe, Ag, Os

Câu 21. Có các kim loại Cu, Ag, Fe, Al, Au. Độ dẫn điện của chúng giảm dần theo thứ tự ở dãy nào sau đây?

  1. Ag, Cu, Au, Al, Fe B. Ag, Cu, Fe, Al, Au C. Au, Ag, Cu, Fe, Al                           D. Al, Fe, Cu, Ag, Au

Câu 22. Có các kim loại Cu, Ag, Fe, Al, Zn. Độ dẫn nhiệt của chúng giảm dần theo thứ tự ở dãy nào sau đây?

  1. Cu, Ag, Fe, Al, Zn B. Ag, Cu, Al, Zn, Fe C. Al, Fe, Zn, Cu, Ag                           D. Al, Zn, Fe, Cu, Ag

Câu 23. Trong những câu sau, câu nào không đúng ?

  1. Trong hợp kim có liên kết kim loại hoặc liên kết cộng hoá trị
  2. Tính chất của hợp kim phụ thuộc vào thành phần, cấu tạo của hợp kim
  3. Hợp kim có tính chất hoá học khác tính chất của các kim loại tạo ra chúng
  4. Hợp kim có tính chất vật lý và tính cơ học khác nhiều so với các kim loại tạo ra chúng.

Câu 24. Trong những câu sau, câu nào đúng?

  1. Trong hợp kim có liên kết kim loại hoặc liên kết ion
  2. Tính chất của hợp kim không phụ thuộc vào thành phần, cấu tạo của hợp kim
  3. Hợp kim có tính chất hoá học tương tự tính chất của các kim loại tạo ra chúng
  4. Hợp kim có tính chất vật lý và tính cơ học khác nhiều so với các kim loại tạo ra chúng.

Câu 25. Trong những câu sau, câu nào đúng?

  1. Tính dẫn điện, dẫn nhiệt của hợp kim tốt hơn các kim loại tạo ra chúng
  2. Khi tạo thành liên kết cộng hoá trị, mật độ electron tự do trong hợp kim giảm
  3. Hợp kim thường có độ cứng kém các kim loại tạo ra chúng
  4. Nhiệt độ nóng chảy của hợp kim thường cao hơn so với các kim loại tạo ra chúng

Câu 26. Trong những câu sau, câu nào không đúng ?

  1. Tính dẫn điện, dẫn nhiệt của hợp kim tốt hơn các kim loại tạo ra chúng
  2. Khi tạo thành liên kết cộng hoá trị, mật độ electron tự do trong hợp kim giảm
  3. Hợp kim thường có độ cứng và dòn hơn các kim loại tạo ra chúng
  4. Nhiệt độ nóng chảy của hợp kim thường thấp hơn so với các kim loại tạo ra chúng.

Câu 27. Trong những câu sau, câu nào không đúng?

  1. Hợp kim Fe – Mn được tạo bởi liên kết kim loại B. Hợp kim Sn – Pb được tạo bởi liên kết kim loại
  2. Hợp kim Au – Zn được tạo bởi liên kết kim loại D. Hợp kim Fe3C được tạo bởi liên kết cộng hoá trị

Câu 28. Hoà tan 6 gam hợp kim Cu – Ag trong dung dịch HNO3 tạo ra được 14,68 gam hỗn hợp muối Cu (NO3)2 và AgNO3. Thành phần % khối lượng của hợp kim là bao nhiêu?

  1. 50% Cu và 50% Ag B. 64% Cu và 36% Ag C. 36% Cu và 64% Ag                       D. 60% Cu và 40%Ag

Câu 29. Một loại đồng thau chứa 60% Cu và 40%Zn. Hợp kim này có cấu tạo tinh thể hợp chất hoá học. Công thức hoá học của hợp kim là công thức nào sau đây?

  1. CuZn2 B. Cu2Zn C. Cu2Zn3                                                                     D. Cu3Zn2

Câu 30. Một hợp kim tạo bởi Cu, Al có cấu tạo tinh thể hợp chất hoá học và có chứa 12,3% khối lượng nhôm. Công thức hoá học của hợp kim là:

  1. Cu3Al B. CuAl3 C. Cu2Al3                                                                       D. Cu3Al2

Câu 31. Trong hợp kim Al – Ni cứ 5mol Al thì có 0,5mol Ni. Thành phần % của hợp kim là bao nhiêu?

  1. 18% Al và 82% Ni B. 82% Al và 18% Ni C. 20% Al và 80% Ni                          D. 80% Al và 20% Ni

Câu 32. Hợp kim Fe – Zn có cấu tạo tinh thể dung dịch rắn. Hoà tan 1,165gam hợp kim này bằng dung dịch axit HCl dư thoát ra 448ml khí hđrô (đktc). Thành phần % của hợp kim là.

  1. 72,0%Fe và 28,0% Zn B. 73,0%Fe và 27,0% Zn C. 72,1%Fe và 27,9% Zn                   D.27,0%Fe và73,0% Zn

Câu 33. Cho các câu phát biểu về vị trí và cấu tạo của từng kim loại sau:

I/ Hầu hết các kim loại chỉ có từ 1e đến 3e lớp ngoài cùng         

II/ Tất cả các nguyên tố nhóm B (phân nhóm phụ) đều là kim loại

III/ Ở trạng thái rắn, đơn chất kim loại có cấu tạo tinh thể         

IV/ Liên kết kim loại là liên kết được hình thành do sức hút tương hỗ tĩnh điện giữa các ion dương kim loại và lớp electron tự do.

Những phát biểu nào đúng?

  1. Chủ có I đúng B. Chỉ có I, II đúng C. Chỉ có IV sai                   D. Cả I, II, III, IV đều đúng

Câu 34. Kim loại có những tính chất vật lý chung nào sau đây?

  1. Tính dẻo, tính dẫn nhiệt, nhiệt độ nóng chảy cao B. Tính dẻo, tính dẫn điện và nhiệt, có ánh kim
  2. Tính dẫn điện và nhiệt, có khối lượng riêng lớn, có ánh kim D. Tính dẻo, có ánh kim, rất cứng.

Câu 35. Dãy kim loại nào sau đây đã được xếp theo chiều tăng dần của tính khử?

  1. Al, Mg, Ca, K B. K, Ca, Mg, Al C. Al, Mg, K, Ca                                   D. Ca, K, Mg, Al

Câu 36. Để điều chế các kim loại Na, Mg, Ca trong công nghiệp, người ta dùng cách nào trong các cách sau?

  1. Điện phân dung dịch muối clorua bão hoà tương ứng có vách ngăn
  2. Dùng H2 hoặc CO khử oxit kim loại tương ứng ở nhiệt độ cao
  3. Dùng kim loại K cho tác dụng với dung dịch muối clorua tương ứng
  4. Điện phân nóng chảy muối clorua khan tương ứng

Câu 37. Kết luận nào sau đây không đúng về tính chất của hợp kim?

  1. Liên kết trong đa số tinh thể hợp kim vẫn là liên kết kim loại
  2. Hợp kim thường dẫn nhiệt và dẫn điện tốt hơn kim loại nguyên chất
  3. Độ cứng của hợp kim thường lớn hơn độ cứng của kim loại nguyên chất
  4. Nhiệt độ nóng chảy của hợp kim thường lớn hơn độ cứng của kim loại nguyên chất.

Câu 38. Kết luận nào sau đây không đúng?

  1. Các thiết bị máy móc bằng kim loại tiếp xúc với hơi nước ở nhiệt độ cao có khả năng bị ăn mòn hoá học
  2. Nối thanh Zn với vỏ tàu thuỷ bằng thép thì vỏ tàu thủy sẽ được bảo vệ
  3. Để đồ vật bằng thép ra ngoài không khí ẩm thì đồ vật đó sẽ bị ăn mòn điện hoá
  4. Một miếng vỏ đồ hộp làm bằng sắt tây (sắt tráng thiếc) bị xây xát tận bên trong, để trong không khí ẩm thì Sn sẽ bị ăn mòn trước.

Câu 39. Ngâm lá kẽm trong dung dịch chứa 0,1mol CuSO4. Phản ứng xong thấy khối lượng lá kẽm thay đổi như thế nào?

  1. tăng 0,1g B. tăng 0,01g C. giảm 0,1 g                                        D. không thay đổi

Câu 40. Có những pin điện hoá được ghép bởi các cặp oxi hoá – khử chuẩn sau:

  1. a) Ni2+/Ni và Zn2+/Zn b) Cu2+/Cu và Hg2+/Hg c) Mg2+/Pb2+/Pb

Điện cực dương của các pin điện hoá là:

  1. Pb, Zn, Hg B. Ni, Hg, Pb C. Ni, Cu, Mg                                        D. Mg, Zn, Hg

Hãy chọn đáp án đúng

Câu 41. Câu nào đúng trong các câu sau? Trong ăn mòn điện hoá, xảy ra

  1. sự oxy hoá ở cực dương B. sự khử ở cực âm
  2. sự oxi hoá ở cực dương và sự khử ở cực âm D. sự oxi hoá ở cực âm và sự khử ở cực dương

Câu 42. Điện phân dung dịch CuCl2 bằng điện cực trơ trong một giờ với cường độ dòng điện 5 ampe. Khối lượng đồng giải phóng ở catôt là bao nhiêu gam?

  1. 5,9g B. 5,5g C. 7,5g                                                   D: 7,9g

Câu 43. Tìm câu sai

  1. Trong hai cặp oxi hoá – khử sau: Al3+/Al và Cu2+/Cu, Al3+ không oxi hoá được Cu
  2. Để điều chế Na, người ta điện phân dung dịch NaCl bão hoà trong nước
  3. Hầu hết các kim loại khử được N+5 và sắt S+6 trong axit HNO3, H2SO4 xuống số oxi hoá thấp hơn

Câu 44. Câu nào sau đây đúng?

  1. Miếng hợp kim Zn-Cu để trong không khí ẩm bị phá huỷ là do ăn mòn hoá học
  2. Trong hai cặp oxi hoá – khử sau: Al3+/Al và Cu2+/Cu, Al3+ không oxi hoá được Cu
  3. Để điều chế Na người ta điện phân NaCl nóng chảy
  4. Hầu hết các kim loại không oxi hoá được N+5 và S+6 trong axit HNO3, H2SO4 xuống số oxi hoá thấp hơn.

Câu 45. Câu nào sau đây đúng:

Cho bột sắt vào dung dịch HCl sau đó thêm tiếp vài giọt dung dịch CuSO4. Quan sát thấy hiện tượng nào sau đây?

  1. Bọt khí bay lên ít và chậm dần B. Bọt khí bay lên nhanh và nhiều dần lên
  2. Không có bọt khí bay lên D. Dung dịch không chuyển màu

Câu 46. Có các kim loại Mg, Ni, Sn, Cu. Kim loại nào có thể dùng để bảo vệ điện hoá vỏ tàu biển làm bằng thép?

  1. Ni B. Mg C. Sn                                                      D. Cu

Câu 47. Đồng kim loại thay thế ion bạc trong dung dịch, kết quả có sự tạo thành bạc kim loại và ion đồng. Điều này chỉ ra rằng:

  1. Phản ứng trao đổi đã xảy ra B. Bạc ít tan hơn đồng
  2. Cặp oxi hóa – khử Ag+/Ag có thế điện cực chuẩn cao hơn cặp Cu2+/Cu D. Kim loại đồng dễ bị đứt

Câu 48. Cho dòng điện 3A đi qua một dung dịch đồng (II) ntơrat trong 1 giờ thì lượng đồng kết tủa trên catot là bao nhiêu gam?

  1. 18,2gam B. 3,56gam C. 31,8gam                                           D. 7,12g

Câu 49. Ngâm một lá Fe trong dung dịch CuSO4. Sau một thời gian phản ứng, lấy lá Fe ra rửa nhẹ, làm khô, đem cân thấy khối lượng tăng thêm 1,6g. Khối lượng Cu bám trên lá Fe là bao nhiêu gam?

  1. 12,8g B. 8,2g C.   6,4g                                                 D. 9,6g

Câu 50. Một cation kim loại M có cấu hình electron ở phân lớp ngoài cùng là : 2s22p6. Vậy cấu hình electron phân lớp ngaòi cùng của nguyên tử kim loại M không thể là cấu hình nào?

  1. 3s1 B.3s23p1                                                 C. 3s23p3                                                                        D. 3s2

Câu 51. Trong các trường hợp sau, trường hợp nào kim loại bị ăn mòn điện hoá?

  1. Cho kim loại Zn vào dung dịch HCl B. Thép cacbon để trong không khí ẩm
  2. Đốt dây Fe trong khí O2 D. Cho kim loại cu vào dung dịch HNO3 loãng

Câu 52. Một sợi dây Cu nối với một sợi dây Fe để ngoài không khí ẩm, sau một thời gian có hiện tượng gì?

  1. Dây Fe và dây Cu bị đứt B. Ở chỗ nối dây Fe bị mủn và đứt
  2. Ở chỗ nối dây Cu bị mủn và đứt D. Không có hiện tượng gì

Câu 53. Cho các ion: Ca2+, K+, Pb2+, Br, SO2-4, NO3. Trong dung dịch, dãy những ion nào không bị điện phân?

  1. Pb2+, Ca2+, Br, NO3 B. Ca2+, K+, SO2-4, NO3 C. Ca2+, K+, SO2-4, Br–                                       D. Ca2+, K+, SO2-4, Pb2+

Câu 54. Kim loại M được tác dụng với các dung dịch HCl, Cu (NO3)2, HNO3 đặc nguội, M là kim loại nào?

  1. Al B. Ag C. Zn                                                      D. Fe

Câu 55. Cho các cặp oxi hoá – khử sau: Zn2+/Zn, Cu2+/Cu, Fe2+/Fe. Biết tính oxi hoá của các ion tưng dần theo thứ tự: Zn2+, Fe2+, Cu2+ tính khử giảm dần theo thứ tự Zn, Fe, Cu. Trong các phản ứng hoá học sau, phản ứng nào không xảy ra?

  1. Cu+FeCl2 B. Fe+CuCl2 C. Zn+CuCl2                                                              D. Zn+FeCl2

Câu 56. Để tách riêng từng kim loại ra khỏi dung dịch chứa đồng thời muối AgNO3 và Pb(NO3)2, người ta dùng lần lượt các kim loại nào?

  1. Cu, Fe B. Bb, Fe                                               C. Ag, Pb                                               D. Zn, Cu

Câu 57. Cho 10,4g hỗn hợp bột gồm Mg, Fe tác dụng vừa đủ với 400ml dung dịch HCl. Kết thúc phản ứng thu được 6,72 lít khí (đktc). Thành phần % về khối lượng của Mg, Fe và nồng độ mol/l của dung dịch HCl ban đầu lần lượt là ở đáp án nào?

  1. 46,15%; 53,85%; 1,5M
  2. 11,39%; 88,61%; 1,5M
  3. 53,85%; 46,15%; 1M
  4. 46,15%; 53,85%; 1M

Câu 58. Cho các dung dịch: (a) HCl, b) KNO3, c) HCl+KNO3, d) Fe2(SO4)3. Bột Cu bị hoà tan tỏng các dung dịch nào?

  1. c) d) B. a) b)
  2. a) c) D. b) d)

Bai 59. Cho các phương trình điện phân sau, phương trình nào viết sai?

  1. 4AgNO3 + 2H2O4Ag+O2+4HNO3
  2. 2CuSO4 + 2H2O2Cu+O2+2H2NO3
  3. 2MCln 2M+nCl2
  4. 4MOHn 4M+2H2O

Câu 60. Những nhóm nào dưới đây ngoài nguyên tố kim loại còn có nguyên tố phi kim?

  1. IA (trừ hiđro) và IIA B. IIIA đến VIIIA
  2. IB đến VIIIB D. Họ lântn và họ actini

Câu 61. Cấu hình của nguyên tử hay ion nào dưới đây được biểu diễn không đúng?

  1. Cr (Z= 24) : [Ar] 3d54s1
  2. Mn2+ (Z= 25) ; [Ar]3d34s2
  3. Fe3+ (Z = 26): [Ar]3d5
  4. Cu (Z = 29) : [Ar]3d104s1

Câu 62. Tính chất vật lý nào dưới đây của kim loại không phải do các electron tự do gây ra?

  1. Ánh kim B. Tính dẻo
  2. Tính cứng D. Tính dẫn điện và nhiệt

Câu 63. Dãy so sánh tính chất vật lí của kim loại nào dưới đây là không đúng?

  1. Khả năng dẫn điện và nhiệt: Ag > Cu > Al > Fe
  2. Tỷ khối: Li < Fe < Os
  3. Nhiệt độ nóng chảy: Hg < Al < W
  4. Tính cứng. Cs < Fe < Al ~ Cu < Cr

Câu 64. Tính chất đặc trưng của kim loại là tính khử vị:

  1. Nguyên tử kim loại thường có 5,6,7 electron lớp ngoài cùng
  2. Nguyên tử kim loại có nưng lượng ion hoá nhỏ
  3. Kim loại có xu hướng nhận thêm electron để đạt đến cấu trúc bền
  4. Nguyên tử kim loịa có độ âm điện lớn.

Hãy chọn đáp án đúng.

Câu 65. Cho . Xác định xuất điện động chuẩn của pin điện hoá Zn-Pb

  1. +6,3V B. – 0,63V
  2. – 0,89V D. 0,89V

Câu 66. Phản ứng nào dưới đây xảy ra theo chiều thuận? Biết giá trị thế điện cực chuẩn như sau:

E0 -2,37 -0,76   -0,13    +0,34

  1. Zn+Mg2+ ® Zn2+ + Mg
  2. Zn+Pb2+ ® Zn2++Pb
  3. Cu + Pb2+ ® Cu2++Pb
  4. Cu + Mg2+ ® Cu2++ Mg

Câu 67. Phản ứng nào dưới đây không xảy ra? Biết giá trị thế điện cực chuẩn như sau”

  1. Mg (dư) + 2 Fe3+ ® Mg2+ + 2 Fe2+
  2. Fe + 3Ag+ (dư) ® Fe3+ + 3Ag
  3. Fe + 2 Fe3+ ® 3 Fe2+
  4. Cu + 2 Fe3+ ® Cu2+ + 2 Fe2+

Câu 68. Kim loại nào dưới đây không phản ứng với nước ở điều kiện thường?

  1. Na B. Ba
  2. Ca D. Al

Câu 69. Kim loại nào dưới đây có thể tan trong dung dịch HCl?

  1. Sn B.Cu
  2. Ag D. Hg

Câu 70. Kim loại nào sau đây có thể đẩy sắt ra hỏi dung dịch muối Fe (NO3)2?

  1. Ni B. Sn
  2. Zn D. Cu

Câu 71. Mô tả nào dưới đây không phù hợp với thí nghiệm nhúng thanh Fe vào dung dịch CuSO4 một thời gian?

  1. Bề mặt thanh kim loại có màu đỏ
  2. Dung dịch bị nhạt màu
  3. Dung dịch có màu vàng nâu
  4. Khối lượng thanh kim loại tăng

Câu 72. Mô tả phù hợp với thí nghiệm nhhúng thanh Cu (dư) vào dung dịch FeCl3 là:

  1. Bề mặt thanh kim loại có màu trắng
  2. Dung dịch bị từ vàng nâu qua xanh
  3. Dung dịch có màu vàng nâu
  4. Khối lượng thanh kim loại tăng

Câu 73. Phản ứng điện phân nóng chảy nào dưới đây bị viết sai sản phẩm?

  1. Al2O3 2Al+3/2O2
  2. 2NaOH 2Na+O2+ H2
  3. 2NaCl 2Na+Cl2
  4. Ca3N2 3Ca + N2

Câu 74. Điện phân đến hết 0,1 mol Cu (NO3)2 trong dung dịch với điện tực trơ, thì sau điện phân khối lượng dung dịch đã giảm bao nhiêu gam?

  1. 1,6g B. 6,4g
  2. 8,0 gam D. 18,8g

Câu 75. Tính thể tích khí (đktc) thu được khi điện phân hết 0,1 mol NaCl trong dung dịch với điện cực trơ, màng ngăn xốp.

  1. 0,024 lit B. 1,120 lit
  2. 2,240 lit D. 4,489 lit

Câu 76. Ứng dụng nào dưới đây không phải là ứng dụng của sự điện phân ?

  1. Điều chế một số kim loại, phi kim và hợp chất
  2. Thông qua các phản ứng để sản sinh ra dòng điện
  3. Tinh chế một số kim loại như Cu, Pb, Zn, Fe, Ag, Au…
  4. Mạ Zn, sn, Ni, Ag, Au… bảo vệ và trang trí kim loại

Câu 77. Điện phân (điện cực trơ) dung dịch chứa 0,02mol NiSO4 với cường độ dòng điện 5A trong 6 phút 26 giây. Khối lượng catot tăng lên bao nhiêu gam?

  1. 0,00gam B. 0,16gam
  2. 0,59gam D. 1,18gam

Câu 78. Phản ứng điều chế kim loại nào dưới đây không thuộc phương pháp nhiệt luyện?

  1. 3CO + Fe2O3 ® 2Fe + 3CO2
  2. 2Al + Cr2O3 ® 2Cr + Al2O3
  3. HgS + O2 ® Hg + SO2
  4. Zn + CuSO4 ® ZnSO4 + Cu

Câu 79. Phản ứng điều chết kim loại nào dưới đây thuộc phương pháp nhiệt luyện?

  1. C + ZnO ® Zn + CO
  2. Al2O3 ® 2Al + 3/2O2
  3. MgCl2 ® Mg + Cl2
  4. Zn + 2Ag (CN)2 ® Zn (CN)42- + 2 Ag

Câu 80. Có những vật bằng sắt được mạ bằng những kim loại khác nhau dưới đây. Nếu các vật này đều bị sây sát sâu đến lớp sắt, thì vật nào bị gỉ chậm nhất?

  1. Sắt tráng kẽm B. Sắt tráng thiếc
  2. Sắt tráng niken D. Sắt tráng đồng

Câu 81. Phát biểu nào sau đây là không đúng?

  1. Ăn mòn kim loại là sự huỷ hoại kim loại và hợp kim dưới tác dụng của môi trường xung quanh
  2. Ăn mòn kim loại là một quá trình hoá học trong đó kim loại bị ăn mòn bởi các axit trong môi trường không khí.
  3. Trong quá trình ăn mòn, kim loại bị oxi hoá thành ion của nó
  4. Ăn mòn kim loại được chia làm hai dạng: ăn mòn hoá học và ăn mòn điện hoá

Câu 82. Phát biểu sau đây là đúng khi nói về ăn mòn hoá học?

  1. Ăn mòn hoá học không làm phát sinh dòng điện
  2. Ăn mòn hoá học làm phát sinh dòng điện một chiều
  3. Kim loại tinh khiết sẽ không bị ăn mòn hoá học
  4. Về bản chất, ăn mòn hoá học cũng là một dạng của ăn mòn điện hoá

Câu 83. Điều kiện để xảy ra ăn mòn điện hoá là gì?

  1. Các điện cực phải tiếp xúc với nhau hoặc được nối với nhau bằng một dây dẫn
  2. Các điện cực phải được nhúng trong dung dịch điện li
  3. Các điện cực phải khác nhau về bản chất
  4. Cả ba điều kiện trên

Câu 84. Một chiếc chìa khoá làm bằng hợp kim Cu – Fe bị rơi xuống đáy giếng. Sau một thời gian chiếc chìa khoá sẽ:

  1. Bị ăn mòn hoá học
  2. Bị ăn mòn điện hoá
  3. Khôn bị ăn mòn
  4. Ăn mòn điện hoá hoặc hoá học tuỳ theo lượng Cu-Fe có trong chìa khoá đó

Hãy chọn đáp án đúng

Câu 85. Có một thuỷ thủ làm rơi một đồng 50 xu làm bằng Zn xuống đáy tàu và vô tình quên không nhặt lại đồng xu đó. Hiện tượng gì sẽ xảy ra sau một thời gian dài?

  1. Đồng xu rơi ở chỗ nào vẫn còn nguyên ở đó
  2. Đồng xu biến mất
  3. Đáy tàu bị thủng dần làm con tàu bị đắm
  4. Đồng xu nặng hơn trước nhiều lần

Câu 86. Để bảo vệ nồi hơi (Supde) bằng thép khỏi bị ăn mòn, người ta có thể lót những kim loại nào sau đây vào mặt trong của nồi hơi?

  1. Zn hoặc Mg B. Zn hoặc Cr
  2. Ag hoặc Mg D. Pb hoặc Pt

Câu 87. Trên cửa của các đập nước bằng thép thường thấy có gắn những lá Zn mỏng. Làm như vậy là để chống ăn mòn cửa đập theo phương pháp nào trong các phương pháp sau đây?

  1. Dùng hợp kim chống gỉ
  2. Phương pháp hủ
  3. Phương pháp biến đổi hoá học lớp bề mặt
  4. Phương pháp điện hoá

Câu 88. Trong các chất sau: Mg, Al, hợp kim Al – Ag, hợp kim Al – Cu, chất nào khi tác dụng với dung dịch H2SO4 loãng giải phóng bọt khí H2 nhiều nhất?

  1. Al B. Mg và Al
  2. Hợp kim Al – Ag D. Hợp kim Al-Cu

Câu 89. Cho một thanh Al tiếp xúc với một thanh Zn trong dung dịch HCl, sẽ quan sát được hiện tượng gì?

  1. Thanh Al tan, bọt khí H2 thoát ra từ thanh Zn
  2. Thanh Zn tan, bọt khí H2 thoát ra từ thanh Al
  3. Cả 2 thanh cùng tan và bọt khí H2 thoát ra từ cả 2 thanh.
  4. Thanh Al tan trước, bọt khí H2 thoát ra từ thanh Al

Câu 90. Có 2 chiếc thìa sắt như nhau, một chiếc giữ nguyên còn một chiếc bị vặn cong cùng đặt trong điều kiện không khí ẩm như nhau. Hiện tượng xảy ra là gì?

  1. Cả 2 chiếc thìa đều không bị ăn mòn
  2. Cả 2 chiếc thìa đều bị ăn mòn với tốc độ như nhau
  3. Chiếc thìa cong bị ăn mòn ít hơn
  4. Chiếc thìa cong bị ăn mòn nhiều hơn

Câu 91. Một lá Al được nối với một lá Zn ở một đầu, đầu còn lại của 2 thanh kim loại đều được nhúng trong dịch muối ăn. Tại chỗ nối của 2 thanh kim loại sẽ xảy ra quá trình nào?

  1. Ion Zn2+ thu thêm 2e để tạo Zn
  2. Ion Al3+ thu thêm 3e để tạo Al
  3. Electron di chuyển từ Al sang Zn
  4. Electron di chuyển từ Zn sang Al

Câu 92. Giữ cho bề mặt kim loại luôn sạch, không có bùn đất bám vào là một biện pháp để bảo vệ kim loại không bị ăn mòn. Như vậy là đã áp dụng phương pháp chống ăn mòn nào sau đây?

  1. Cách li kim loại với môi trường
  2. Dùng phương pháp điện hoá
  3. Dùng phương pháp biến đổi hoá học lớp bề mặt
  4. Dùng phương pháp phủ

Câu 93. Phát biểu nào sau đây là không đúng?

  1. Gỉ sắt có công thức hoá học là Fe3O4xH2O
  2. Gỉ đồng có công thức hoá học là Cu (OH)2CuCO3
  3. Các đồ dùng bằng sắt thường bị ăn mòn do không được chế tạo từ Fe tinh khiết mà thường có lẫn các tạp chất khác
  4. Trong quá trình tạo thành gỉ Fem, anôt xảy ra quá trình

O2 + 2H2O + 4e ® 4OH

ĐÁP ÁN

CHƯƠNG VIII

KIM LOẠI KIỀM, KIỀM THÔ VÀ NHÔM

C.1. Kim loại kiềm

Câu 1. Kim loại kiềm có nhiệt độ nóng chảy tháp và mềm là do yếu tố nào sau đây?

  1. Khối lượng riêng nhỏ
  2. Thể tích nguyên tử lớn và khối lượng nguyên tử nhỏ
  3. Điện tích của ion nhỏ (+1), mật độ electron thấp, liên kết kim loại kém bền
  4. Tính khử mạnh hơn các kim loại khác

Câu 2. Để bảo quản các kim loại kiềm cần phải làm gì?

  1. Ngâm chúng vào nước
  2. Giữ chúng trong lọ có nắp đậy kín
  3. Ngâm chúng trong rượu nguyên chất
  4. Ngâm chúng trong dầu hoả

Câu 3. Điện phân muối clorua kim loại kiềm nóng chảy thu được 1,792 lit khí (đktc) ở anot và 6,24 gam kim loại ở catot. Công thức hoá hc của muối đem điện phân là công thức nào sau đây?

  1. LiCl B. NaCl
  2. KCl D. RbCl

Câu 4. Có dung dịch NaCl trong nước. Quá trình nào sau đây biểu diễn sự điều chế kim loại Na từ dung dịch trên?

  1. Điện phân dung dịch
  2. Dùng kim loại K đẩy Na ra khỏi dung dịch
  3. Nung nóng dung dịch để NaCl phan huỷ
  4. Cô cạn dung dịch và điện phân NaCl nóng chảy

Câu 5. Có 2 lít dung dịch NaCl 0,5M. Khối lượng kim loại và thể tích khí thu được (đktc) từ dung dịch trên (hiệu suất điều chế bằng 90%) là”

  1. 27,0gam và 18,00lit B. 20,7gam và 10,08;ot
  2. 10,35g và 5,04 lit D. 31,05gam và 15,12 lit

Hãy chọn đáp án đúng

Câu 6. Trong các phản ứng sau, phản ứng nào trong đó ion Na+ bị khử thành nguyên tử Na?

  1. 4Na + O2 ® 2Na2O

B.2Na+2H2O ® 2NaOH+H2

  1. 4NaOH ® 4Na+O2 + 2H2O
  2. 2Na+H2SO4®Na2SO4+H2

Câu 7. Quá trình nào sau đây, ion Na+ không bị khử?

  1. Điện phân NaCl nóng chảy
  2. Điện phân dung dịch NaCl trong nước
  3. Điện phân NaOH nóng chảy
  4. Điện phân Na2OH nóng chảy

Câu 8. Quá trình nào sau đây, ion Na+ bị khử?

  1. Dung dịch NaOH tác dụng với dung dịch HCl
  2. Điện phân NaCl nóng chảy
  3. Dung dịch Na2CO3 tác dụng với dụng HCl
  4. Dung dịch NaCl tác dụng với dung dịch AgNO3

Câu 9. Cho biết thể tích của 1 mol các kim loại kiềm là:

Kim loại

Li

Na

K

Cs

V(cm3)

13,2

23,71

45,35

55,55

Khối lượng riêng (g/cm3) của mỗi kim loại trên lần lượt là bao nhiêu?

  1. 0,97; 0,53; 1,53 và 0,86
  2. 0,97; 1,53; 0,53 và 0,86
  3. 0,53; 0,97; 0,86 và 1,53
  4. 0,53; 0,86; 0,97 và 1,53

Câu 10. Trong quá trình điện phân dung dịch NaCl, ở cực âm xảy ra quá trình gì?

  1. Sự khử ion Na+ B. Sự oxi hoá ion Na+
  2. Sự khử phân nước D. Sự oxi hoá phân tử nước

Câu 11. Trong quá trình điện phân dung dịch KBr, phản ứng nào sau đây xảy ra ở cực dương?

  1. Ion Br bị oxi hoá B. IonBr bị khử
  2. Ion K+ bị oxi hoá D. Ion K+ bị khử

Câu 12. Cho 6,08 gam hỗn hợp NaOH và KOH tác dụng hết với dung dịch HCl tạo ra 8,30gam hỗn hợp muối clorua. Số gam hiđroxit trong hỗn hợp lần lượt là bao nhiêu?

  1. 2,4gam và 3,68gam B. 1,6gam và 4,48gam
  2. 3,2gam và 2,88gam D. 0,8gam và 5,28 gam

Câu 13. Cho 100 gam CaCO3 tác dụng với axit HCl dư. Khí thoát ra được hấp thụ bằng 200gam dung dịch NaOH 30%. Khối lượng muối natri trong dung dịch thu được là bao nhiêu gam?

  1. 10,6 gam Na2CO3
  2. 53 gam Na2CO3 và 42 gam NaHCO3
  3. 16,8 gam NaHCO3
  4. 79,5 gam Na2CO3 và 21 gam NaHCO3

Câu 14. Nung nóng 100 gam hỗn hợp gầm NaCO3 và NaHCO3 cho đến khối lượng không đổi còn lại 69 gam chất rắn. Thành phần % khối lượng mỗi chất trong hỗn hợp đầu là.

  1. 63% và 37% B. 84% và 16%
  2. 42% và 58% D. 21% và 79%

Câu 15. Cho 6 lít hỗn hợp CO2 và N2 (đktc) đi qua dung dịch KOH tạo ra 2,07 gam K2CO3 và 6 gam KHCO3. Thành phần % thể tích của CO2 trong hỗn hợp là

  1. 42% B. 56%
  2. 28% D. 50%

Câu 16. Những đặc điểm nào sau đây là chung cho các kim loại kiềm?

  1. Bán kinh nguyên tử
  2. Số lớp electron
  3. Số electron ngoài cùng của nguyên tử
  4. Điện tích hạt nhân của nguyên tử

Câu 17. Những đặc điểm nào sau đây không phải là chung cho các kim loại kiềm?

  1. Số oxi hoá của nguyên tố trong hợp chất
  2. Số lớp electron
  3. số electron ngoài cùng của nguyên tử
  4. Cấu tạo đơn chất kim loại

Câu 18. Dãy nào sau đây xếp theo chiều giảm dần bán kính của các ion?

  1. S2-; Cl; K+; Ca2+ B. Ca2+; K+; Cl; S2-
  2. S2-; K+; Cl; Ca2+ D. Ca2+; S2-; K+; Cl

Câu 19. Dãy nào sau đây xếp theo chiều tăng dần bán kính của các ion?

  1. O2-; F; Na+; Mg2+; Al3+ B. Na+; O2-; Al3+; F; Mg2+
  2. Al3+; Mg2+; Na+; F; O2- D. F; Na+; O2-; Mg2+; Al3+

Câu 20. Điện phân dung dịch NaOH với cường độ không đổi là 10A trong thời gian 268 giờ. Dung dịch còn lại sau điện phân có khối lượng 100g và nồng độ 24%. Nồng độ % của dung dịch ban đầu là bao nhiêu phần trăm?

A.9,6%                                                                                                     B. 4,8%

  1. 2,4% D. 1,2%

Câu 21. Cho 5 gam hỗn hợp Na, Na2O và tạp chất trơ tác dụng hết với nước thoát ra 1,875 lít khí (đktc). Trung hoà dung dịch sau phản ứng cần 100ml dung dịch HCl2M. Thành phần % khối lượng mỗi chất trong hỗn hợp đầu là bao nhiêu?

  1. 80%Na; 18% Na2O; 2% tạp chất
  2. 77% Na; 20m2%Na2O; 2,8% tập chất
  3. 82%Na; 12,4% Na2O; 5,6% tạp chất
  4. 92%Na; 6,9%Na2O; 1,1% tạp chất

Câu 22. Thêm từ từ từng giọt dung dịch chứa 0,05mol HCl vào dung dịch chứa 0,06 mol Na2CO3. Thể tích khí CO2 (đktc) thu được bằng bao nhiêu lit?

  1. 0,000 lit C. 1,120 lit
  2. 0,560 lit D. 1,344lit

Câu 23. Nhóm các kim loại nào sau đây đều tác dụng với nước lạnh tạo dugn dịch kiềm?

  1. Na, K, Mg, Ca B, Be, Mg, Ca, Ba
  2. Ba,Na, K, Ca D. K, Na, Ca, Zn

Câu 24. Tính chất hoá học chung của các kim loại kiềm, kiềm thổ, nhôm là gì?

  1. Tính khử mạnh B. Tính khử yếu
  2. Tính oxi hoá yếu D. Tính oxi hoá manj

Câu 25. Các ion nào sau đây đều có cấu hình 1s22s22p6?

  1. Na+, Ca2+, Al3+ B. K+, Ca2+, Mg2+
  2. Na+, Mg2+, Al3+ D. Ca2+, Mg2+, Al3+

Câu 26. Phản ứng đặc trưng nhất của kim loại kiềm là phản ứng nào?

  1. Kim loại kiềm tác dụng với nước
  2. Kim loại kiềm tác dụng với oxi
  3. Kim loại kiềm tác dụng với dung dịch axit
  4. Kim loại kiềm tác dụng với dung dịch muối

Câu 27. Chọn thứ tự giảm dần độ hoạt động hoá học của các kim loại kiềm

  1. Na – K – Cs – Rb – Li B. Cs – Rb – K – Na – Li
  2. Li – Na – K – Rb – Cs D. K – Li – Na – Rb – Cs

Câu 28. Phương trình điện phân nào sau đây sai?

  1. 2ACln (điện phân nóng chảy) ® 2A + nCl2
  2. 4MOH (điện phân nóng chảy) ® 4M + 2H2O
  3. 4AgNO3 + 2 H2O ® 4Ag + O2 + 4 HNO3
  4. 2NaCl + 2H2O ® H2 + Cl2 + 2NaOH (có vách ngăn)

Câu 29. Muốn điều chế Na, hiện nay người ta có thể dùng phản ứng nào trong các phản ứng sau?

  1. CO + Na2O 2Na+CO2
  2. 4NaOH (điện phân nóng chảy) ® 4Na + 2H2O + O2
  3. 2NaCl (điện phân nóng chảy) ® 2Na+Cl2
  4. B và C đều đúng

Câu 30. Hiện tượng nào đã xảy ra khi cho Na kim loại vào dung dịch CuSO4?

  1. Sủi bọt không màu và có kết tủa màu xanh
  2. Bề mặt kim loại có màu đỏ, dung dịch nhạt màu
  3. Sủi bọt khí không màu và có kết tủa màu đỏ
  4. Bề mặt kim loại có màu đỏ và có kết tủa màu xanh

Câu 31. Phát biểu nào dưới đây không đúng?

  1. Kim loại kiềm gồm Li, Na, K, Ra, Cs và Fr
  2. Kim loại kiềm thuộc nhóm IA của bảng tuần hoàn
  3. Các kim loại kiềm đều các cấu hình electron hoá trị loà ns1
  4. Trong hợp chất, kim loại kiềm có mức oxi hoá +1

Câu 32. Giải thích nào dưới đây không đúng?

  1. Nguyên tử kim loại kiềm có năng lượng ion hoá I1 nhỏ nhất so với các kim loại khác trong cùng chu kì do kim loại kiềm có bán kính lớn nhất.
  2. Do năng lượng ion hoá nhỏ nên kim loại kiểm có tính khử rất mạnh.
  3. Nguyên tử kim loại kiềm có xu hướng nhường 1 electron do I2 của nguyên tử kim loại kiềm lớn hơn nhiều so với I1 và do ion kim loại kiềm M+ có cấu hình bền.
  4. Tinh thể kim loại kiềm có cấu trúc rỗng do có cấu tạo mạng tinh thể lập phương tâm diện

Câu 33. Phát biểu nào dưới đây là đúng?

  1. Kim loại kiềm có nhiệt độ nóng chảy và nhiệt sôi thấp do liên kết kim loại trong mạng tinh thể kim loại kiềm bền vững.
  2. Kim loại kiềm có khối lượng riêng nhỏ do nguyên tử kim loại kiềm có bán kính lớn và cấu trúc tinh thể kém đặc khít.
  3. Kim loại kiềm có độ cứng cao do liên kêt skim loịa trong mạng inh thể kim loại kiềm bền vững.
  4. Kim loại kiềm có tỉ khối lớn và thuộc loại kim loại nặng

Câu 34. Cho 0,2mol Na cháy hết trong O2 dư thu được sản phẩm rắn A. Hoà tan hết A trong nước thu được 0,025mol O2. Khối lượng của A bằng bao nhiêu gam?

  1. 3,9 gam B. 6,6gam
  2. 7,0 gam D. 7,8gam

Câu 35. Cho hỗn hợp các kim loại kiềm Na, K hoà tan hết vào nước được dung dịch A và 0,672 lit khí H2(đktc). Thể tích dung dịch HCl 0,1M cần để trung hoà hết một phần ba thể tích dung dịch A là bao nhiêu?

  1. 100ml B. 200ml
  2. 300ml D. 600ml

Câu 36. Hoà tan m gam Na kim loịa vào nước thu được dung dịch A. Trung hoà dung dịch A cần 100ml dung dịch H2SO41M. Tính m

  1. 2,3gam B. 4,6gam
  2. 6,9 gam D.9,2gam

Câu 37. Ứng dụng nào mô tả dưới đây không thể là ứng dụng của kim loại kiềm?

  1. Mạ bảo vệ kim loại
  2. Tạo hợp kim dùng trong thiết bị báo cháy
  3. Chế tạo tế bào quang điện
  4. Điều chế một số kim loại khác bằng phương pháp nhiệt luyện

Câu 38. Dung dịch nào dưới đây không làm đổi màu quỳ?

  1. NaOH B. NaHCO3
  2. Na2CO3 D. NH4Cl

Câu 39. Trộn 200ml dung dịch H2SO4 0,05M với 300ml dung dịch NaOH 0,06M pH của dung dịch tạo thành là bao nhiêu?

  1. 2,7 B. 1,6
  2. 1,9 D. 2,4

Câu 40. Những nguyên tố trong nhóm IA của bảng tuần hoàn được sắp xếp theo trình tự tăng dần của đại lượng nào?

  1. Nguyên tử khối B. Bán kính nguyên tử
  2. Điện tích hạt nhân của nguyên tử D. Số oxi hoá

Câu 41. Nguyên tố nào sau đây chỉ có ở trạng thái hợp chất trong tự nhiên?

  1. Au B. Na
  2. Ne D. Ag

Câu 42. Nếu M là nguyên tố nhóm IA thì oxit của nó có công thức là gì?

  1. MO2 B. M2O3
  2. MO D. M2O

Câu 43. Cho a mol CO2 hấp thụ hoàn toàn vào dung dịch chứa 2a mol NaOH. Dung dịch thu được có giá trị pH là bao nhiêu?

  1. Không xác định B. > 7
  2. < 7 D. = 7

Câu 44. Cho 0,001 mol NH4Cl vào 100ml dung dịch NaOH có pH = 12 và đun sôi, sau đó làm nguội, thêm vào một ít phenolphtalein, dung dịch thu được có màu gì?

  1. xanh B. hồng
  2. trắng D. không màu

Câu 45. Thể tích H2 sinh ra khi điện phân dung dịch chứa cùng một lượng NaCl có màng ngăn (1) và không có màng ngăn (2) là:

  1. Bằng nhau B. (2) gấp đôi (1)
  2. (1) gấp đôi (2) D. không xác định

Hãy chọn đáp án đúng

Câu 46. Phản ứng nào sau đây không tạo ra hai muối?

  1. CO2 + NaOH dư
  2. NO2 + NaOH dư
  3. Fe3O4 + HCl dư
  4. Ca (HCO3)2 + NaOH dư

Câu 47. Trộn 150ml dd Na2CO3 1M và K2CO3 0,5M với 250mL dd HCL 2M thì thể tích khí CO2 sinh ra ở đktc là bao nhiêu lít?

  1. 2,52 lít B. 5,04 lít
  2. 3,36 lít D. 5,60 lít

Câu 48. Thêm từ từ đến hết dung dịch chứa 0,02mol K2CO3 vào dung địch chứa 0,03mol HCl. Thể tích khí CO2 thu được (đktc) bằng bao nhiêu lít?

  1. 0,448 lit B. 0,224lit
  2. 0,336 lit D. 0,112 lit

Đáp án

 

C. KIM LOẠI KIỀM THỔ

Câu 1. Trong những câu sau đây, câu nào không đúng đối với nguyên tử kim loại kiềm thổ?

Theo chiều tăng dần của điện tích hạt nhân thì:

  1. Bán kính nguyên tử tăng dần B. Năng lượng ion hoá giảm dần
  2. Khối lượng riêng tăng dần D. Thế điện cực chuẩn tăng dần

Câu 2. Các nguyên tố trong cặp nguyên tố nào sau đây có tính chất hoá học tương tự nhau?

  1. Mg và S B. Mg và Ca
  2. Ca và Br2 D. S và Cl2

Câu 3. Ở trạng thái cơ bản, nguyên tử kim loại kiềm thổ có số electron hoá tị bằng

  1. 1 e B. 2e
  2. 3e D. 4e

Câu 4. Trong nhóm kim loại kiềm thổ:

  1. Tính khử của kim loại tăng khi bán kính nguyên tử tăng
  2. Tính khử của kim loại tăng khi bán kính nguyên tử giảm
  3. Tính khử của kim loại giảm khi bán kính nguyên tử tăng
  4. Tính khử của kim loại tăng khi bán kính nguyên tử giảm

Hãy chọn đáp án đúng

Câu 5. Khi so sánh tính chất của Ca và Mg, câu nào sau đây không đúng?

  1. Số electron hoá trị bằng nhau
  2. Đều tác dụng với nước ở nhiệt độ thường
  3. Oxit đều có tính chất oxit bazơ
  4. Đều được điều chế bằng cách điện phân clorua nóng chảy

Câu 6. Điều nào sau đây không đúng của canxi?

  1. Nguyên tử Ca bị oxi hoá khi Ca tác dụng với H2O
  2. Ion Ca2+ bị khử khi điện phân Cal2 nóng chảy
  3. Ion Ca2+ không bị oxi hoá hoặc khử khi Ca (OH)2 tác dụng với HCl
  4. Nguyên tử Ca bị khử khi Ca tác dụng với H2

Câu 7. Cho 10 gam một kim loại kiềm thổ tác dụng hết với nước thoát ra 5,6 khi (đktc). Kim loại kiềm thổ đó có kí hiệu hoá học gì?

  1. Ba B. Mg
  2. Ca D. Sr

Câu 8. Đun nóng 6,96 gam MnO2 với dung dịch HCl đặc, dư. Khí thoát ra tác dụng hết với kim loại kiềm thổ M tạo ra 7,6 gam muối. M là kim loại nào sau đây?

  1. Be B. Mg
  2. Ca D. Ba

Câu 9. Khi nung đến hoàn toàn 20 gam quặng đôlômit thoát ra 5,6 lit khí (ở 0C và 0,8atm). Hàm lượng CaCO3. MgCO3 trong quặng là bao nhiêu %?

  1. 10 C.6
  2. 8 D.12

Câu 11. Nhóm các bazơ nào có thể điều chế được bằng phương pháp điện phân?

  1. NaOH và Ba(OH)2 C. Zn(OH)2 và KOH
  2. Cu(OH)2 và Al (OH)3 D. Mg (OH)2 và Fe (OH)3

Câu 12. Trong các chất sau: H2O; Na2O; CaO; MgO. Chất có liên kết cộng hoá trị là chất nào?

  1. H2O B. Na2O
  2. CaO D. MgO

Câu 13. Trong phản ứng: CO+ H2O HCO3 + OH. Vai trò của  COvà H2O là gì?

  1. COlà axit và H2O là bazơ
  2. COlà bazơ và H2O là axit
  3. COlà lưỡng tính và H2O là trung tính
  4. COlà chất oxi hoá và H2O là chất khử

Câu 14. Cho 10 ml dung dịch muối canxi tác dụng với dung dịch Na2CO­3 dư tách ra một kết tủa, lọc và đem nung kết tủa đến lượng không đổi còn lại 0,28gam chất rắn. Khối lượng ion Ca2+ trong 1 lít dung dịch là bao nhiêu gam?

  1. 10g B. 20g
  2. 30g D. 40g

Câu 15. Hoà tan 8,2 gam hỗn hợp bột CaCO3 và MgCO3 trong nước cần 2,016 lít khí CO2 (đktc). Số gam mỗi muối ban đầu lần lượt là bao nhiêu?

  1. 2,0 gam và 6,2 ga, B. 6,1 gam và 2,1 gam
  2. 4,0 gam và 4,2gam D. 1,48gam và 6,72 gam

Câu 16. Có các chất sau: NaCl, NaOH, Na2CO3, HCl. Chất có thể làm mềm nước cứng tạm thời là chất nào?

  1. NaCl B. NaOH
  2. Na2CO3 D. HCl

Câu 17. Nước cứng là nước có chứa nhiều ion nào?

  1. Na+ mà Mg2+ B. Ba2+ và Ca2+
  2. Ca2+ và Mg2+ D. K+ và Ba2+

Câu 18. Câu nào sau đây về nước cứng là không đúng?

  1. Nước có chứa nhiều ion Ca2+; Mg2+
  2. Nước không chứa hoặc chứa ít ion Ca2+, Mg2+ là nước mềm
  3. Nước cứng có chứa một trong hai Ion Cl và SO2-4 hoặc cả hai là nước cứng tạm thời.
  4. Nước cứng có chứa đồng thời anion HCO3 và SO2-4 hoặc Cl là nước cứng toàn phần.

Câu 19. Hỗn hợp X gồm 2 kim loại kiềm và 1 kim loại kiềm thổ tan hết trong nước tạo ra dung dịch Y và thoát ra 0,12 mol hiđro. Thể tích dung dịch H2SO4 0,5M cần để trung hoà dung dịch Y là bao nhiêu?

  1. 120 ml B. 60ml
  2. 1,20lit D. 240ml

Câu 20. Một dung dịch chứa các ion Na+, Ca2+, Mg2+, Ba2+, H+, Cl. Phải dùng dung dịch chất nào sau đây để loại bỏ hết các ion Ca2+, Mg2+, Ba2+, H+ ra khỏi dung dịch ban đầu?

  1. K2CO3 B. NaOH
  2. Na2SO4 D. AgNO3

Câu 21. Tính khối lượng kết tủa tạo thành khi trộn lẫn dung dịch chứa 0,0075 mol NaHCO3 với dung dịch chứa 0,01 mol Ba (OH)2

  1. 0,73875 gam B. 1,47750gam
  2. 1,97000 gam D. 2,95500gam

Câu 22. Giải pháp nào sau đây được sử dụng để điều chế Mg kim loại?

  1. Điện phân nóng chảy MgCl2
  2. Điện phân dung dịch Mg (NQ3)2
  3. Cho Na vào dung dịch MgSO4
  4. Dùng H2 khử MgO ở nhiệt độ cao

Câu 23. Mô tả nào dưới đây không phù hợp các nguyên tố nhóm IIA?

  1. Cấu hình electron hoá trị là ns2
  2. Tinh thể có cấu trúc lục phương
  3. Gồm các nguyên tố Be, Mg, Ca, Sr, Ba
  4. Mức oxi hoá đặc trưng trong các hợp chất là +2

Câu 24. Theo chiều tăng dần điện tích hạt nhân nguyên tử của các nguyên tố kim loại kiềm thổ, đại lượng nào dưới đây có giá trị tăng dần?

  1. Bán kính nguyên tử B. Năng lượng ion hoá
  2. Thế điện cực chuẩn D. Độ cứng

Câu 25. Khi so sánh với kim loại kiềm cùng chu kì, nhận xét nào về kim loại kiềm thổ dưới đây là đúng?

  1. Độ cứng lớn hơn
  2. Thế điện cực chuẩn âm hơn
  3. Khối lượng riêng nhỏ hơn (nhẹ hơn)
  4. Nhiệt độ nóng cháy và nhiệt độ sôi thấp hơn

Câu 26. Nhận xét nào sau đây không đúng?

  1. Các kim loại kiềm thổ có tính khử mạnh
  2. Tính khử của các kim loại kiềm thổ tăng dần từ Be đến Ba
  3. Tính khử của kim loại kiềm thổ yếu hơn kim loại kiềm cùng chu kì
  4. Các kim loại kiểm thổ có năng lượng ion hoá nhỏ và thế điện cực chuẩn lớn

Câu 27. Kim loại Be không tác dụng với chất nào dưới đây?

  1. O2 B. H2O
  2. Dung dịch NaOH D. Dung dịch HCl

Câu 28. Kim loại Mg không tác dụng với chất nào dưới đây ở nhiệt độ thường?

  1. H2O B. Dung dịch NaOH
  2. Dung dịch HCl D. Dung dịch Cu SO4

Câu 29. Khi cho Ca kim loại vào các chất dưới đây, trường hợp nào không có phản ứng của Ca với nước?

  1. H2O B. Dung dịch HCl vừa đủ
  2. Dung dịch NaOH vừa đủ D. Dung dịch CuSO4 vừa đủ

Câu 30. So sánh (1) thể tích khí O2 cần dùng để đốt cháy hỗn hợp gồm 1 mol Be, 1 mol ca và (2) thể tích khí H2 sinh ra khi hoà cùng lượng hỗn hợp trên vào nước

  1. (1) bằng (2) B. (1) gấp đôi (2)
  2. (1) bằng một nửa (2) D. (1) bằng một p9hần ba (2)

Câu 31. Hoà tan hết 7,6 gam hỗn hợp hai kim loại kiềm thổ thuộc hai chu kì liên tiếp bằng lượng dư dung dịch HCl thì thu được 5,6 lit khí (đktc). Hai kim loại này là các kim loại nào?

  1. Be và Mg B. Mg và Ca
  2. Ca và Sr D. Sr và Ba

Câu 32. Mô tả ứng dụng của Mg nào dưới đây không đúng?

  1. Dùng chế tạo dây dẫn điện
  2. Dùng để tạo chất chiếu sáng
  3. Dùng trong các quá trình tổng hợp hữu cơ
  4. Dùng để chế tạo hợp kim nhẹ, cần cho công nghiệp sản xuất máy bay, tên lửa, ô tô

Câu 33. Phương trình hoá học nào dưới đây không đúng?

  1. BaSO4 Ba + SO2 + O2
  2. 2Mg (NO3) 2MgO + 4NO2 + O2
  3. CaCO3 CaO + CO2
  4. Mg (OH)2 MgO + H2O

Câu 34. Dãy nào dưới đây chỉ gồm các chất tan tốt trong nước?

  1. BeSO4, MgSO4, CaSO4, SrSO4
  2. BeCl2, MgCl2, CaCl2, SrCl2
  3. BeCO3, MgCO3, CaCO3, SrCO3
  4. Be (OH)2, Mg (OH)2, Ca (OH)2

Câu 35. Phản ứng nào sau đây không xảy ra?

  1. CaSO4 + Na2CO3 B. Ca (OH)2 + MgCl2
  2. CaCO3 + Na2SO4 D. CaSO4 + BaCl2

Câu 36. Thổi Vlit (đktc) khí CO2 vào 300ml dung dịch Ca (OH)2 0,02M thì thu được 0,2 gam kết tủa. Giá trị của V là:

  1. 44,8 ml hoặc 89,6ml B. 224ml

C44,8ml hoặc 224ml                                                                            D. 44,8ml

Hãy chọn đáp án đúng

Câu 37. Dẫn V lít (đktc) khí CO2 qua 100ml dung dịch Ca(OH)2 1 M thu được 6gam kết tủa. Lọc bỏ kết tủa, lấy dung dich nước lọc đun nóng lại thu được kết tủa nữa. V bằng bao nhiêu?

  1. 3,136lit B. 1,344lit
  2. 1,344 lit D. 3,360lit hoặc 1,120lit

Câu 38. Sục 2,24 lit CO2 (đktc) vào 100ml dd Ca (OH)2 0,5M và KOH 2M. Khối lượng kết tủa thu được sau khi phản ứng xảy ra hoàn toàn là bao nhiêu gam?

  1. 500gam B. 30,0gam
  2. 10,0gam D. 0,00gam

Câu 39. Thổi khí CO2 vào dung dịch chứa 0,02 mol Ba (OH)2. Giá tị khố lượng kết tủa biến thiên trong khoảng nào khi CO2 biến thiên trong khoảng từ 0,005mol đến 0,024 mol?

  1. 0gam đến 3,94 gam B. 0 gam đến 0,985 gam
  2. 0,985 gam đến 3,94 gam D. 0,985gam đến 3,152 gam

Câu 40. Phản ứng nào dưới đây đồng thời giải thích sự hình thành thạch nhũ trong hang động và sự xâm nhập thực của nước mưa với đá vôi?

  1. CaCO3 + H2O + CO2 ® Ca (HCO3)2
  2. Ca(HCO3)2 ® CaCO3 + H2O + CO2
  3. CaCO3 + 2HCl ® CaCl2 + H2O + CO2
  4. CaCO3 CaO + CO2

Câu 41. Những mô tả ứng dụng nào dưới đây không chính xác?

  1. CaO làm vật liệu chịu nhiệt, điều chế CaC2, làm chất hút ẩm
  2. Ca (OH)2 dùng để điều chế NaOH, chế tạo vữa xây nhà, khử chưa đất trồng, chế tạo clorua vôi
  3. CaCO3 dùng để sản xuất xi măng, vôi sống, vôi tôi, khí cacbonic
  4. CaSO4 dùng để sản xuất xi măng, phấn viết, bó bột. Thạch cao khan dùng để đúc tượng, mẫu trang trí nội thất.

Câu 42. Nước cứng không gây ra tác hại nào dưới đây?

  1. Gây ngộ độc nước cuống
  2. Làm mất tính tẩy rửa của xà phòng, làm hư hại quần áo
  3. Làm hỏng các dung dịch pha chế. Làm thực phẩm lâu chín và giảm mùi vị thực phẩm
  4. Gây hao tốn nhiên liệu và không an toàn cho các nồi hơi, làm tắc các đường ống dẫn nước.

Câu 43. Cho các phản ứng mô tả các phương pháp khác nhau để làm mềm nước cứng (dùng M2+ thay cho Ca2+ và Mg2+):

1) M2+ + 2 HCO3 MCO3 + H2O  + CO2

2) M2+ + HCO3  + OH ® MCO3

3) M2+ + CO2-3 ® MCO3

4) M2+ + 2 PO3-4 ® M3(PO4)2

Phương pháp nào có thể áp dụng với nước có độ cứng tạm thời?

  1. 1) B. 2)

C.1) và 2)                                                                                                D. 1) 2) 3) và 4)

ĐÁP ÁN

 

C3. NHÔM

 

Câu 1. Cho biết số thứ tự của Al trong bảng tuần hoàn là 13. Phát biểu nào sau đây đúng?

  1. Al thuộc chu kỳ 3, phân nhóm chính nhóm III B. Al thuộc chu kỳ 3, phân nhóm phụ nhóm III
  2. Ion nhôm có cấu hình electron lớp ngoài cùng là 2s2 D. Ion nhôm có cấu hình electron lớp ngoài cùng là 3s2

Câu 2. Cho phản ứng

Al  + H2O + NaOH ® NaAlO2 + 3/2H2

Chất tham gia phản ứng đóng vai trò chất oxi hoá là chất nào?

  1. Al B. H2O                                                   C. NaOH                                               D. NaAlO2

Câu 3. Mô tả nào dưới đây không phù hợp với nhôm?

  1. Ở ô thứ 12, chu kỳ 2, nhóm IIIA B. Cấu hình electron [Ne] 3s23p1
  2. Tinh thể cấu tạo lập phương tâm diện D. Mức oxi hoá đặc trưng là +3

Câu 4. Mô tả nào dưới đây về tính chất vật lý của nhôm là chưa chính xác?

  1. Màu trắng bạc B. Là kim loại nhẹ
  2. Mềm, dễ kéo sợi và dát mỏng D. Dẫn nhiệt và dẫn điện tốt, tốt hơn các kim loại Ag và Cu

Câu 5. Nhận xét nào dưới đây đúng?

  1. Nhôm kim loại không tác dụng với nước do thế khử của nhôm lớn hơn thế khử của nước
  2. Trong phản ứng của nhôm với dung dịch NaOH thì NaOH đóng vai trò chất oxi hoá
  3. Các vận dụng bằng nhôm không bị oxi hoá tiếp và không tan trong nước do được bảo vệ bởi lớp màng Al2O3
  4. Do có tính khử mạnh nên nhôm phản ứng với các axit HCl, HNO3, H2SO4 trong mọi điều kiện

Câu 6. Đốt hoàn toàn m gam bột nhôm trọng lượng S dư, rồi hoà tan hết sản phẩm thu được vào nước thì thoát ra 6,72lít khí (đktc). Tính m

  1. 2,70g B. 4,05g C. 5,4g                                                   D. 8,1g

Câu 7. Hoà tan hết m gam hỗn hợp Al và Fe trong lượng dư dung dịch H2SO4 loãng thoát ra 0,4mol khí, còn trọng lượng dư dung dịch NaOH thì thu được 0,3mol khí. Tính m

  1. 11,00 gam B. 12,28gam                                         C. 13,70gam                                         D. 19,50gam

Câu 8. So sánh (1) thể tích khí H2 thoát ra khi do Al tác dụng với lượng dư dung dịch NaOH và (2) thể tích khí N2 duy nhất thu được khi cho cùng lượng Al trên tác dụng với dung dịch HNO3 loãng dư.

  1. 1) gấp 5 lần 2) B. 2) gấp 5 lần 1) C. 1) bằng 2)                                         D. 1) gấp 2,5 lần 2

Câu 9. Dùng m gam Al để khử hết 1,6 gam Fe2O3 (phản ứng nhiệt nhôm). Sản phẩm sau phản ứng tác dụng với lượng dư dung dịch NaOH tạo 0,672 lít khí (đktc). Tính m

  1. 0,540gam B. 0,810gam                                         C. 1,080 gam                                        D. 1,755 gam

Câu 10. Nhúng một thanh nhôm kim loại vào dung dịch chứa 0,03mol CuSO4. Sau khi phản ứng hoàn toàn, lấy thanh Al ra khỏi dung dịch. Nhận xét sau thí nghiệm nào sau đây không đúng?

  1. Thanh Al có màu đỏ B. Khối lượng thanh Al tăng 1,38gam
  2. Dung dịch thu được không màu. D. Khối lượng dung dịch tưng 1,38gam

Câu 11. Mô tả ứng dụng nào của nhôm dưới đây là chưa chính xác?

  1. Làm vật liệu chế tạo ô tô, máy bay, tên lửa, tàu vũ trụ
  2. Làm khung cửa, trang trí nội thất và mạ đồ trang sức
  3. Làm dây dẫn điện, thiết bị trao đổi nhiệt, công cụ đun nấu trong gia đình

D, Chế tạo hỗn hợp tecmit, được dùng để hàn gắn đường ray.

Câu 12. Xác định phát biểu không đúng về quá trình điện phân sản xuất Al dưới đây

  1. Cần tinh chế quặng boxit (Al2O3.2H2O) do còn lẫn tạp chất là Fe2O3 và SiO2
  2. Từ 1 tấn boxit chưá 60% Al2O3) có thể điều chế được gần 0,318 tấn Al với hiệu suất 100%
  3. Sản xuất 2,7 tấn Al tiêu hao 18 tấn C làm anot, nếu các quá trình là hoàn toàn và sản phẩm oxi hoá chỉ là CO2
  4. Criolit được sử dụng để hạ nhiệt độ nóng chảy, tăng độ dẫn điện và ngăn cản Al bị oxi hoá bởi không khí

Câu 13. Dung dịch nào dưới đây làm quỳ đổi màu xanh?

  1. K2SO4 B. KAl (SO4)12H2O                           C. Na[Al(OH)4]                                     D. AlCl3

Câu 14. Phản ứng của cặp chất nào dưới đây không tạo sản phẩm khí?

  1. dd Al (NO3)3 + dd Na2S B. dd AlCl3 + dd Na2CO3
  2. Al + dd NaOH D. dd AlCl3 + dd NaOH

Câu 15. Trường hợp nào dưới đây tạo ra kết tủa sau khi phản ứng xảy ra hoàn toàn ?

  1. Thêm dư NaOH vào dd AlCl3 B. Thêm dư AlCl3 vào dd NaOH
  2. Thêm dư HCl vào dd NaAlO2 D. Thêm dư CO2 vào dd NaOH

Câu 16. Hoà tan 0,24 mol FeCl3 và 0,16mol Al2 (SO4)3 vào 0,4mol dung dịch H2SO4 được dung dịch A. thêm 2,6 mol NaOH nguyên chất vào dung dịch A thấy xuất hiện kết tủa B. Khối lượng của B là bao nhiêu gam?

  1. 15,60 gam B. 25,65gam                                         C. 41,28gam                                         D. 0,64 gam

Câu 17. Thêm NaOH vào dung dịch hỗn hợp chứa 0,01 mol HCl và 0,01 mol AlCl3. Kết tủa thu được là lớn nhất và nhỏ nhất ứng với số mol NaOH lần lượt bằng bao nhiêu?

  1. 0,01 mol và ³ 0,02mol B. 0,02mol và ³ 0,03mol                   C. 0,03mol và ³ 0,04mol               D. 0,04 mol và ³ 0,05mol

Câu 18. Thêm HCl vào dd chứa 0,1 mol NaOH và 0,1 mol NaAlO2. Khi kết tủa thu được là 0,08 mol thì số mol HCl đã dùng là bao nhiêu?

  1. 0,08 mol hoặc 0,16 mol B. 0,16mol C. 0,26mol                            D. 0,18 mol hoặc 0,26mol

Câu 19. Kim loại có thể điều chế được từ quặng boxit là kim loại nào?

  1. Nhôm B. Sắt                                                     C. Magie                                                D. Đồng

Câu 20. Kim loại có thể điều chế được từ quặng hematit là kim loại nào?

  1. Nhôm B. Sắt                                                     C. Magie                                                D. Đồng

Câu 21. Kim loại có thể điều chế được từ quặng malakit là kim loại nào?

  1. Nhôm B. Sắt                                                     C. Magie                                                D. Đồng

Câu 22. Kim loại có thể điều chế được bằng phương pháp nhiệt luyện là kim loại nào?

  1. Nhôm B. Sắt                                                     C. Magie                                                D. Đồng

Câu 23. Kim loại có thể điều chế được bằng phương pháp điện phân nóng chảy là kim loại nào?

  1. Kẽm B. Sắt                                                     C. Natri                                                  D. Đồng

Câu 24. Cho m gam hỗn hợp bột Al và Fe tác dụng với dung dịch NaOH dư thoát ra 6,72 lit khí (đktc). Nếu cho m gam hỗn hợp trên tác dụng với dung dịch HCl dư thì thoát ra 8,96 lit khí (đktc). Khối lượng của Al và Fe trong hỗn hợp đầu là bao nhiêu gam?

  1. 10,8 gam Al và 5,6gam Fe B. 5,4 gam Al và 5,6 gam Fe
  2. 5,4 gam Al và 8,4 gam Fe D. 5,4gam Al và 2,8 gam Fe

Câu 25. Cần bao nhiêu gam bột nhôm để có thể điều chế được 78 gam crom từ Cr2O3 bằng phương pháp nhiệt nhôm?

  1. 27,0 gam B. 54,0gam                                           C. 67,5gam                                           D. 40,5gam

Câu 26. Ngâm một lá nhôm trong dung dịch CuSO4 thì sau khi phản ứng hàon toàn khối lượng lá nhôm thay đổi như thế nào? Biết rằng lượng ion SO2-4 trong dung dịch đủ kết tủa toàn toàn ion Ba2+ trong 26ml dung dịch BaCl2 0,02M

  1. Khối lượng lá nhôm giảm 0,048 gam B. Khối lượng lá nhôm tăng 0,024 gam
  2. Khối lượng lá nhôm giảm 0,024gam D. Khối lượng lá nhôm tăng 0,024gam

Câu 27. 31,2 gam hỗn hợp bột Al và Al2O3 tác dụng với dung dịch NaOH dư thoát ra 13,44 lit khí (đktc). Khối lượng mỗi chất trong hỗn hợp đầu là bao nhiêu gam?

  1. 21,6 gam Al và 9,6 gam Al2O3 B. 5,4 gam Al và 25,8 gam Al2O3
  2. 16,2 gam Al và 15,0 gam Al2O3 D. 10,8 gam Al và 20,4 gam Al2O3

Câu 28. Hoà tan hoàn toàn hợp kim Al – Mg trong dịch HCl dư thu được 8,96 lit khí (đktc). Nếu cho cùng lượng hợp kim trên tác dụng với dung dịch NaOH thì thu được 6,72 lit khí (đktc). Thành phần % khối lượng mỗi kim loại trong hợp kim là bao nhiêu?

  1. 40,0% và 60, 0% B. 69,2% và 30,8%                 C. 62,9% và 37,1%                             D. 60,2% và 32,8%

Câu 29. Xử lí 9 gam hợp kim nhôm bằng dung dịch NaOH đặc, nóng (dư) thoát ra 10,08 lit khí (đktc), còn các thành phần khác của hợp kim không phản ứng. Thành phần & khối lượng của Al trong hợp kim là bao nhiêu?

  1. 75% B. 80% C.90%                                                    D.60%

Câu 30. Hỗn hợp X gồm Al là Al4C3 tác dụng hết với nước tạo ra 31,2 gam Al(OH)3. Cùng lượng X tác dụng hết với dung dịch HCl thì thu được một muối duy nhất và thoát ra 20,16 lít khí (đktc). Khối lượng mỗi chất trong X là bao nhiêu gam?

  1. 5,4 gam Al và 7,2 gam Al4C3 B. 2,7 gam Al và 3,6 gam Al4C3
  2. 10,8 gam Al và 14,4 gam Al4C3 D. 8,1 gam Al và 10,8 gam Al4C3

Câu 31. Có ba chất Mg, Al, Al2O3 . Có thể phân biệt ba chất chỉ bằng một thuốc thử là chất nào sau đây?

  1. Dung dịch HCl B. Dung dịch HNO3 C. Dung dịch NaOH                            D. Dung dịch CuSO4

CHƯƠNG IX

CROM – SẮT

.1. SẮT

 

Câu 1. Biết cấu hình e của Fe: 1s22 s22p63 s23p63d64 s2. Xác định vị trí của Fe trong bảng tuần hoàn các nguyên tố hóa học.

Số thứ tự

Chu kỳ

Nhóm

A

26

4

VIIIB

B

25

3

IIB

C

26

4

IIA

D

20

3

VIIIA

Câu 2. Cấu hình e nào dưới đây được viết đúng?

  1. 26Fe (Ar) 4s13d7                              B. 26Fe (Ar)  4s23d4                               C. 26Fe (Ar)  3d4 4s2                              D. 26Fe (Ar)  3d5

Câu 3. Tính chất vật lý nào dưới đây không phải là tính chất vật lý của Fe?

  1. Kim loại nặng, khó nóng chảy B. Màu vàng nâu, dẻo dễ rèn. C. Dẫn điện và nhiệt tốt                     D. Có tính nhiễm từ.

Câu 4. Phương trình hóa học nào sau dây đã được viết không đúng?

  1. 3 Fe + 2O2 Fe3O4                                                                            B. 2 Fe + 3Cl2 2FeCl3

C, 2 Fe + 3I2 2FeI3                                                                                                                        D.   Fe +  S Fe S

Câu 5. Để 28 gam  bột sắt ngoài không khí một thời gian thấy khối lượng tăng lên thành 34,4 gam. Tính % khối lượng sắt đã bị oxi hóa, giả thiết sản phẩm oxi hóa chỉ là sắt từ oxi.

  1. 48,8% B. 60,0%                                               C. 81,4%                                               D. 99,9%

Câu 6. Phương trình hóa học nào dưới đây viết là đúng?

  1. 3Fe + 4H2O Fe3O4 + 4H2 B.  Fe +  H2O  FeO +  H2
  2. Fe + H2O  FeH2 + 1/2O2                                                       D. Fe + 3H2O  2FeH3 + 3/2O2

Câu 7. Để hòa tan cùng một lượng Fe, thì số mol HCl (1) và số mol H2SO4 (2) trong dd loãng cần dùng là.

  1. (1) bằng (2) B. (1) gấp đôi  (2)                                 C. (2) gấp đôi  (1)                                 D. (1) gấp ba  (2)

Câu 8. Hòa tan hết cùng một Fe trong dd H2SO4 loãng (1) và H2SO4 đặc nóng (2) thì thể tích khí sinh ra trong cùng điều kiện là:

  1. (1) bằng (2) B. (1) gấp đôi  (2)                                 C. (2) gấp rưỡi  (1)                               D. (2) gấp ba   (1)

Câu 9. Hòa tan Fe trong HNO3  dư thấy sinh ra hỗn hợp khí gồm 0,03 mol NO2 và 0,02 mol NO. Khối lượng Fe bị hóa tan bằng bao nhiêu gam?

  1. 0,56g B. 1,12g                                                 C. 1,68g                                                 D. 2,24g

Câu 10. Hòa tan hoàn toàn 1,84 gam hỗn hợp Fe và Mg trong lượng dư dung dịch HNO3 thấy thoát ra 0,04 mol khí NO duy nhất (đktc). Số mol Fe và Mg trong hỗn hợp lần lượt bằng bao nhiêu?

  1. 0,01 mol và 0,01 mol B. 0,02 mol và 0,03 mol C. 0,03 mol và 0,02 mol                    D. 0,03 mol và 0,03 mol

Câu 11. Cho 0,04mol bột Fe vào dd chứa 0,08mol HNO3 thấy thoát ra khí NO. Khi phản ứng hoàn toàn lọc dung dịch khối lượng chất rắn thu được bằng bao nhiêu gam?

  1. 3,6g B. 4,84g                                                 C. 5,4g                                                   D. 9,68g

Câu 12. Cho 0,04mol bột Fe vào dd  chứa 0,08mol HNO3 thấy thoát ra khí NO. Khi phản ứng hoàn toàn lọc dung dịch khối lượng chất rắn thu được bằng bao nhiêu gam?

  1. 3,6g B. 4,84g                                                 C. 5,96g                                                 D. 9,68g

Câu 13. Nhúng thanh Fe vào dd CuSO4 . Quan sát thấy hiện tượng gì?

  1. Thanh Fe có màu trắng và dd nhạt dần màu xanh. B. Thanh Fe có màu đỏ và dd nhạt dần màu xanh
  2. Thanh Fe có trắng xám và dd nhạt dần màu xanh. D. Thanh Fe có màu đỏ và dd có dần màu xanhư

Câu 14. Nhúng thanh Fe vào 100 ml dd Cu(NO3)2 0,1M. Đến khi phản ứng hoàn toàn thì thấy khối lượng thanh Fe.

  1. Tăng 0,08 gam B. Tăng 0, 8 gam                                 C. Giảm 0,08 gam                               D. Giảm 0,56 gam

Câu 15. Cho 0,04mol bột sắt vào dd chứa 0,07 mol AgNO3. Khi phản ứng hoàn toàn thì khối lượng chất rắn thu được bằng bao nhiêu gam?

  1. 1,12 gam B. 4,32gam                                 C. 6,48gam                                           D. 7,84gam.

Câu 16. Trường hợp nào dưới dây không có sự phù hợp giữa tên quặng sắt và công thức hợp chất săt chính có trong quặng?

  1. Hematit nâu chứa Fe2O3 B. Manhetit chứa Fe3O4 C. Xiđerit chứa FeCO3                        D. Pirit chứa FeS2

Câu 17. Nhận xét về tính chất hóa học của các hợp chất Fe (II) nào dưới đây là đúng?

Hợp chất

Tính axit- bazơ

Tính oxi hóa- khử

A

FeO

Axit

Vừa oxi hóa vừa khử

B

Fe(OH)2

Bazơ

Chỉ có tính khử

C

FeCl2

Axit

Vừa oxi hóa vừa khử

D

FeSO4

Trung tính

Vừa oxi hóa vừa khử

Câu 18. Hòa tan 2,16gam FeO trong lượng dư dung dịch HNO3 loãng thu được V lít (đktc) khi NO duy nhất. V bằng bao nhiểu?

  1. 0,224 lít B. 0,336 lít                                            C. 0,448 lít                                            D. 2,240 lít

Câu 19. Thêm dd NaOH dư vào dd chứa 0,15mol FeCl2 trong không khí. Khi các phản ứng xảy ra hoàn toàn thì khối lượng kết tủa thu được bằng bao nhiêu gam?

  1. 1,095 lít B. 1,350 lít                                            C. 1,605 lít                                            D. 13,05 lít

Câu 20. Nhận xét nào dưới đây là không đúng cho phản ứng oxi hóa hết 0,1 mol FeSO4 bàng KMnO4 trong H2SO4.

  1. Dung dịch trước phản ứng có màu tím hồng. B. Dung dịch sau phản ứng có màu vàng.
  2. Lượng KMnO4 cần dùng là 0,02mol D. Lượng H2SO4 cần dùng là 0,18mol

Câu 21. Phản ứng giữa cặp chất nào dưới đây không thể sử dụng để điểu chế các muối Fe(II)?

  1. FeO + HCl B. Fe(OH)2 + H2SO4 loãng C. FeCO3 + HNO3 loãng                     D. Fe + Fe(NO3)3

Câu 22. Phản ứng nào dưới đây không thể sử dụng để điều chế FeO?

  1. Fe(OH)2 B. FeCO3                           C. Fe(NO3)2                   D. CO + Fe2O3

Câu 23. Nhận xét về tính chất hóa học của các hợp chất Fe(II) nào dưới đây là đúng?    

Hợp chất

Tính axit- bazơ

Tính oxi hóa- khử

A

Fe2O3

Axit

Chỉ có oxi hóa

B

Fe(OH)3

Bazơ

Chỉ có tính khử

C

FeCl3

Trung tính

Vừa oxi hóa vừa khử

D

Fe2(SO4)3

Axit

Chỉ có oxi hóa 

Câu 24. Dung dịch muối FeCl3 không tác dụng với kim loại nào dưới đây?

  1. Zn B. Fe                                                       C. Cu                                                      D. Ag

Câu 25. Tính lượng I2 tạo thành khi cho dd chứa 0,2 mol FeCl3 phản ứng hoàn toàn với dd chứa 0,3 mol KI.

  1. 0,1 mol B. 0,15 mol                                           C. 0,2 mol                                             D. 0,4 mol

Câu 26. Tính khối lượng kết tủa S thu được khi thổi 3,36 lít (đktc) khí H2S qua dd chứa 0,2 mol FeCl3. Biết phản ứng xảy ra hoàn toàn.

  1. 3,2 g B. 4,8g                                                   C. 6,4g                                                   D. 9,6g

Câu 27. Dùng khí CO khử sắt (III) oxi, sản phẩm khử sinh ra có thể có những chất nào ?

  1. Fe B. Fe và FeO                                         C. Fe, FeO và Fe3O4                   D. Fe, FeO và Fe3O4 và Fe2O3

Câu 28. Thêm dd NaOH dư vào dd chứa 0,3 mol Fe(NO­3)3. Lọc kết tủa , đem nung đến khối lượng không đổi thì khối lượng chất rắn thu đựoc bằng bao nhiêu gam?

  1. 24g B. 32,1g                                                 C. 48g                                                    D. 96g

Câu 29. Để hoàn tan vừa hết 0,1 mol của mỗi oxit FeO, Fe3O4 và Fe2O3 bằng dd HCl thì lượng HCl cần dùng lần lượt bằng

  1. 0,2 mol, 0,8 mol và 0,6 mol B. 0,2 mol, 0,4 mol và 0,6 mol
  2. 0,1 mol, 0,8 mol và 0,3 mol D. 0,4 mol, 0,4 mol và 0,3 mol

                Hãy chọn đáp án đúng

Câu 30. Hiện tường nào dưới dây được mô tả không đúng?

  1. Thêm NaOH vào dd FeCl3 màu vàng nâu thấy xuất hiện kết tủa đỏ nâu.
  2. Thêm một ít bột Fe vào lượng dư dd AgNO3 thấy xuất hiện dd màu vàng nhạt.
  3. Thêm Fe(OH)2 màu đỏ nâu vào dd H2SO4 thấy hình thành dd màu vàng nâu.
  4. Thêm Cu vào dd Fe(NO3)3 thấy dd chuyển từ màu vàng nâu sang màu xanh.

Câu 31. Phản ứng nào dưới đây không tạo sản phẩm là hợp chất Fe(III)?

  1. FeCl3 + NaOH ® B. Fe(OH)3
  2. FeCO3                                 D. Fe(OH)3 + H2SO4

Câu 32. Cho biết hiện tượng xảy ra khi trộn lẫn các dd FeCl3 và Na2CO3              

  1. Kết tủa trắng B. Kết tủa đỏ nâu C. Kết tủa đỏ nâu và bị sủi bọt         D. Kết tủa trắng và bị sủi bọt

Câu 33. Trong bốn hợp kim của Fe với C (ngoài ra còn có lượng nhỏ Mn, Si, P, S..) với hàm lượng C tương ứng là : 0,1% (1); 1,9%(2); 2,1%(30 và 4,9%(4) thì hợp kim nào là gang và hợp kim nào là thép?                           

Gang

Thép

A

(1), (2)

(3), (4)

B

(3), (4)

(1), (2)

C

(1), (3)

(2), (4)

D

(1), (4)

(2), (3)

Câu 34. Thành phần nào dưới dây là không cần thiết trong quá trình sản xuất gang?

  1. Quặng sắt (chứa 3095% oxi sắt, không chứa hoặc chứa rất ít S, P)
  2. Than cốc (không có trong tự nhiên, phải điều chến từ than mỡ)
  3. Chất chảy (CaCO3, dùng để tạo xỉ silicat)
  4. Gang trắng hoặc gang xám, sắt thép phế liệu.

Câu 35. Chất nào dưới dây là chất khử oxi sắt trong lò cao?

  1. H2 B. CO                                                     C. Al                                                       D. Na

Câu 36. Trường hợp nào dưới dây không có sự phù hợp giữa nhiệt độ (0C) và phản ứng xảy ra trong lò cao?              

A

1800

C+ CO2 ® 2CO

B

400

CO + 3 Fe2O3 ® 2Fe3O4 + CO2

C

500-600

CO + Fe3O4 ® 3FeO + CO2

D

900-1000

CO +FeO ® Fe + CO2

Câu 37. Thổi khí CO đi qua 1,6g Fe2O3 nung nóng đến phản ứng hoàn toàn. Khối lượng Fe thu được là bao nhiêu?

  1. 0,56g B. 1,12g                                                 C. 4,8g                                                   D. 11,2g

Câu 38. Thổi 0,3mol CO  qua 0,2g Fe2O3  đến phản ứng hoàn toàn. Khối lượng chất thu được là bao nhiêu?

A.5 ,6g                                                   B. 27,2g                                                 C. 30,9g                                                 D. 32,2g

Câu 39. Cần bao nhiêu tấn quặng manhetit chứa 80% Fe3O4 để có thể luyện được 800 tấn gang có hàm lượng sắt 95% ?Lượng sắt bị hoa hụt trong sản xuất là 1%.

  1. 1325,16 tấn B. 2 351,16 tấn                                    C. 3512,61 tấn                                     D. 5213,61 tấn

Câu 40. Thành phần nào sau đây không phải nguyên liệu cho quá trình luyện thép?

  1. Gang, sắt thép phế liệu B. Khí nitơ và khí hiếm. C. Chất chảy là canxi oxit         D. Dầu ma dút hoặc khí đốt.

Câu 41.Phát biểu náo dưới đây cho biết bản chất của quá trình luyện thép?

  1. Oxi hóa các nguyên tố trong gang thành oxit, loại oxit dưới dạng khí hoặc xỉ. B. Điện phân dd muối sắt (III)
  2. Khử hợp chất của kim lọai thành kim loại tự do. D. Khử quặng sắt thành sắt tự do

Câu 42. Nhóm phản ứng mô tả một phần quá trình luyện thép nào dưới đây là không chính xác?

A.  C + O2 ® CO2

S + O2 ® SO2

B. Si + O2 ® SiO2

4P + 3O2 ® 2P2 O3

C.  4Fe + 3O2 ® 2Fe2 O3

2Mn + O2 ® 2MnO

D.   CaO + SiO2 ® CaSiO3

3CaO+ P2O5 ® Ca3(PO4)2 

MnO + SiO2 ® MnSiO3

Câu 43. Có ba lọ đựng hỗn hợp Fe + FeO; Fe + Fe2O3 và FeO + F2O3 . Giải pháp lần lượt dùng các thuốc thử nào dưới đây có thể phân biệt ba hỗn hợp này?

  1. Dùng dd HCl, sau đó thêm NaOH vào dd thu được. B. dd H2SO4 đậm đặc, sau đó thêm NaOH vào dd thu được.
  2. Dung dịch HNO3 đậm đặc, sau đó thêm NaOH vào dd thu được. D. Thêm dd NaOh, sau đó thêm tiếp dd H2SO4 đậm đặc.

Câu 44. Cho 20g hỗn hợp Fe và Mg tác dụng hết với dd HCl thấy có 1,0g khí hiđro thoát ra . Đem cô cạn dung dịch sau phản ứng thì thu được bao nhiêu gam muối khan.

  1. 50g B. 55,5g                                                 C. 60g                                                    D. 60,5g.

Câu 45. Đốt một kim loại trong bình chứa khí Clo thu được 32,5gam muối, đồng thời thể tích clo trong bình giảm 6,72 lít (đktc). Kim loại bị đốt là kim loại nào?

  1. Mg B. Al                                                       C. Fe                                                       D. Cu

Câu 46. Ngâm một lá kim loại nặng 50g trong dd HCL, sau khi thoát ra 336 ml khí (đktc) thì khối lượng lá kim loại giảm 1,68%. Nguyên tố kim loại đã dùng là nguyên tố nào ?

  1. Mg B. Al                                                       C. Zn                                                      D. Fe

Câu 47. Dung dịch chứa 3,25gam muố clorua của một kim loại chưa biết phản ứng với dd AgNO3 dư tách  ra 8,61 gam kết tủa trắng. Công thức của muối clorua kim loại là công thức nào sau đây?

  1. MgCl2 B. FeCl2                                                 C. CuCl2                                                                D. FeCl3

Câu 48. Khi cho 11,2 gam Fe tác dụng với Cl2 dư thu được m1 gam muối, còn nếu cho 11,2 gam Fe tác dụng với dd HCl dư thì thù được m2 gam muối. Kết quả tính giá trị của m1 và m2 là bao nhiêu?

  1. m1=m2=25,4g B. m1=25,4g và m2=26,7g C. m1=32,5g và m2=24,5g                  D.m1=32,5g và m2=25,4

Câu 49. Trong số các loại quặng sắt : FeCO3 (xiđerit), Fe2O3 (hematit), Fe3O4 (manhetit), FeS2 (pirit). Quặng chứa hàm lượng % Fe lớn nhất là?

  1. FeCO3 B. Fe2O3 C. Fe3O4                                                 D.FeS2

Câu 50. Trong số các loại quặng sắt: FeCO3  (xiđerit), Fe2O3 (hematit), Fe3O4 (manhetit), FeS2 (pirit). Quặng chứa hàm lượng % Fe nhỏ nhất là?

  1. FeCO3 B. Fe2O3 C. Fe3O4                                                 D.FeS2

Câu 51. Tên của các quặng chứa FeCO3  , Fe2O3 , Fe3O4 , FeS2 lần lượt là

  1. Hematit, pirit, manhetit, xiđerit B. Xiđerit, manhetit, pirit, hematit,
  2. Xiđerit , hematit , manhetit, pirit. D. Pirit, hematit, manhetit ,  xiđerit

Câu 52. Trong các phản ứng sau , phản ứng nào không phải là phản ứng oxi hóa- khử.

  1. Fe + 2 HCl ® FeCl2+ H2                 B. 2Fe + 3Cl2 ® 2FeCl3
  2. Fe + CuCl2 ® FeCl2 + Cu D. FeS+ 2 HCl ® FeCl2+ H2S

Câu 53. Chia đôi một hỗn hợp Fe và F2O3, cho một luồng khí CO đi qua phần thứ nhất nung nóng thì khối lượng chất rắn giảm đi 4,8 g. Ngâm phần thứ hai trong dd HCl dư thấy thoát ra 2,24 lít khí (đktc). Thành phần % khối lượng mỗi chất trong hỗn hợp là.

  1. 48,83% Fe và 51,17% Fe2O3 B. 41,83% Fe và 58,17% Fe2O3
  2. 41,17% Fe và 58,83% Fe2O3 D. 48,17% Fe và 51,83% Fe2O3

 Câu 54. Câu nào sau đây là đúng?

  1. Ag có khả năng ta trong dd FeCl3 B. Cu có khả năng ta trong dd FeCl3
  2. Cu có khả năng ta trong dd PbCl2 D. Cu có khả năng ta trong dd FeCl2

Câu 55. Câu nào sau đây không đúng?

  1. Ag có khả năng ta trong dd FeCl3 B. Cu có khả năng ta trong dd FeCl3
  2. Fe có khả năng ta trong dd CuCl2 D. Ag có khả năng ta trong dd FeCl3

Câu 56. Đốt nóng hỗn hợp gồm bột Al và Fe3O4 (không có không khí) đến phản ứng hòan toàn. Chia đôi chất rắn thu đựơc, một phần hòa tan bằng dd NaOH dư thoát ra 6,72 lít khí (đktc), phần còn lại hòa tan trong dd HCl dư thoát ra 26,88 lít khí (đktc). Số gam mỗi chất trong hỗn hợp ban đầu là bao nhiêu.

  1. 27gam Al và 69,6 gam Fe3O4. B.  54 gam Al và 139,2gam Fe3O4.
  2. 36 gam Al và 139,2 gam Fe3O4. D.  72 gam Al và 104,4 gam Fe3O4.

Câu 57. Khử hoàn toàn 16 gam bột oxi sắt bằng CO ở nhiệt độ cao. Sau phản ứng khối lượng khí tăng thêm 4,8 gam. Công thức của oxi sắt là công thức nào sau đây?

  1. FeO B. FeO2                                                  C. Fe2O3                                                 D. Fe3O4

Câu 58. Khử 9,6 gam một hỗn hợp gồm Fe2O3 và FeO bằng khí hiđro ở nhiệt độ cao thu được sắt kim loại và 2,88 gam nước. Thành phần % khối lượng các chất trong hỗn hợp là.

  1. 53,34% FeO và 46,66% Fe2O3 B. 43,34% FeO và 56,66% Fe2O3
  2. 40,00% FeO và 50,00% Fe2O3 D.70,00% FeO và 30,00% Fe2O3

Câu 59. Hòa tan 3,04 gam hỗn hợp bột kim loại sắt và đồng trong axit nitric loẵng thu được 0,896 lít (đktc) khí NO duy nhất. Thành phần % khối lượng mỗi kim loại là bao nhiêu?

  1. 36,2% Fe và 63,8 % Cu C. 36,8% Fe  và 63,2 % Cu               B. 63,2% Fe  và 36,8 % Cu          D. 33,2% Fe  và 66,8 % Cu

Câu 60. Hỗn hợp bột Fe, Al, Al2O3 . Nếu ngâm 16,1 gam hỗn hợp trong dd NaOH dư thoát ra 6,72 lít khí (đktc) và còn một chất rắn. Lọc lay chất rắn đem hòa tan bằng dd HCl 2M thì cần dùng 100 ml dd HCl. Thành phần % khối lượng mỗi chất trong hỗn hợp là bao nhiêu?

  1. 35,34%Al; 37,48% Fe và 27,18 % Al2O3 B. 33,54%Al; 33,78% Fe  và 32,68 % Al2O3
  2. 34,45%Al; 38,47% Fe và 27,08 % Al2O3 D. 32,68%Al; 33,78% Fe  và 33,54 % Al2O3

Câu 61. Hòa tan 10gam hỗn hợp bột Fe và FeO bằng một lượng dd HCl vừa đủ thấy thoát ra 1,12 lít khí (đktc). Dung dịch thu được cho tác dụng với dd NaOH dư, lọc kết tủa tách ra đem nung trong không khí đến lượng không đổi thu được chất rắn nặng m gam .Trị số của m là bao nhiêu?

  1. 8 B. 16                                                      C. 10                                                      D. 12.

Câu 62. Hòa  tan m gam hỗn hợp bột Fe và FeO bằng một lượng dd HCl vừa đủ thấy  thoát ra 1,12 lít khì (đktc). Dung dịch thu được cho tác dụng với dd NaOH dư, lọc kết tủa tách ra đem nung trong không khí đến lượng không đổi thu được chất rắn nặng 12 gam . Trị số của m là bao nhiêu?

  1. 16 B. 10                                                      C. 8                                                         D. 12.

Câu 63. Hòa  tan 10 gam hỗn hợp bột Fe và FeO bằng một lượng dd HCl vừa đủ thấy thoát ra 1,12 lít khì (đktc). Dung dịch thu được cho tác dụng với dd NaOH dư, lọc kết tủa tách ra đem nung trong không khí đến lượng không đổi thu được chất rắn nặng 12 gam. Thành phần % khối lượng các chất trong hỗn hợp là:

  1. 22% Fe và 78% FeO B. 56% Fe và 44% FeO C. 28% Fe và 72% FeO                      D.64% Fe và 36% FeO

Câu 64. Cho sắt kim loại tác dụng với dd axit sunfuric loãng, sau đó cho bay hơi hết nước của dd thu được thì còn lại 55,6 gam tinh thể FeSO4.7H2O. Thể tích hiđro thoát ra (đktc) khi Fe tan là bao nhiêu lít?

  1. 2,24 lít                 B. 4,48 lít                                              C. 3,36 lít                                              D. 5,60 lít

Câu 65. Trong dd có chứa các cation K+, Ag+, Fe2+, Ba2+ và một anion. Anion đó là anion nào sau đây?

  1. Cl B. NO3                                                   C. SO­42-                                                 D. CO32-

Câu 66. Hòa tan một lượng FeSO4.7H2O trong nước để được 300 ml dd .Thêm H2SO4 vào 20ml dd trên thì dd hỗn hợp thu được làm mất màu 30 ml dd KMnO4 0,1M. Khối lượng FeSO4.7H2O ban đầu là bao nhiêu gam?

  1. 65,22gam B. 62,55gam                                         C.  4,15gam                                          D.  4,51gam

Câu 67. Hòa tan 27,2 gam hỗn hợp bột Fe và FeO trong dd axit sunfuric loãng sau đó làm bay hơi dd thu được 111,2 gam FeSO4.7H2O . Thành phần % khối lượng các chất trong hỗn hợp là bao nhiêu?

  1. 29,4%Fe và 70,6%FeO B. 24,9%Fe và 75,1%FeO C. 20,6%Fe và 79,4%FeO            D. 26,0%Fe và 74,0%FeO

Câu 68. Một hỗn hợp bột Fe và Fe2O3 đem chia đôi. Cho khí CO dư đi qua phần thứ nhất ở nhiệt độ cao thì khối lượng chất rắn giảm đi 4,8g. Ngâm phần thứ hai trong dd CuSO4 dư thì sau phản ứng khối lượng chất rắn tăng thêm 0,8 gam. Khối lượng hỗn hợp ban đầu là bao nhiêu gam?

  1. 13,6gam B.  27,2gam                                          C. 16,3gam                                           D. 22,7gam

Câu 69. Một dd có hòa tan 16,8 gam NaOH tác dụng với dd có màu hòa tan 8 gam Fe2(SO4)3, sau đó lại thêm vào dd trên 13,68 gam Al2(SO403. Sau phản ứng, lọc dd thu được kết tủa, đem nung kết tủa đến khối lượng không đổi còn lại chất rắn X. Thành phần định tính và định lượng của chất rắn X là.

  1. 6,4 gam Fe2O3 va 2,04 gam Al2O3 B. 2,88 gam Fe2O3 va 2,04 gam Al2O3
  2. 3,2 gam Fe2O3 va 1,02 gam Al2O3 D. 1,44 gam Fe2O3 va 1,02 gam Al2O3

Câu 70. Một dd có hòa tan 16,8gam NaOH tác dụng với dd có hòa tan 8gam Fe2(SO4)3 , sau đó lại thêm vào dd trên 13,68gam Al2(SO4)3 . Sau các  phản ứng , lọc bỏ kết tủa, pha loãng nước lọc thành 500ml . Nồng độ mol của mỗi chất trong 500ml nước lọc là bao nhiêu mol/lit.

  1. 0,18 mol Na2SO4 và 0,06M NaOH B. 0,36 mol Na2SO4 và 0,12M NaOH
  2. 0,18 mol Na2SO4 và 0,06M NaAlO2 D. 0,36 mol Na2SO4 và 0,12M NaAlO2

Câu 71. Hòa tan một đinh thép có khối lượng 1,1,4 gam trong dd axit sunfuric loãng dư, lọc bỏ phần không tan và chuẩn độ nước lọc bằng dd KMnO4 0,1M cho đến khi nước lọc xuất hiện màu hồng thì thể tích dung dịch KMnO4  đã dùng hết 40 ml. Thành phần % khối lượng Fe trong đinh thép là bao nhiêu?

  1. 91,5% B. 92,8%                                               C. 95,1%                                               D. 98,2%

Câu 72. Khử 4,8gm một oxit kim loại ở nhiệt độ cao cần 2,016lít hiđro (đktc). Kim loại thu được đem hòa tan hết trong dd HCl thoát ra 1,344 lít khí (đktc) . Công thức hóa học của oxit kim loại là công thức nào sau đây?

  1. CuO B. MnO2                                                                C. Fe3O4                                                 D. Fe2O3

Câu 73. Cho 4,72 gam hỗn hợp bột các chất Fe, FeO, Fe2O3 tác dụng với CO dư ở nhiệt độ cao, sau phản ứng thu được 3,92gam Fe. Nếu ngâm chúng cùng lượng hỗn hợp ban đầu trong dd CuSO4 dư thì sau phản ứng khối lượng chất rắn thu được bằng 4,96gam. Khối lượng mỗi chất trong hỗn hợp ban đầu là bao nhiêu gam?

  1. 0,84gam Fe; 0,72gam FeO; 0,8gam Fe2O3 B. 1,68gam Fe; 0,72gam FeO; 1,6gam Fe2O3
  2. 1,68gam Fe;1,44gam FeO; 1,6gam Fe2O3 D. 1,68gam Fe; 1,44gam FeO; 0,8gam Fe2O3

 

 

 

C.2. CROM

Câu 1. Trong cá câu sau đây, câu nào không đúng?

  1. Crom là kim loại có tính khử mạnh hơn sắt
  2. Crom là kim loại nên chỉ tạo được oxit bazơ

                C.Crom có những  tính chất hóa học giống nhôm

  1. Crom có những hợp chất giống hợp chất của lưu huỳnh.

Câu 2. Trong các câu sau đây, câu nào đúng?

  1. Crom là kim loại có tính khử mạnh hơn sắt
  2. Crom là kim loại nên chỉ tạo được oxit bazơ
  3. Trong tự nhiên, crom có ở dạng đơn chất.
  4. Phương pháp điều chế crom là điện phân Cr2O3 nóng chảy.

Câu 3. Trong các cấu hình e của nguyên tử và ion crom sau đây, cấu hình e nào không đúng?

  1. 24Cr: (Ar)3d54s1 B. 24Cr: (Ar)3d4
  2. 24Cr2+: (Ar)3d4s2 D. 24Cr3+: (Ar)3d3

Câu 4. Trong các cấu hình e của nguyên tử và ion crom sau đây, cấu hình e nào  đúng?

  1. 24Cr: (Ar)3d44s2 B. 24Cr2+: (Ar)3d2s4
  2. 24Cr2+: (Ar)3d2s2 D. 24Cr3+: (Ar)3d3

Câu 5. Cho 100 gam hợp kim của Fe, Cr, Al tác dụng với dd NaOH dư thoát ra 5,04 lít khí (đktc) và một phần rắn không tan. Lọc lấy phần không tan đem hòa tan hế bằng dd HCl dư (khong có không khí) thoát ra 38,8lít khí (đktc).Thành phần % khối lượng các chất trong hợp kim là bao nhiêu?

  1. 13,66% Al; 82,29Fe và 4,05%Cr
  2. 4,05% Al; 83,66Fe và 12,29%Cr
  3. 4,05% Al; 82,29Fe và 13,66%Cr
  4. 4,05% Al; 13,66Fe và 82,29%Cr

Câu 6. Phát biểu nào dưới đây không đúng?

  1. Crom là nguyên tố thuộc ô thứ 24 , chu kỳIV, nhóm VIB, có cấu hình e [Ar]3d54s1
  2. Nguyên tử khối crom là 51,996; cấu trúc tinh thể lập phương tâm diện.
  3. Khác với kim loại phân nhóm chính, crom có thể tham gia liên kết bằng e của cả phân lớp 4s và 3d.
  4. Trong hợp chất , crom có các mức oxi hóa đặt trưng là +2, +3 và +6

Câu 7. Phát biểu nào dưới đây không đúng?

  1. Crom có màu trắng, ánh bạc, dễ bị mờ đi trong không khí.
  2. Crom là một kim loại cứng (chỉ thua kim cương), cắt đựoc thủy tinh.
  3. Crom là kim loại khí nóng chảy (nhiệt độ nóng chảy là 18900C)
  4. Crom thuộc kim loại nặng (khối lượng riêng là 7,2g/cm3)

Câu 8. Phản ứng nào sau đây không đúng?

  1. Cr + 2 F2 ® CrF4 B. 2Cr + 3Cl2  2CrCl3                
  2. 2Cr + 2 S Cr2Cl3                      D. 3Cr + N2  Cr3N2                     

Câu 9. Đốt cháy bột crom trong oxi dư thu được 2,28g một oxit duy nhất. Khối lượng crom bị đốt cháy là bao nhiêu gam?

                A.0,78g                  B. 1,56g C. 1,74g D. 1,19g

Câu 10. Hòa tan hết 1,08gam hỗn hợp Cr và Fe trong dd HCl loãng, nóng thu được 448 ml (đktc) . Khối lượng crom có trong  hỗn hợp là bao nhiêu gam?

  1. 0,065g B. 0,520g                               C. 0,56g                 D. 1,015g

Câu 11. Tính khố lượng bột nhôm cấn dùng để có thể điều chế được 78g crom bằng phương pháp nhiệt nhôm.

  1. 20,25g B. 35,695g                            C. 40,500g                            D. 81,000g.

Câu 12. Giải thích ứng dụng của crom nào dưới đây là không hợp lý?

  1. Crom là kim loại cứng nhất, có thể dùng để cắt thủy tinh
  2. Crom là hợp kim cứng và chịu nhiệt hơn nên dùng để tạo thép cứng không gỉ, chịu nhiệt.
  3. Crom là kim loại nhẹ, nên được sử dụng các hợp kim dùng trong ngành hàng không.
  4. Điều kiện thường, crom tạo được lớp màng oxit mịn, bền chắc nên crom được dùng để mạ bảo vệ thép.

Câu 13. Nhận xét nào dưới đây không đúng?

  1. Hợp chất Cr (II) có tính khử đặc trưng, Cr(III) vừa có tính oxi hóa, vừa có tính khử, Cr(VI) có tính oxi hóa.
  2. CrO, Cr(OH)2 có tính bazơ; Cr2O3; Cr(OH)3 lưỡng tính.
  3. Cr2+; Cr3+ trung tính; Cr(OH)4 có tính bazơ.
  4. Cr(OH)2; Cr(OH)3, CrO3 có thể bị nhiệt phân.

Câu 14. Thêm 0,02 mol NaOH vào dd chứa 0,01 mol CrCl3 rồi để trong không khí đến phản ứng hoàn toàn thì khối lượng kết tủa cuối cùng thu được là bao nhiêu gam?

  1. 0,86g B. 1,03g                 C. 1,72g                 D. 2,06g

Câu 15. Lượng Cl2 và NaOH tương ứng được sử dụng để oxi hóa hoàn toàn 0,01 mol CrCl3 thành CrO42- là bao nhiêu?

  1. 0,015 mol và 0,08mol B. 0,030 mol và 0,16mol
  2. 0,015 mol và 0,10mol D. 0,030 mol và 0,14mol

Câu 16. So sánh nào dưới đây không đúng?

  1. Fe(OH)2 và Cr(OH) đều là bazơ và là chất khử.
  2. Al(OH)3 và Cr(OH)23 đều là chất lưỡng tính và vừa có tính oxi hóa vừa có tính khử.
  3. H2SO4 và H2CrO4 đều là axit có tính oxi hóa mạnh.
  4. BaSO4 và BaCrO4 đều là những chất không tan trong nước.

Câu 17. Hiện tượng nào dưới đây đã được mô tả không đúng?

  1. Thổi khí NH3 qua CrO3 đun nóng thấy chất rắn chuyển từ màu đỏ sang màu lục thẫm.
  2. Đun nóng S với K2Cr2O7 thấy chất rắn chuyển từ màu da cam sang màu lục thẫm.

                C Nung Cr(OH)2 trong không khí thấy chất rắn chuyển từ màu lục sáng sang màu thẫm.

  1. Đốt CrO trong không khí thấy chất rắn chuyển từ màu đen sang màu thẫm.

Câu 18. Thổi khí NH3 dư qua 1 gam CrO3 đốt nóng đến phản ứng hoàn toàn thì thu được lượng chất rắn bằng bao nhiêu gam?

                A.0,52g                  B. 0,68g                 C. 0,76g                 D. 1,52g

Câu 19. Khối lượng kết tủa S tọ thành khi dùng H2S khử dung dịch chứa 0,04 mol K2Cr2O7 trong H2SO4 dư là bao nhiêu gam?

                A.0,96g                  B. 1,92g                 C. 3,84g                 D. 7,68g

Câu 20. Lượng HCl và K2Cr2O7 tương ứng cần sử dụng để điều chế 672 ml khí Cl2 (đktc) là bao nhiêu?

  1. 0,06mol và 0,03mol B. 0,14mol và 0,01mol
  2. 0,42mol và 0,03mol                D. 0,16mol và 0,01mol

Câu 21. Hiện tượng nào dưới đây được mô tả không đúng?

  1. Thêm lượng dư NaOH vào dd K2Cr2O7 thì dd chuyển từ màu da cam sang màu vàng.
  2. Thêm lượng dự NaOH và Cl2 vào dd CrCl2 thì dd từ màu xanh chuyển thành màu vàng.
  3. Thêm từ từ dd NaOH vào dd CrCl3 thấy xuất hiện kết tủa vàng nâu tan lại được trong dd NaOH dư.
  4. Thêm từ từ dd HCl vào dd Na[Cr(OH)4] thấy xuất hiện kết tủa lục xám, sau đó lại tan.

Câu 22. Giải pháp điều chế nào dưới đây không hợp lý?

  1. Dùng phản ứng K2Cr2O7 bằng than họăc lưu huỳnh để điều chế Cr2O3
  2. Dùng phản ứng của muối Cr (II) với dd kiềm dư để điều chế Cr(OH)2
  3. Dùng phản ứng của muối Cr (III) với dd kiềm dư để điều chế Cr(H)3
  4. Dùng phản ứng của H2SO4 đặc với dd K2Cr2O7 để điều chế CrO3

ĐÁP ÁN

1

2

3

4

5

6

7

8

9

10

11

12

13

14

15

B

A

C

D

C

B

A

A

B

B

C

A

C

B

A

16

17

18

19

20

21

22

B

C

C

C

B

C

C

PHẦN BA:

ĐỀ THI MINH HỌA THEO “CẤU TRÚC ĐỀ THI TRẮC NGHIỆM KHÁCH QUAN”

DO CỤC KHẢO THÍ VÀ KIỂM ĐỊNH CHẤT LƯỢNG GIÁO DỤC ĐỀ XUẤT

CẤU TRÚC ĐỀ THI TRẮC NGHIỆM

(Kèm theo công văn số: 155/BGDĐT-KT&KĐ,

ngày 05 tháng 01 năm 2007 của Bộ Giáo dục và Đào tạo)

 

  1. Thi tốt nghiệp THPT (chương trình không phân ban và bổ túc THPT)

Tổng số câu hỏi: 40 câu- Thời gian làm bài 60 phút

  1. Rượu – Phenol- Amin (3 câu)
  2. Anđehit- Axit- Este (4 câu)
  3. Glixerin- Lipit (1 câu)
  4. Gluxit (2 câu)
  5. Aminoaxit và protit (1 câu)
  6. Hợp chất cao phân tử và vật liệu polime (2 câu)
  7. Nội dung tổng hợp các chương trình Hóa hữu cơ (7 phong)
  8. Đại cương về kim loại (4 câu)
  9. Kim loại các phân nhóm chinh I (2 câu), II (2 câu) và Al (2 câu).
  10. Sắt (3 câu)
  11. Nội dung tổng hợp các chương của hóa vô cơ và đại cương (7 câu)
  12. Thi tốt nghiệp THPT (chương trình phân ban)

Tổng số câu hỏi: 40 câu- Thời gian làm bài :60 phút

  1. Phần chung cho các thí sinh : (33 câu)
  2. Cacbonhđrat (2 câu)
  3. Amin-Amino axit- Protein (3 câu)
  4. Polime – Vật liệu polime (2 câu)
  5. Đại cương kim loại (4 câu)
  6. Kim loại kiềm, kiềm thổ- Nhôm (6 câu)
  7. Crom- Sắt- Đồng. Hóa học và vấn đề phát triển kinh tế, xã hội, môi trường (4 câu)
  8. Tổng hợp các kiến thức hóa vô cơ thuộc chương trình THPT (6 câu)
  9. Tổng hợp các kiến thức Hóa hữu cơ thuộc chương trình THPT (6 câu)
  10. Phần dành cho thí sinh chương trình ban KHTN: (7 câu)
  11. Xeton (1 câu)
  12. Dãy thế điện cực chuẩn của kim loại (2 câu)
  13. Bạc, vàng, niken, kẽm, thiếc, chì (1 câu)
  14. Phân tích hóa học (1 câu)
  15. Tổng hợp các kiến thức hóa học vô cơ thuộc phần riêng (2 câu)
  16. Phần dành cho thí sinh chương trình ban KHXH &NV(7 câu)
  17. Ancol- Phenol (2 câu)
  18. Anđehit- Axit cacbonxylic (2 câu)
  19. Eset – Lipit (1 câu)
  20. Tổng hợp các kiến thức hóa học hữu cơ thuộc phần riêng (2 câu)

III. Thi tuyển sinh đại học và cao đẳng

Tổng số câu hỏi: 50 câu- Thời gian làm bài :90 phút

  1. Phần chung cho các thí sinh : (44 câu)
  2. Nguyên tử, bảng tuần hoàn các nguyên tố hóa học . Liên kết hóa học (2 câu)
  3. Phản ứng oxi hóa- khử. Cân bằng hóa h ọc (2 câu)
  4. Sự điện ly (2 câu)
  5. Phi kim (2 câu)
  6. Đại cương kim loại (2 câu)
  7. Kim loại cụ thể (nhó IA, IIA, Al, Fe) (6 câu)
  8. Đại cương hóa hữu cơ. Hiđrocacbon (2 câu)
  9. Rượu (Ancol)- Phenol (3 câu)
  10. Anđehit, axit cacboxylic (3 câu)
  11. Este- Lipit (3 câu)
  12. Amin- Amino axit – Protit (protein) (2 câu)
  13. Gluxit (cacbonhiđrat) (2 câu)
  14. Hợp chất cao phân tử (polime). Vật liệu polime (1 câu)
  15. Tổng hợp các kiến thức

LEAVE A REPLY

Please enter your comment!
Please enter your name here

LEAVE A REPLY

Please enter your comment!
Please enter your name here